Added application-mgt UI feature
@ -0,0 +1,62 @@
|
|||||||
|
<?xml version="1.0" encoding="UTF-8"?>
|
||||||
|
<!--
|
||||||
|
~ Copyright (c) 2014, WSO2 Inc. (http://www.wso2.org) All Rights Reserved.
|
||||||
|
~
|
||||||
|
~ WSO2 Inc. licenses this file to you under the Apache License,
|
||||||
|
~ Version 2.0 (the "License"); you may not use this file except
|
||||||
|
~ in compliance with the License.
|
||||||
|
~ you may obtain a copy of the License at
|
||||||
|
~
|
||||||
|
~ http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
~
|
||||||
|
~ Unless required by applicable law or agreed to in writing,
|
||||||
|
~ software distributed under the License is distributed on an
|
||||||
|
~ "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||||
|
~ KIND, either express or implied. See the License for the
|
||||||
|
~ specific language governing permissions and limitations
|
||||||
|
~ under the License.
|
||||||
|
-->
|
||||||
|
|
||||||
|
<project xmlns="http://maven.apache.org/POM/4.0.0" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:schemaLocation="http://maven.apache.org/POM/4.0.0 http://maven.apache.org/xsd/maven-4.0.0.xsd">
|
||||||
|
|
||||||
|
<parent>
|
||||||
|
<artifactId>application-mgt</artifactId>
|
||||||
|
<groupId>org.wso2.carbon.devicemgt</groupId>
|
||||||
|
<version>2.0.63-SNAPSHOT</version>
|
||||||
|
<relativePath>../pom.xml</relativePath>
|
||||||
|
</parent>
|
||||||
|
|
||||||
|
<modelVersion>4.0.0</modelVersion>
|
||||||
|
<artifactId>org.wso2.carbon.device.application.mgt.ui</artifactId>
|
||||||
|
<packaging>pom</packaging>
|
||||||
|
<version>2.0.63-SNAPSHOT</version>
|
||||||
|
<name>WSO2 Carbon - Application Management Base UI</name>
|
||||||
|
<description>WSO2 Carbon - Application Management Base UI</description>
|
||||||
|
<url>http://wso2.org</url>
|
||||||
|
|
||||||
|
<build>
|
||||||
|
<plugins>
|
||||||
|
<plugin>
|
||||||
|
<artifactId>maven-assembly-plugin</artifactId>
|
||||||
|
<version>2.5.5</version>
|
||||||
|
<configuration>
|
||||||
|
<finalName>${project.artifactId}-${carbon.device.mgt.version}</finalName>
|
||||||
|
<appendAssemblyId>false</appendAssemblyId>
|
||||||
|
<descriptors>
|
||||||
|
<descriptor>src/assembly/src.xml</descriptor>
|
||||||
|
</descriptors>
|
||||||
|
</configuration>
|
||||||
|
<executions>
|
||||||
|
<execution>
|
||||||
|
<id>create-archive</id>
|
||||||
|
<phase>package</phase>
|
||||||
|
<goals>
|
||||||
|
<goal>single</goal>
|
||||||
|
</goals>
|
||||||
|
</execution>
|
||||||
|
</executions>
|
||||||
|
</plugin>
|
||||||
|
</plugins>
|
||||||
|
</build>
|
||||||
|
|
||||||
|
</project>
|
||||||
@ -0,0 +1,48 @@
|
|||||||
|
<!--
|
||||||
|
~ Copyright (c) 2016, WSO2 Inc. (http://www.wso2.org) All Rights Reserved.
|
||||||
|
~
|
||||||
|
~ WSO2 Inc. licenses this file to you under the Apache License,
|
||||||
|
~ Version 2.0 (the "License"); you may not use this file except
|
||||||
|
~ in compliance with the License.
|
||||||
|
~ You may obtain a copy of the License at
|
||||||
|
~
|
||||||
|
~ http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
~
|
||||||
|
~ Unless required by applicable law or agreed to in writing,
|
||||||
|
~ software distributed under the License is distributed on an
|
||||||
|
~ "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||||
|
~ KIND, either express or implied. See the License for the
|
||||||
|
~ specific language governing permissions and limitations
|
||||||
|
~ under the License.
|
||||||
|
-->
|
||||||
|
|
||||||
|
<assembly
|
||||||
|
xmlns="http://maven.apache.org/plugins/maven-assembly-plugin/assembly/1.1.0"
|
||||||
|
xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance"
|
||||||
|
xsi:schemaLocation="http://maven.apache.org/plugins/maven-assembly-plugin/assembly/1.1.0 http://maven.apache.org/xsd/assembly-1.1.0.xsd">
|
||||||
|
<id>src</id>
|
||||||
|
<formats>
|
||||||
|
<format>zip</format>
|
||||||
|
</formats>
|
||||||
|
<includeBaseDirectory>false</includeBaseDirectory>
|
||||||
|
<baseDirectory>${basedir}/src</baseDirectory>
|
||||||
|
<fileSets>
|
||||||
|
<fileSet>
|
||||||
|
<!-- CDMF base app -->
|
||||||
|
<directory>${basedir}/src/main/resources/jaggeryapps/application-mgt</directory>
|
||||||
|
<outputDirectory>/jaggeryapps/application-mgt/</outputDirectory>
|
||||||
|
<useDefaultExcludes>true</useDefaultExcludes>
|
||||||
|
</fileSet>
|
||||||
|
<fileSet>
|
||||||
|
<!-- UUF framework app -->
|
||||||
|
<directory>${basedir}/src/main/resources/jaggeryapps/uuf-template-app</directory>
|
||||||
|
<outputDirectory>/jaggeryapps/appmgt-uuf-template-app/</outputDirectory>
|
||||||
|
<useDefaultExcludes>true</useDefaultExcludes>
|
||||||
|
</fileSet>
|
||||||
|
<fileSet>
|
||||||
|
<directory>${basedir}/src/main/resources/jaggery-modules</directory>
|
||||||
|
<outputDirectory>/jaggery-modules/</outputDirectory>
|
||||||
|
<useDefaultExcludes>true</useDefaultExcludes>
|
||||||
|
</fileSet>
|
||||||
|
</fileSets>
|
||||||
|
</assembly>
|
||||||
@ -0,0 +1,38 @@
|
|||||||
|
<module name="utils" xmlns="http://wso2.org/projects/jaggery/module.xml">
|
||||||
|
<script>
|
||||||
|
<name>reflection</name>
|
||||||
|
<path>scripts/reflection/reflection.js</path>
|
||||||
|
</script>
|
||||||
|
<script>
|
||||||
|
<name>file</name>
|
||||||
|
<path>scripts/file/file.js</path>
|
||||||
|
</script>
|
||||||
|
<script>
|
||||||
|
<name>patterns</name>
|
||||||
|
<path>scripts/patterns/patterns.js</path>
|
||||||
|
</script>
|
||||||
|
<script>
|
||||||
|
<name>xml</name>
|
||||||
|
<path>scripts/xml/xml.js</path>
|
||||||
|
</script>
|
||||||
|
<script>
|
||||||
|
<name>request</name>
|
||||||
|
<path>scripts/request/request.js</path>
|
||||||
|
</script>
|
||||||
|
<script>
|
||||||
|
<name>response</name>
|
||||||
|
<path>scripts/response/response.js</path>
|
||||||
|
</script>
|
||||||
|
<script>
|
||||||
|
<name>time</name>
|
||||||
|
<path>scripts/time/time.js</path>
|
||||||
|
</script>
|
||||||
|
<script>
|
||||||
|
<name>url</name>
|
||||||
|
<path>scripts/url/url.js</path>
|
||||||
|
</script>
|
||||||
|
<script>
|
||||||
|
<name>exception</name>
|
||||||
|
<path>scripts/exception/exception.js</path>
|
||||||
|
</script>
|
||||||
|
</module>
|
||||||
@ -0,0 +1,62 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (c) WSO2 Inc. (http://wso2.com) All Rights Reserved.
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Description: The response of the currently invoked api enpoint is organized
|
||||||
|
*/
|
||||||
|
|
||||||
|
var exception = {};
|
||||||
|
var log = new Log('exception_module');
|
||||||
|
|
||||||
|
(function(exception) {
|
||||||
|
/**
|
||||||
|
*
|
||||||
|
* @param message The exception description
|
||||||
|
* @param code HTTP STATUS CODE related to the exception
|
||||||
|
* @return The error object
|
||||||
|
*/
|
||||||
|
exception.buildExceptionObject = function(message, code) {
|
||||||
|
var error = {};
|
||||||
|
error.message = message;
|
||||||
|
error.code = code;
|
||||||
|
return error;
|
||||||
|
};
|
||||||
|
|
||||||
|
exception.handleError = function (exception, type, code){
|
||||||
|
var constants = require('rxt').constants;
|
||||||
|
|
||||||
|
if (type == constants.THROW_EXCEPTION_TO_CLIENT) {
|
||||||
|
log.debug(exception);
|
||||||
|
var e = exceptionModule.buildExceptionObject(exception, code);
|
||||||
|
throw e;
|
||||||
|
} else if (type == constants.LOG_AND_THROW_EXCEPTION) {
|
||||||
|
log.error(exception);
|
||||||
|
throw exception;
|
||||||
|
} else if (type == constants.LOG_EXCEPTION_AND_TERMINATE) {
|
||||||
|
log.error(exception);
|
||||||
|
var msg = 'An error occurred while serving the request!';
|
||||||
|
var e = exceptionModule.buildExceptionObject(msg, constants.STATUS_CODES.INTERNAL_SERVER_ERROR);
|
||||||
|
throw e;
|
||||||
|
} else if (type == constants.LOG_EXCEPTION_AND_CONTINUE) {
|
||||||
|
log.debug(exception);
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
log.error(exception);
|
||||||
|
throw e;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}(exception))
|
||||||
|
|
||||||
@ -0,0 +1,167 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (c) 2005-2014, WSO2 Inc. (http://www.wso2.org) All Rights Reserved.
|
||||||
|
*
|
||||||
|
* WSO2 Inc. licenses this file to you under the Apache License,
|
||||||
|
* Version 2.0 (the "License"); you may not use this file except
|
||||||
|
* in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing,
|
||||||
|
* software distributed under the License is distributed on an
|
||||||
|
* "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||||
|
* KIND, either express or implied. See the License for the
|
||||||
|
* specific language governing permissions and limitations
|
||||||
|
* under the License.
|
||||||
|
*
|
||||||
|
*/
|
||||||
|
var file = {};
|
||||||
|
(function() {
|
||||||
|
var log = new Log('utils-file');
|
||||||
|
var CONTENT_MAP = {
|
||||||
|
'js': 'application/javascript',
|
||||||
|
'css': 'text/css',
|
||||||
|
'csv': 'text/csv',
|
||||||
|
'html': 'text/html',
|
||||||
|
'json': 'application/json',
|
||||||
|
'png': 'image/png',
|
||||||
|
'jpeg': 'image/jpeg',
|
||||||
|
'gif': 'image/gif',
|
||||||
|
'svg': 'image/svg+xml',
|
||||||
|
'ttf': 'application/x-font-ttf',
|
||||||
|
'eot': 'application/vnd.ms-fontobject',
|
||||||
|
'woff': 'application/font-woff',
|
||||||
|
'otf': 'application/x-font-otf',
|
||||||
|
'zip': 'application/zip',
|
||||||
|
'xml': 'text/xml',
|
||||||
|
'xhtml': 'application/xhtml+xml',
|
||||||
|
'pdf': 'application/pdf'
|
||||||
|
};
|
||||||
|
/**
|
||||||
|
* The function checks whether a directory contains a particular file
|
||||||
|
* @param dir The directory in which the file must be checked
|
||||||
|
* @param file A File object if the file exists,else null
|
||||||
|
*/
|
||||||
|
file.getFileInDir = function(dir, fileName) {
|
||||||
|
var isFilePresent = false;
|
||||||
|
var files = dir.listFiles();
|
||||||
|
for (var index in files) {
|
||||||
|
if (files[index].getName() == fileName) {
|
||||||
|
return files[index];
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return null;
|
||||||
|
};
|
||||||
|
/**
|
||||||
|
* The function returns the file extension of a filename
|
||||||
|
* @param file
|
||||||
|
* @return: The extension of the file
|
||||||
|
*/
|
||||||
|
file.getExtension = function(file) {
|
||||||
|
var baseFileName = file.getName();
|
||||||
|
//Break up the name by .
|
||||||
|
var baseNameComponents = baseFileName.split('.');
|
||||||
|
var extension = baseNameComponents[baseNameComponents.length - 1];
|
||||||
|
return extension;
|
||||||
|
};
|
||||||
|
/**
|
||||||
|
* The function obtains the MIME type based on the extension
|
||||||
|
* @param The extension
|
||||||
|
* @return The mime type
|
||||||
|
*/
|
||||||
|
file.getMimeType = function(extension) {
|
||||||
|
return CONTENT_MAP[extension];
|
||||||
|
};
|
||||||
|
/**
|
||||||
|
* The function returns the name of the file without the file extension
|
||||||
|
* @param file A file object
|
||||||
|
* @return: The name of the file without the extension
|
||||||
|
*/
|
||||||
|
file.getFileName = function(file) {
|
||||||
|
//Get the name of the file
|
||||||
|
var baseFileName = file.getName();
|
||||||
|
//Break up the name by .
|
||||||
|
var baseNameComponents = baseFileName.split('.');
|
||||||
|
//Get all of the components except the last one
|
||||||
|
baseNameComponents.splice(baseNameComponents.length - 1, 1);
|
||||||
|
return baseNameComponents.join('.');
|
||||||
|
};
|
||||||
|
/**
|
||||||
|
* The function returns the contents of a directory as a JSON object.The name of the
|
||||||
|
* file is used as the property names without the extensions.
|
||||||
|
* NOTE: The method will not traverse sub folders.
|
||||||
|
* @param The directory to be inspected
|
||||||
|
* @return A JSON object which contains the files in the directory
|
||||||
|
*/
|
||||||
|
file.getDirectoryContents = function(dir) {
|
||||||
|
var dirContents = {};
|
||||||
|
//Check if it is a directory
|
||||||
|
if (!dir.isDirectory()) {
|
||||||
|
log.info('Not a directory');
|
||||||
|
return dirContents;
|
||||||
|
}
|
||||||
|
//Obtain a list of all files
|
||||||
|
var files = this.getAllFiles(dir);
|
||||||
|
var name;
|
||||||
|
log.info('Files: ' + files);
|
||||||
|
//Create the directory object with each file been a property
|
||||||
|
for (var index in files) {
|
||||||
|
dirContents[this.getFileName(files[index])] = files[index];
|
||||||
|
}
|
||||||
|
return dirContents;
|
||||||
|
};
|
||||||
|
/**
|
||||||
|
* The function obtains a list of files that are not directories
|
||||||
|
* @param dir The directory to be inspected
|
||||||
|
* @return An array with all of the files in the directory
|
||||||
|
*/
|
||||||
|
file.getAllFiles = function(dir) {
|
||||||
|
var filesInDir = [];
|
||||||
|
if (!dir.isDirectory()) {
|
||||||
|
return filesInDir;
|
||||||
|
}
|
||||||
|
//Obtain a list of all files
|
||||||
|
var files = dir.listFiles();
|
||||||
|
for (var index in files) {
|
||||||
|
log.info('Checking file: ' + files[index].getName());
|
||||||
|
//Check if the file is a directory
|
||||||
|
if (!files[index].isDirectory()) {
|
||||||
|
filesInDir.push(files[index]);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return filesInDir;
|
||||||
|
};
|
||||||
|
/**
|
||||||
|
* The function returns a list of all file names in a directory
|
||||||
|
* @param dir The directory to be inspected
|
||||||
|
* @return {An array containing the name of all files in a directory
|
||||||
|
*/
|
||||||
|
file.getAllFileNames = function(dir) {
|
||||||
|
var files = dir.listFiles();
|
||||||
|
var list = [];
|
||||||
|
var fileName;
|
||||||
|
for (var index in files) {
|
||||||
|
if (files[index].isDirectory()) {
|
||||||
|
fileName=this.getFileName(files[index].getName());
|
||||||
|
list.push(fileName);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return list;
|
||||||
|
};
|
||||||
|
/**
|
||||||
|
* The function returns a list of all sub directories in a given directory
|
||||||
|
* @param dir The root directory
|
||||||
|
* @return: An array containing all sub directories
|
||||||
|
*/
|
||||||
|
file.getAllSubDirs = function(dir) {
|
||||||
|
var files = dir.listFiles();
|
||||||
|
var subDirs = [];
|
||||||
|
for (var index in files) {
|
||||||
|
if (files[index].isDirectory()) {
|
||||||
|
subDirs.push(files[index]);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return subDirs;
|
||||||
|
};
|
||||||
|
}());
|
||||||
@ -0,0 +1,128 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (c) 2005-2014, WSO2 Inc. (http://www.wso2.org) All Rights Reserved.
|
||||||
|
*
|
||||||
|
* WSO2 Inc. licenses this file to you under the Apache License,
|
||||||
|
* Version 2.0 (the "License"); you may not use this file except
|
||||||
|
* in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing,
|
||||||
|
* software distributed under the License is distributed on an
|
||||||
|
* "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||||
|
* KIND, either express or implied. See the License for the
|
||||||
|
* specific language governing permissions and limitations
|
||||||
|
* under the License.
|
||||||
|
*
|
||||||
|
*/
|
||||||
|
var patterns = {};
|
||||||
|
|
||||||
|
(function () {
|
||||||
|
|
||||||
|
var DEF_ERR_ARITY = 3;
|
||||||
|
var DEF_HANDLE_ARITY = 2;
|
||||||
|
var log = new Log('utils.patterns.GenericPipe');
|
||||||
|
|
||||||
|
function GenericPipe(options) {
|
||||||
|
this.errHandlerArity = DEF_ERR_ARITY || options.errArity;
|
||||||
|
this.handlerArity = DEF_HANDLE_ARITY || options.handlerArity;
|
||||||
|
this.plugins = [];
|
||||||
|
this.finalHandler = function () {
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
*The function registers the provided plugin
|
||||||
|
*/
|
||||||
|
GenericPipe.prototype.plug = function (plugin, options) {
|
||||||
|
var options = options || {};
|
||||||
|
//Only a function
|
||||||
|
if (plugin instanceof Function) {
|
||||||
|
this.plugins.push({
|
||||||
|
handle: plugin,
|
||||||
|
options: options
|
||||||
|
});
|
||||||
|
}
|
||||||
|
//Is it a plugin object
|
||||||
|
else if (plugin instanceof Object) {
|
||||||
|
plugin.options = options;
|
||||||
|
this.plugins.push(plugin);
|
||||||
|
}
|
||||||
|
|
||||||
|
return this;
|
||||||
|
};
|
||||||
|
|
||||||
|
GenericPipe.prototype.finally = function (plugin) {
|
||||||
|
this.finalHandler = plugin;
|
||||||
|
return this;
|
||||||
|
};
|
||||||
|
|
||||||
|
GenericPipe.prototype.resolve = function (data, req, res, session) {
|
||||||
|
var context = {};
|
||||||
|
context.req = req;
|
||||||
|
context.res = res;
|
||||||
|
context.session = session;
|
||||||
|
context.data = data;
|
||||||
|
handle(context, this.plugins, this.errHandlerArity, this.handlerArity, this.finalHandler);
|
||||||
|
};
|
||||||
|
|
||||||
|
var handle = function (context, plugins, errArity, handlerArity, finallyHandler) {
|
||||||
|
var index = 0;
|
||||||
|
var currentPlugin;
|
||||||
|
|
||||||
|
var recursiveHandle = function (err) {
|
||||||
|
|
||||||
|
currentPlugin = plugins[index];
|
||||||
|
|
||||||
|
index++;
|
||||||
|
|
||||||
|
//Check if there is a plugin
|
||||||
|
if (!currentPlugin) {
|
||||||
|
//log.warn('No plugin found at index: ' + index);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
//Populate the options object for the plugin
|
||||||
|
context.options=currentPlugin.options;;
|
||||||
|
|
||||||
|
//Check if an error has been provided
|
||||||
|
if (err) {
|
||||||
|
//Can the current plugin handle the err
|
||||||
|
if (currentPlugin.handle.length == errArity) {
|
||||||
|
try {
|
||||||
|
currentPlugin.handle(err, context,recursiveHandle);
|
||||||
|
}
|
||||||
|
catch (e) {
|
||||||
|
recursiveHandle(e);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
recursiveHandle(err);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
//There is no error so try to invoke the current plugin
|
||||||
|
else {
|
||||||
|
if (currentPlugin.handle.length == handlerArity) {
|
||||||
|
try {
|
||||||
|
|
||||||
|
|
||||||
|
currentPlugin.handle(context,recursiveHandle);
|
||||||
|
} catch (e) {
|
||||||
|
recursiveHandle(e);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
recursiveHandle();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
recursiveHandle();
|
||||||
|
finallyHandler(context);
|
||||||
|
};
|
||||||
|
|
||||||
|
patterns.GenericPipe = GenericPipe;
|
||||||
|
|
||||||
|
}());
|
||||||
@ -0,0 +1,230 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (c) 2005-2014, WSO2 Inc. (http://www.wso2.org) All Rights Reserved.
|
||||||
|
*
|
||||||
|
* WSO2 Inc. licenses this file to you under the Apache License,
|
||||||
|
* Version 2.0 (the "License"); you may not use this file except
|
||||||
|
* in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing,
|
||||||
|
* software distributed under the License is distributed on an
|
||||||
|
* "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||||
|
* KIND, either express or implied. See the License for the
|
||||||
|
* specific language governing permissions and limitations
|
||||||
|
* under the License.
|
||||||
|
*
|
||||||
|
*/
|
||||||
|
var reflection = {};
|
||||||
|
/**
|
||||||
|
* Description: The script encapsulates any reflection related utility functions
|
||||||
|
*/
|
||||||
|
(function() {
|
||||||
|
var log = new Log('utils-reflection');
|
||||||
|
reflection.copyPropKeys = function(from, to) {
|
||||||
|
for (var key in from) {
|
||||||
|
if (from.hasOwnProperty(key)) {
|
||||||
|
to[key] = '';
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return to;
|
||||||
|
};
|
||||||
|
/**
|
||||||
|
* The function recursively copies all property keys in an object
|
||||||
|
* @param from
|
||||||
|
* @param to
|
||||||
|
*/
|
||||||
|
reflection.copyAllPropKeys = function(from, to) {
|
||||||
|
recurse(from, to, function(from, to, key) {
|
||||||
|
if (from[key] instanceof Object) {
|
||||||
|
to[key] = from[key];
|
||||||
|
} else {
|
||||||
|
to[key] = null;
|
||||||
|
}
|
||||||
|
});
|
||||||
|
};
|
||||||
|
reflection.copyAllPropValues = function(from, to) {
|
||||||
|
recurse(from, to, function(from, to, key) {
|
||||||
|
//Create an instance if the property does not exist
|
||||||
|
if (!to[key]) {
|
||||||
|
to[key] = {};
|
||||||
|
}
|
||||||
|
//Copy the values over
|
||||||
|
if (!(from[key] instanceof Object)) {
|
||||||
|
to[key] = from[key];
|
||||||
|
} else {
|
||||||
|
log.debug('Not copying values of key: ' + key);
|
||||||
|
}
|
||||||
|
});
|
||||||
|
};
|
||||||
|
/**
|
||||||
|
* The function will only copy public properties
|
||||||
|
* @param from
|
||||||
|
* @param to
|
||||||
|
*/
|
||||||
|
reflection.copyPublicPropValues = function(from, to) {
|
||||||
|
recurse(from, to, function(from, to, key) {
|
||||||
|
//Ignore any hidden properties
|
||||||
|
if (key.charAt(0) == '_') {
|
||||||
|
log.warn('Drop key: ' + key);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
//Create an instance if the property does not exist
|
||||||
|
if (!to[key]) {
|
||||||
|
to[key] = {};
|
||||||
|
}
|
||||||
|
//Copy the values over
|
||||||
|
if (!(from[key] instanceof Object)) {
|
||||||
|
to[key] = from[key];
|
||||||
|
} else {
|
||||||
|
log.warn('Not copying values of key: ' + key);
|
||||||
|
}
|
||||||
|
});
|
||||||
|
};
|
||||||
|
reflection.inspect = function(from, to, cb) {
|
||||||
|
recurse(from, to, cb);
|
||||||
|
};
|
||||||
|
/**
|
||||||
|
* The function recursively traverses an object and then invokes the provided
|
||||||
|
* callback
|
||||||
|
* @param root
|
||||||
|
* @param clone
|
||||||
|
* @param cb
|
||||||
|
*/
|
||||||
|
var recurse = function(root, clone, cb) {
|
||||||
|
var key;
|
||||||
|
//Check if the root is an object
|
||||||
|
if (!(root instanceof Object)) {
|
||||||
|
return;
|
||||||
|
} else {
|
||||||
|
var keys = Object.keys(root);
|
||||||
|
//Go through all the other keys in the current root
|
||||||
|
for (var index in keys) {
|
||||||
|
key = keys[index];
|
||||||
|
cb(root, clone, key);
|
||||||
|
recurse(root[key], clone[key], cb);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
};
|
||||||
|
reflection.copyProps = function(from, to) {
|
||||||
|
for (var key in from) {
|
||||||
|
if (from.hasOwnProperty(key)) {
|
||||||
|
to[key] = from[key];
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return to;
|
||||||
|
};
|
||||||
|
reflection.getProps = function(obj) {
|
||||||
|
var props = {};
|
||||||
|
for (var key in obj) {
|
||||||
|
if (!(obj[key] instanceof Function)) {
|
||||||
|
props[key] = obj[key];
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return props;
|
||||||
|
};
|
||||||
|
reflection.printProps = function(obj) {
|
||||||
|
for (var key in obj) {
|
||||||
|
if (obj.hasOwnProperty(key)) {
|
||||||
|
log.info('key: ' + key);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
};
|
||||||
|
/**
|
||||||
|
* The function determines if a property is hidden based on _
|
||||||
|
* @param key
|
||||||
|
* @returns {boolean}
|
||||||
|
*/
|
||||||
|
reflection.isHiddenProp = function(key) {
|
||||||
|
if (key == '') {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
return (key.charAt(0) == '_') ? true : false;
|
||||||
|
};
|
||||||
|
var getDiff = function(a, b, diff) {};
|
||||||
|
/**
|
||||||
|
* The function calculates the differences between two simple JSON objects
|
||||||
|
* @param a The object with which b is compared
|
||||||
|
* @param b The target of the comparison
|
||||||
|
* @return An object which records the differences between the two objects
|
||||||
|
*/
|
||||||
|
reflection.diff = function(a, b) {};
|
||||||
|
/**
|
||||||
|
* The function merges the two provided objects to create a new
|
||||||
|
* object.In the case where b has the same property as a; the property of b
|
||||||
|
* will have precedence
|
||||||
|
* @param {[type]} a [description]
|
||||||
|
* @param {[type]} b [description]
|
||||||
|
* @return A new object having the properties of both object a and b
|
||||||
|
*/
|
||||||
|
reflection.merge = function(a, b) {
|
||||||
|
var newObj = {};
|
||||||
|
//Copy the properties of a first
|
||||||
|
for (var key in a) {
|
||||||
|
newObj[key] = b[key];
|
||||||
|
}
|
||||||
|
//Override with the properties of b
|
||||||
|
for (var key in b) {
|
||||||
|
newObj[key] = b[key];
|
||||||
|
}
|
||||||
|
return newObj;
|
||||||
|
};
|
||||||
|
/**
|
||||||
|
* The function allows a child class to override a select set of methods of
|
||||||
|
* a parent class.The original methods of the parent can be accessed
|
||||||
|
* using the this._super keyword
|
||||||
|
* @param {[type]} parent The parent class instance to be overriden
|
||||||
|
* @param {[type]} child The child class instance containing methods which will override the parent
|
||||||
|
*/
|
||||||
|
reflection.override = function(parent, child) {
|
||||||
|
//Make a clone of the parent
|
||||||
|
var super = parse(stringify(parent));
|
||||||
|
for (var childKey in child) {
|
||||||
|
for (var parentKey in parent) {
|
||||||
|
//Only override those methods that are common
|
||||||
|
if (childKey === parentKey) {
|
||||||
|
var parentPtr = parent[parentKey];
|
||||||
|
var childPtr = child[childKey];
|
||||||
|
//Update the clone with the old parent method
|
||||||
|
super[parentKey] = parentPtr;
|
||||||
|
parent[parentKey] = childPtr;
|
||||||
|
/*parent[parentKey] = function() {
|
||||||
|
var result=childPtr.apply(this, arguments)||null;
|
||||||
|
return result;
|
||||||
|
};*/
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
//Allow the child object to call methods of the parent
|
||||||
|
parent._super = super;
|
||||||
|
};
|
||||||
|
reflection.overrideAll=function(parent,child){
|
||||||
|
//Make a clone of the parent
|
||||||
|
var super = parse(stringify(parent));
|
||||||
|
for (var childKey in child) {
|
||||||
|
for (var parentKey in parent) {
|
||||||
|
//Only override those methods that are common
|
||||||
|
if ( (child.hasOwnProperty(childKey))&&(parent.hasOwnProperty(parentKey)) ) {
|
||||||
|
var parentPtr = parent[parentKey];
|
||||||
|
var childPtr = child[childKey];
|
||||||
|
//Update the clone with the old parent method
|
||||||
|
super[parentKey] = parentPtr;
|
||||||
|
parent[parentKey] = childPtr;
|
||||||
|
/*parent[parentKey] = function() {
|
||||||
|
var result=childPtr.apply(this, arguments)||null;
|
||||||
|
return result;
|
||||||
|
};*/
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
//Allow the child object to call methods of the parent
|
||||||
|
parent._super = super;
|
||||||
|
};
|
||||||
|
reflection.isArray = function(object) {
|
||||||
|
if (Object.prototype.toString.call(object) === '[object Array]') {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
return false;
|
||||||
|
};
|
||||||
|
}());
|
||||||
@ -0,0 +1,57 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (c) 2005-2014, WSO2 Inc. (http://www.wso2.org) All Rights Reserved.
|
||||||
|
*
|
||||||
|
* WSO2 Inc. licenses this file to you under the Apache License,
|
||||||
|
* Version 2.0 (the "License"); you may not use this file except
|
||||||
|
* in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing,
|
||||||
|
* software distributed under the License is distributed on an
|
||||||
|
* "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||||
|
* KIND, either express or implied. See the License for the
|
||||||
|
* specific language governing permissions and limitations
|
||||||
|
* under the License.
|
||||||
|
*
|
||||||
|
*/
|
||||||
|
var request = {};
|
||||||
|
(function(request) {
|
||||||
|
var hasOwnProperty = function(obj, element) {
|
||||||
|
return Object.prototype.hasOwnProperty.call(obj, element);
|
||||||
|
};
|
||||||
|
var isObject = function(object) {;
|
||||||
|
return typeof object === 'object';
|
||||||
|
};
|
||||||
|
/*
|
||||||
|
* ECMA Standard (ECMA-262 : 5.1 Edition)*/
|
||||||
|
var decodes = function(encodedURI) {
|
||||||
|
return decodeURIComponent(encodedURI);
|
||||||
|
};
|
||||||
|
request.getQueryOptions = function(queryString) {
|
||||||
|
var opt={};
|
||||||
|
var sep = opt.sep || '&',
|
||||||
|
assign = opt.assign || '=',
|
||||||
|
compoArray = [];
|
||||||
|
var obj = {};
|
||||||
|
var decodedURI = decodes(queryString);
|
||||||
|
decodedURI.split(sep).forEach(function(comp) {
|
||||||
|
comp.split(assign).some(function(element, index, array) {
|
||||||
|
if (hasOwnProperty(obj, element.toString())) {
|
||||||
|
compoArray.push(obj[element]);
|
||||||
|
compoArray.push(array[1]);
|
||||||
|
obj[element] = compoArray;
|
||||||
|
} else {
|
||||||
|
Object.defineProperty(obj, element, {
|
||||||
|
enumerable: true,
|
||||||
|
writable: true,
|
||||||
|
value: array[1]
|
||||||
|
});
|
||||||
|
}
|
||||||
|
return true;
|
||||||
|
});
|
||||||
|
});
|
||||||
|
return obj;
|
||||||
|
};
|
||||||
|
}(request))
|
||||||
@ -0,0 +1,96 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (c) WSO2 Inc. (http://wso2.com) All Rights Reserved.
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Description: The response of the currently invoked api endpoint is organized
|
||||||
|
*/
|
||||||
|
|
||||||
|
var response = {};
|
||||||
|
var log = new Log("response");
|
||||||
|
|
||||||
|
(function(response) {
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Build Error response
|
||||||
|
* @param resp jaggery-response object to retrieve to client
|
||||||
|
* @param code status code
|
||||||
|
* @param message message to the client side
|
||||||
|
* @return return response
|
||||||
|
*/
|
||||||
|
response.buildErrorResponse = function(resp,code,message) {
|
||||||
|
var content={};
|
||||||
|
content.error = message;
|
||||||
|
resp = processResponse(resp,code,content);
|
||||||
|
return resp;
|
||||||
|
};
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Build success response
|
||||||
|
* @param resp jaggery response object
|
||||||
|
* @param code status code
|
||||||
|
* @param data the result to client
|
||||||
|
* @return return response
|
||||||
|
*/
|
||||||
|
response.buildSuccessResponse= function(resp, code, data){
|
||||||
|
var content={};
|
||||||
|
content.data = data;
|
||||||
|
resp = processResponse(resp,code,content);
|
||||||
|
return resp;
|
||||||
|
};
|
||||||
|
|
||||||
|
/**
|
||||||
|
* process General response
|
||||||
|
* @param resp jaggery response
|
||||||
|
* @param code status code
|
||||||
|
* @param data success result
|
||||||
|
* @return resp jaggery response
|
||||||
|
*/
|
||||||
|
response.buildSuccessResponseForRxt= function(resp, code, data){
|
||||||
|
resp.status = code;
|
||||||
|
resp.content = data;
|
||||||
|
return resp;
|
||||||
|
};
|
||||||
|
|
||||||
|
/**
|
||||||
|
* General response builder
|
||||||
|
* @param resp jaggery response
|
||||||
|
* @param code status code
|
||||||
|
* @param content what ever the content to be sent as response
|
||||||
|
* @return resp jaggery response
|
||||||
|
*/
|
||||||
|
function processResponse(resp, code, content){
|
||||||
|
resp.status = code;
|
||||||
|
resp.contentType = 'application/json';
|
||||||
|
resp.content = content;
|
||||||
|
return resp;
|
||||||
|
|
||||||
|
};
|
||||||
|
|
||||||
|
/**
|
||||||
|
*
|
||||||
|
* @param resp
|
||||||
|
* @param code
|
||||||
|
* @param data
|
||||||
|
* @return The http response
|
||||||
|
*/
|
||||||
|
response.buildSuccessResponseForRxt= function(resp, code, data){
|
||||||
|
resp.contentType = 'application/json';
|
||||||
|
resp.status = code;
|
||||||
|
resp.content = data;
|
||||||
|
return resp;
|
||||||
|
};
|
||||||
|
|
||||||
|
}(response))
|
||||||
@ -0,0 +1,35 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (c) 2005-2014, WSO2 Inc. (http://www.wso2.org) All Rights Reserved.
|
||||||
|
*
|
||||||
|
* WSO2 Inc. licenses this file to you under the Apache License,
|
||||||
|
* Version 2.0 (the "License"); you may not use this file except
|
||||||
|
* in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing,
|
||||||
|
* software distributed under the License is distributed on an
|
||||||
|
* "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||||
|
* KIND, either express or implied. See the License for the
|
||||||
|
* specific language governing permissions and limitations
|
||||||
|
* under the License.
|
||||||
|
*
|
||||||
|
*/
|
||||||
|
var time = {};
|
||||||
|
(function(time) {
|
||||||
|
time.getCurrentTime = function(dateLength) {
|
||||||
|
var dateLength=dateLength||20;
|
||||||
|
var now = new String(new Date().valueOf());
|
||||||
|
var length = now.length;
|
||||||
|
var prefix = dateLength;
|
||||||
|
var onsetVal = '';
|
||||||
|
if (length != prefix) {
|
||||||
|
var onset = prefix - length;
|
||||||
|
for (var i = 0; i < onset; i++) {
|
||||||
|
onsetVal += '0';
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return onsetVal + now;
|
||||||
|
};
|
||||||
|
}(time));
|
||||||
@ -0,0 +1,47 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (c) 2005-2014, WSO2 Inc. (http://www.wso2.org) All Rights Reserved.
|
||||||
|
*
|
||||||
|
* WSO2 Inc. licenses this file to you under the Apache License,
|
||||||
|
* Version 2.0 (the "License"); you may not use this file except
|
||||||
|
* in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing,
|
||||||
|
* software distributed under the License is distributed on an
|
||||||
|
* "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||||
|
* KIND, either express or implied. See the License for the
|
||||||
|
* specific language governing permissions and limitations
|
||||||
|
* under the License.
|
||||||
|
*
|
||||||
|
*/
|
||||||
|
var url = {};
|
||||||
|
(function() {
|
||||||
|
var log=new Log('utils-url');
|
||||||
|
url.popServerDetails = function(obj) {
|
||||||
|
var process = require('process');
|
||||||
|
var localIP = process.getProperty('server.host');
|
||||||
|
var httpPort = process.getProperty('http.port');
|
||||||
|
var httpsPort = process.getProperty('https.port');
|
||||||
|
var value = '';
|
||||||
|
var carbonLocalIP = process.getProperty('carbon.local.ip');
|
||||||
|
|
||||||
|
for (var key in obj) {
|
||||||
|
if (obj.hasOwnProperty(key)) {
|
||||||
|
value = obj[key];
|
||||||
|
if ((typeof value === 'string') && value.indexOf('%https.host%') > -1) {
|
||||||
|
value=value.replace('%https.host%', 'https://' + localIP + ':' + httpsPort);
|
||||||
|
} else if ((typeof value === 'string') && value.indexOf('%http.host%') > -1) {
|
||||||
|
value=value.replace('%http.host%', 'http://' + localIP + ':' + httpPort);
|
||||||
|
} else if ((typeof value === 'string') && value.indexOf('%https.carbon.local.ip%') > -1) {
|
||||||
|
value=value.replace('%https.carbon.local.ip%', 'https://' + carbonLocalIP + ':' + httpsPort);
|
||||||
|
} else if ((typeof value === 'string') && value.indexOf('%http.carbon.local.ip%') > -1) {
|
||||||
|
value=value.replace('%http.carbon.local.ip%', 'http://' + carbonLocalIP + ':' + httpPort);
|
||||||
|
}
|
||||||
|
obj[key] = value;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return obj;
|
||||||
|
};
|
||||||
|
}(url));
|
||||||
@ -0,0 +1,138 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (c) 2005-2014, WSO2 Inc. (http://www.wso2.org) All Rights Reserved.
|
||||||
|
*
|
||||||
|
* WSO2 Inc. licenses this file to you under the Apache License,
|
||||||
|
* Version 2.0 (the "License"); you may not use this file except
|
||||||
|
* in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing,
|
||||||
|
* software distributed under the License is distributed on an
|
||||||
|
* "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||||
|
* KIND, either express or implied. See the License for the
|
||||||
|
* specific language governing permissions and limitations
|
||||||
|
* under the License.
|
||||||
|
*
|
||||||
|
*/
|
||||||
|
var xml = {};
|
||||||
|
|
||||||
|
(function () {
|
||||||
|
|
||||||
|
var log=new Log('util.xml')
|
||||||
|
|
||||||
|
/*
|
||||||
|
The method is used to create a JSON object using
|
||||||
|
an xml object.
|
||||||
|
@xmlElement: An xml element object to be processed
|
||||||
|
@return: A pseudo object containing the properties of the
|
||||||
|
xml element.
|
||||||
|
*/
|
||||||
|
var createJSONObject = function (xmlElement) {
|
||||||
|
|
||||||
|
var pseudo = {};
|
||||||
|
|
||||||
|
//Extract all attributes
|
||||||
|
var attributes = xmlElement.@*;
|
||||||
|
|
||||||
|
//Fill the pseudo object with the attributes of the element
|
||||||
|
for (var attributeKey in attributes) {
|
||||||
|
var attribute = attributes[attributeKey];
|
||||||
|
pseudo[attribute.localName()] = attribute.toString();
|
||||||
|
}
|
||||||
|
|
||||||
|
return pseudo;
|
||||||
|
};
|
||||||
|
|
||||||
|
/*
|
||||||
|
The function converts an E4X Xml object to a JSON object
|
||||||
|
This function has been adapted from the work of Oleg Podsechin available at
|
||||||
|
https://gist.github.com/olegp/642667
|
||||||
|
It uses a slightly modified version of his algorithm , therefore
|
||||||
|
all credit should be attributed to Oleg Podsechin.
|
||||||
|
IMPORTANT:
|
||||||
|
1. It does not create a 1..1 mapping due to the differences
|
||||||
|
between Xml and JSON.It is IMPORTANT that you verify the structure
|
||||||
|
of the object generated before using it.
|
||||||
|
2. The input xml object must not contain the xml header information
|
||||||
|
This is a known bug 336551 (Mozilla Developer Network)
|
||||||
|
Source: https://developer.mozilla.org/en/docs/E4X
|
||||||
|
Please remove the header prior to sending the xml object for processing.
|
||||||
|
@root: A starting element in an E4X Xml object
|
||||||
|
@return: A JSON object mirroring the provided Xml object
|
||||||
|
*/
|
||||||
|
var recursiveConvertE4XtoJSON = function (root) {
|
||||||
|
|
||||||
|
log.debug('Root: ' + root.localName());
|
||||||
|
|
||||||
|
//Obtain child nodes
|
||||||
|
var children = root.*;
|
||||||
|
|
||||||
|
//The number of children
|
||||||
|
var numChildren = children.length();
|
||||||
|
|
||||||
|
//No children
|
||||||
|
if (numChildren == 0) {
|
||||||
|
|
||||||
|
//Extract contents
|
||||||
|
return createJSONObject(root);
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
|
||||||
|
//Create an empty object
|
||||||
|
var rootObject = createJSONObject(root);
|
||||||
|
|
||||||
|
//Could be multiple children
|
||||||
|
for (var childElementKey in children) {
|
||||||
|
|
||||||
|
var child = children[childElementKey];
|
||||||
|
|
||||||
|
log.debug('Examining child: ' + child.localName());
|
||||||
|
|
||||||
|
//If the child just contains a single value then stop
|
||||||
|
if (child.localName() == undefined) {
|
||||||
|
|
||||||
|
log.debug('Child is undefined: ' + child.toString());
|
||||||
|
|
||||||
|
//Change the object to just a key value pair
|
||||||
|
rootObject[root.localName()] = child.toString();
|
||||||
|
return rootObject;
|
||||||
|
}
|
||||||
|
|
||||||
|
//Make a recursive call to construct the child element
|
||||||
|
var createdObject = recursiveConvertE4XtoJSON(child);
|
||||||
|
|
||||||
|
log.debug('Converted object: ' + stringify(createdObject));
|
||||||
|
|
||||||
|
//Check if the root object has the property
|
||||||
|
if (rootObject.hasOwnProperty(child.localName())) {
|
||||||
|
|
||||||
|
log.debug('key: ' + child.localName() + ' already present.');
|
||||||
|
rootObject[child.localName()].push(createdObject);
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
|
||||||
|
log.debug('key: ' + child.localName() + ' not present.');
|
||||||
|
rootObject[child.localName()] = [];
|
||||||
|
rootObject[child.localName()].push(createdObject);
|
||||||
|
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
log.debug('root: ' + root.localName());
|
||||||
|
|
||||||
|
return rootObject;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The function is used to convert an E4X xml to JSON
|
||||||
|
* @param root
|
||||||
|
*/
|
||||||
|
xml.convertE4XtoJSON = function (root) {
|
||||||
|
return recursiveConvertE4XtoJSON(root);
|
||||||
|
};
|
||||||
|
|
||||||
|
|
||||||
|
}());
|
||||||
@ -0,0 +1,30 @@
|
|||||||
|
<!DOCTYPE html>
|
||||||
|
<html>
|
||||||
|
<head>
|
||||||
|
<meta charset='UTF-8'>
|
||||||
|
<link rel="stylesheet" href="https://error.cloud.wso2.com/style/style.css">
|
||||||
|
<link rel="stylesheet" href="https://error.cloud.wso2.com/style/font-mf.css">
|
||||||
|
</head>
|
||||||
|
<body>
|
||||||
|
<div class="sky">
|
||||||
|
<section>
|
||||||
|
<div class="error-400">
|
||||||
|
<img src="https://error.cloud.wso2.com/images/400-error.svg">
|
||||||
|
</div>
|
||||||
|
<div class="text-label">
|
||||||
|
<h1>Oops something went wrong </h1>
|
||||||
|
<h2>400 - Bad request</h2>
|
||||||
|
<div style="clear: both"></div>
|
||||||
|
<div class="button-label">
|
||||||
|
<a href="https://cloudmgt.cloud.wso2.com/cloudmgt/site/pages/index.jag"><label class="label-back">Back to Cloud </label></a>
|
||||||
|
<a href="https://cloudmgt.cloud.wso2.com/cloudmgt/site/pages/contact-us.jag"><label class="label-report"> Report Issue </label></a>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</section>
|
||||||
|
|
||||||
|
<div class="clouds_one"></div>
|
||||||
|
<div class="clouds_two"></div>
|
||||||
|
<div class="clouds_three"></div>
|
||||||
|
</div>
|
||||||
|
</body>
|
||||||
|
</html>
|
||||||
@ -0,0 +1,33 @@
|
|||||||
|
<!--
|
||||||
|
~ Copyright 2016 WSO2, Inc. (http://wso2.com)
|
||||||
|
~
|
||||||
|
~ Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
~ you may not use this file except in compliance with the License.
|
||||||
|
~ You may obtain a copy of the License at
|
||||||
|
~
|
||||||
|
~ http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
~
|
||||||
|
~ Unless required by applicable law or agreed to in writing, software
|
||||||
|
~ distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
~ See the License for the specific language governing permissions and
|
||||||
|
~ limitations under the License.
|
||||||
|
-->
|
||||||
|
|
||||||
|
<!DOCTYPE html>
|
||||||
|
<html lang="en">
|
||||||
|
<head>
|
||||||
|
<meta charset="utf-8">
|
||||||
|
<title>Bad request - Error 400</title>
|
||||||
|
<meta name="viewport" content="width=device-width, initial-scale=1.0">
|
||||||
|
<meta name="description" content="">
|
||||||
|
<meta name="author" content="">
|
||||||
|
</head>
|
||||||
|
<body>
|
||||||
|
<i class="icon-unlink error-icon"></i>
|
||||||
|
<h1>Error 400</h1>
|
||||||
|
<h3>We are unable to understand the request and process it. Please re-check your request.</h3>
|
||||||
|
<h4 id="link"><a href="/devicemgt">Go to IoT Home</a></h4>
|
||||||
|
</body>
|
||||||
|
</html>
|
||||||
|
|
||||||
@ -0,0 +1,30 @@
|
|||||||
|
<!DOCTYPE html>
|
||||||
|
<html>
|
||||||
|
<head>
|
||||||
|
<meta charset='UTF-8'>
|
||||||
|
<link rel="stylesheet" href="https://error.cloud.wso2.com/style/style.css">
|
||||||
|
<link rel="stylesheet" href="https://error.cloud.wso2.com/style/font-mf.css">
|
||||||
|
</head>
|
||||||
|
<body>
|
||||||
|
<div class="sky">
|
||||||
|
<section>
|
||||||
|
<div class="error-400">
|
||||||
|
<img src="https://error.cloud.wso2.com/images/400-error.svg">
|
||||||
|
</div>
|
||||||
|
<div class="text-label">
|
||||||
|
<h1>Oops something went wrong </h1>
|
||||||
|
<h2>401 - Unauthorized</h2>
|
||||||
|
<div style="clear: both"></div>
|
||||||
|
<div class="button-label">
|
||||||
|
<a href="https://cloudmgt.cloud.wso2.com/cloudmgt/site/pages/index.jag"><label class="label-back">Back to Cloud </label></a>
|
||||||
|
<a href="https://cloudmgt.cloud.wso2.com/cloudmgt/site/pages/contact-us.jag"><label class="label-report"> Report Issue </label></a>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</section>
|
||||||
|
|
||||||
|
<div class="clouds_one"></div>
|
||||||
|
<div class="clouds_two"></div>
|
||||||
|
<div class="clouds_three"></div>
|
||||||
|
</div>
|
||||||
|
</body>
|
||||||
|
</html>
|
||||||
@ -0,0 +1,33 @@
|
|||||||
|
<!--
|
||||||
|
~ Copyright 2016 WSO2, Inc. (http://wso2.com)
|
||||||
|
~
|
||||||
|
~ Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
~ you may not use this file except in compliance with the License.
|
||||||
|
~ You may obtain a copy of the License at
|
||||||
|
~
|
||||||
|
~ http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
~
|
||||||
|
~ Unless required by applicable law or agreed to in writing, software
|
||||||
|
~ distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
~ See the License for the specific language governing permissions and
|
||||||
|
~ limitations under the License.
|
||||||
|
-->
|
||||||
|
|
||||||
|
<!DOCTYPE html>
|
||||||
|
<html lang="en">
|
||||||
|
<head>
|
||||||
|
<meta charset="utf-8">
|
||||||
|
<title>Unauthorized - Error 401</title>
|
||||||
|
<meta name="viewport" content="width=device-width, initial-scale=1.0">
|
||||||
|
<meta name="description" content="">
|
||||||
|
<meta name="author" content="">
|
||||||
|
</head>
|
||||||
|
<body>
|
||||||
|
<i class="icon-unlink error-icon"></i>
|
||||||
|
<h1>Error 401</h1>
|
||||||
|
<h3>You do not have permission to access this page.Please contact your administrator and request permission.</h3>
|
||||||
|
<h4 id="link"><a href="/devicemgt">Go to IoT Home</a></h4>
|
||||||
|
</body>
|
||||||
|
</html>
|
||||||
|
|
||||||
@ -0,0 +1,30 @@
|
|||||||
|
<!DOCTYPE html>
|
||||||
|
<html>
|
||||||
|
<head>
|
||||||
|
<meta charset='UTF-8'>
|
||||||
|
<link rel="stylesheet" href="https://error.cloud.wso2.com/style/style.css">
|
||||||
|
<link rel="stylesheet" href="https://error.cloud.wso2.com/style/font-mf.css">
|
||||||
|
</head>
|
||||||
|
<body>
|
||||||
|
<div class="sky">
|
||||||
|
<section>
|
||||||
|
<div class="error-400">
|
||||||
|
<img src="https://error.cloud.wso2.com/images/400-error.svg">
|
||||||
|
</div>
|
||||||
|
<div class="text-label">
|
||||||
|
<h1>Oops something went wrong </h1>
|
||||||
|
<h2>403 - Forbidden</h2>
|
||||||
|
<div style="clear: both"></div>
|
||||||
|
<div class="button-label">
|
||||||
|
<a href="https://cloudmgt.cloud.wso2.com/cloudmgt/site/pages/index.jag"><label class="label-back">Back to Cloud </label></a>
|
||||||
|
<a href="https://cloudmgt.cloud.wso2.com/cloudmgt/site/pages/contact-us.jag"><label class="label-report"> Report Issue </label></a>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</section>
|
||||||
|
|
||||||
|
<div class="clouds_one"></div>
|
||||||
|
<div class="clouds_two"></div>
|
||||||
|
<div class="clouds_three"></div>
|
||||||
|
</div>
|
||||||
|
</body>
|
||||||
|
</html>
|
||||||
@ -0,0 +1,34 @@
|
|||||||
|
<!--
|
||||||
|
~ Copyright 2016 WSO2, Inc. (http://wso2.com)
|
||||||
|
~
|
||||||
|
~ Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
~ you may not use this file except in compliance with the License.
|
||||||
|
~ You may obtain a copy of the License at
|
||||||
|
~
|
||||||
|
~ http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
~
|
||||||
|
~ Unless required by applicable law or agreed to in writing, software
|
||||||
|
~ distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
~ See the License for the specific language governing permissions and
|
||||||
|
~ limitations under the License.
|
||||||
|
-->
|
||||||
|
|
||||||
|
<!DOCTYPE html>
|
||||||
|
<html lang="en">
|
||||||
|
<head>
|
||||||
|
<meta charset="utf-8">
|
||||||
|
<title>Forbidden - Error 403</title>
|
||||||
|
<meta name="viewport" content="width=device-width, initial-scale=1.0">
|
||||||
|
<meta name="description" content="">
|
||||||
|
<meta name="author" content="">
|
||||||
|
</head>
|
||||||
|
|
||||||
|
<body>
|
||||||
|
<i class="icon-unlink error-icon"></i>
|
||||||
|
<h1>Error 403</h1>
|
||||||
|
<h3>We cannot process this request.</h3>
|
||||||
|
<h4 id="link"><a href="/devicemgt">Go to IoT Home</a></h4>
|
||||||
|
</body>
|
||||||
|
</html>
|
||||||
|
|
||||||
@ -0,0 +1,30 @@
|
|||||||
|
<!DOCTYPE html>
|
||||||
|
<html>
|
||||||
|
<head>
|
||||||
|
<meta charset='UTF-8'>
|
||||||
|
<link rel="stylesheet" href="https://error.cloud.wso2.com/style/style.css">
|
||||||
|
<link rel="stylesheet" href="https://error.cloud.wso2.com/style/font-mf.css">
|
||||||
|
</head>
|
||||||
|
<body>
|
||||||
|
<div class="sky">
|
||||||
|
<section>
|
||||||
|
<div class="error-400">
|
||||||
|
<img src="https://error.cloud.wso2.com/images/400-error.svg">
|
||||||
|
</div>
|
||||||
|
<div class="text-label">
|
||||||
|
<h1>Oops something went wrong </h1>
|
||||||
|
<h2>404 - Page Not Found</h2>
|
||||||
|
<div style="clear: both"></div>
|
||||||
|
<div class="button-label">
|
||||||
|
<a href="https://cloudmgt.cloud.wso2.com/cloudmgt/site/pages/index.jag"><label class="label-back">Back to Cloud </label></a>
|
||||||
|
<a href="https://cloudmgt.cloud.wso2.com/cloudmgt/site/pages/contact-us.jag"><label class="label-report"> Report Issue </label></a>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</section>
|
||||||
|
|
||||||
|
<div class="clouds_one"></div>
|
||||||
|
<div class="clouds_two"></div>
|
||||||
|
<div class="clouds_three"></div>
|
||||||
|
</div>
|
||||||
|
</body>
|
||||||
|
</html>
|
||||||
@ -0,0 +1,33 @@
|
|||||||
|
<!--
|
||||||
|
~ Copyright 2016 WSO2, Inc. (http://wso2.com)
|
||||||
|
~
|
||||||
|
~ Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
~ you may not use this file except in compliance with the License.
|
||||||
|
~ You may obtain a copy of the License at
|
||||||
|
~
|
||||||
|
~ http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
~
|
||||||
|
~ Unless required by applicable law or agreed to in writing, software
|
||||||
|
~ distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
~ See the License for the specific language governing permissions and
|
||||||
|
~ limitations under the License.
|
||||||
|
-->
|
||||||
|
|
||||||
|
<!DOCTYPE html>
|
||||||
|
<html lang="en">
|
||||||
|
<head>
|
||||||
|
<meta charset="utf-8">
|
||||||
|
<title>Page not found - Error 404</title>
|
||||||
|
<meta name="viewport" content="width=device-width, initial-scale=1.0">
|
||||||
|
<meta name="description" content="">
|
||||||
|
<meta name="author" content="">
|
||||||
|
</head>
|
||||||
|
<body>
|
||||||
|
<i class="icon-unlink error-icon"></i>
|
||||||
|
<h1>Error 404</h1>
|
||||||
|
<h3>We can't find what you are looking for.</h3>
|
||||||
|
<h4 id="link"><a href="/devicemgt">Go to IoT Home</a></h4>
|
||||||
|
</body>
|
||||||
|
</html>
|
||||||
|
|
||||||
@ -0,0 +1,30 @@
|
|||||||
|
<!DOCTYPE html>
|
||||||
|
<html>
|
||||||
|
<head>
|
||||||
|
<meta charset='UTF-8'>
|
||||||
|
<link rel="stylesheet" href="https://error.cloud.wso2.com/style/style.css">
|
||||||
|
<link rel="stylesheet" href="https://error.cloud.wso2.com/style/font-mf.css">
|
||||||
|
</head>
|
||||||
|
<body>
|
||||||
|
<div class="sky">
|
||||||
|
<section>
|
||||||
|
<div class="error-400">
|
||||||
|
<img src="https://error.cloud.wso2.com/images/400-error.svg">
|
||||||
|
</div>
|
||||||
|
<div class="text-label">
|
||||||
|
<h1>Oops something went wrong </h1>
|
||||||
|
<h2>405 - Method Not Allowed</h2>
|
||||||
|
<div style="clear: both"></div>
|
||||||
|
<div class="button-label">
|
||||||
|
<a href="https://cloudmgt.cloud.wso2.com/cloudmgt/site/pages/index.jag"><label class="label-back">Back to Cloud </label></a>
|
||||||
|
<a href="https://cloudmgt.cloud.wso2.com/cloudmgt/site/pages/contact-us.jag"><label class="label-report"> Report Issue </label></a>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</section>
|
||||||
|
|
||||||
|
<div class="clouds_one"></div>
|
||||||
|
<div class="clouds_two"></div>
|
||||||
|
<div class="clouds_three"></div>
|
||||||
|
</div>
|
||||||
|
</body>
|
||||||
|
</html>
|
||||||
@ -0,0 +1,33 @@
|
|||||||
|
<!--
|
||||||
|
~ Copyright 2016 WSO2, Inc. (http://wso2.com)
|
||||||
|
~
|
||||||
|
~ Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
~ you may not use this file except in compliance with the License.
|
||||||
|
~ You may obtain a copy of the License at
|
||||||
|
~
|
||||||
|
~ http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
~
|
||||||
|
~ Unless required by applicable law or agreed to in writing, software
|
||||||
|
~ distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
~ See the License for the specific language governing permissions and
|
||||||
|
~ limitations under the License.
|
||||||
|
-->
|
||||||
|
|
||||||
|
<!DOCTYPE html>
|
||||||
|
<html lang="en">
|
||||||
|
<head>
|
||||||
|
<meta charset="utf-8">
|
||||||
|
<title>Method not allowed - Error 405</title>
|
||||||
|
<meta name="viewport" content="width=device-width, initial-scale=1.0">
|
||||||
|
<meta name="description" content="">
|
||||||
|
<meta name="author" content="">
|
||||||
|
</head>
|
||||||
|
<body>
|
||||||
|
<i class="icon-unlink error-icon"></i>
|
||||||
|
<h1>Error 405</h1>
|
||||||
|
<h3>Method not allowed.</h3>
|
||||||
|
<h4 id="link"><a href="/devicemgt">Go to IoT Home</a></h4>
|
||||||
|
</body>
|
||||||
|
</html>
|
||||||
|
|
||||||
@ -0,0 +1,30 @@
|
|||||||
|
<!DOCTYPE html>
|
||||||
|
<html>
|
||||||
|
<head>
|
||||||
|
<meta charset='UTF-8'>
|
||||||
|
<link rel="stylesheet" href="https://error.cloud.wso2.com/style/style.css">
|
||||||
|
<link rel="stylesheet" href="https://error.cloud.wso2.com/style/font-mf.css">
|
||||||
|
</head>
|
||||||
|
<body>
|
||||||
|
<div class="sky">
|
||||||
|
<section>
|
||||||
|
<div class="error-400">
|
||||||
|
<img src="https://error.cloud.wso2.com/images/400-error.svg">
|
||||||
|
</div>
|
||||||
|
<div class="text-label">
|
||||||
|
<h1>Oops something went wrong </h1>
|
||||||
|
<h2>500 - Internal Server Error</h2>
|
||||||
|
<div style="clear: both"></div>
|
||||||
|
<div class="button-label">
|
||||||
|
<a href="https://cloudmgt.cloud.wso2.com/cloudmgt/site/pages/index.jag"><label class="label-back">Back to Cloud </label></a>
|
||||||
|
<a href="https://cloudmgt.cloud.wso2.com/cloudmgt/site/pages/contact-us.jag"><label class="label-report"> Report Issue </label></a>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</section>
|
||||||
|
|
||||||
|
<div class="clouds_one"></div>
|
||||||
|
<div class="clouds_two"></div>
|
||||||
|
<div class="clouds_three"></div>
|
||||||
|
</div>
|
||||||
|
</body>
|
||||||
|
</html>
|
||||||
@ -0,0 +1,32 @@
|
|||||||
|
<!--
|
||||||
|
~ Copyright 2016 WSO2, Inc. (http://wso2.com)
|
||||||
|
~
|
||||||
|
~ Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
~ you may not use this file except in compliance with the License.
|
||||||
|
~ You may obtain a copy of the License at
|
||||||
|
~
|
||||||
|
~ http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
~
|
||||||
|
~ Unless required by applicable law or agreed to in writing, software
|
||||||
|
~ distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
~ See the License for the specific language governing permissions and
|
||||||
|
~ limitations under the License.
|
||||||
|
-->
|
||||||
|
|
||||||
|
<!DOCTYPE html>
|
||||||
|
<html lang="en">
|
||||||
|
<head>
|
||||||
|
<meta charset="utf-8">
|
||||||
|
<title>Internal Server Error - Error 500</title>
|
||||||
|
<meta name="viewport" content="width=device-width, initial-scale=1.0">
|
||||||
|
<meta name="description" content="">
|
||||||
|
<meta name="author" content="">
|
||||||
|
<body>
|
||||||
|
<i class="icon-ambulance error-icon"></i>
|
||||||
|
<h1>Error 500</h1>
|
||||||
|
<h3>Something went wrong and we're trying to fix it.</h3>
|
||||||
|
<h4 id="link"><a href="/devicemgt">Go to IoT Home</a></h4>
|
||||||
|
</body>
|
||||||
|
</html>
|
||||||
|
|
||||||
@ -0,0 +1,101 @@
|
|||||||
|
{
|
||||||
|
"displayName": "Carbon Application Management App",
|
||||||
|
"logLevel": "info",
|
||||||
|
"initScripts": ["/app/modules/init.js"],
|
||||||
|
"urlMappings": [
|
||||||
|
{
|
||||||
|
"url": "/uuf/login",
|
||||||
|
"path": "/lib/modules/auth/login.jag"
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"url": "/uuf/logout",
|
||||||
|
"path": "/lib/modules/auth/logout.jag"
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"url": "/uuf/sso/acs",
|
||||||
|
"path": "/lib/modules/auth/acs.jag"
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"url": "/public/*",
|
||||||
|
"path": "/lib/static-files.jag"
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"url": "/unit/*",
|
||||||
|
"path": "/lib/units.jag"
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"url": "/*",
|
||||||
|
"path": "/lib/pages.jag"
|
||||||
|
}
|
||||||
|
],
|
||||||
|
"errorPages": {
|
||||||
|
"500": "/error-pages/error500.html",
|
||||||
|
"404": "/error-pages/error404.html",
|
||||||
|
"401": "/error-pages/error401.html",
|
||||||
|
"405": "/error-pages/error405.html",
|
||||||
|
"403": "/error-pages/error403.html",
|
||||||
|
"400": "/error-pages/error400.html"
|
||||||
|
},
|
||||||
|
"filters": [
|
||||||
|
{
|
||||||
|
"name": "ContentTypeBasedCachePreventionFilter",
|
||||||
|
"class": "org.wso2.carbon.ui.filters.cache.ContentTypeBasedCachePreventionFilter",
|
||||||
|
"params" : [
|
||||||
|
{"name" : "patterns", "value" : "text/html\" ,application/json\" ,text/plain"},
|
||||||
|
{"name" : "filterAction", "value" : "enforce"},
|
||||||
|
{"name" : "httpHeaders", "value" : "Cache-Control: no-store, no-cache, must-revalidate, private"}
|
||||||
|
]
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"name":"HttpHeaderSecurityFilter",
|
||||||
|
"class":"org.apache.catalina.filters.HttpHeaderSecurityFilter",
|
||||||
|
"params" : [{"name" : "hstsEnabled", "value" : "false"}]
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"name" : "CSRFGuard",
|
||||||
|
"class" : "org.owasp.csrfguard.CsrfGuardFilter"
|
||||||
|
}
|
||||||
|
|
||||||
|
],
|
||||||
|
"filterMappings": [
|
||||||
|
{
|
||||||
|
"name":"HttpHeaderSecurityFilter",
|
||||||
|
"url":"*"
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"name" : "CSRFGuard",
|
||||||
|
"url" : "/*"
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"name":"ContentTypeBasedCachePreventionFilter",
|
||||||
|
"url":"*"
|
||||||
|
}
|
||||||
|
|
||||||
|
],
|
||||||
|
"listeners" : [
|
||||||
|
{
|
||||||
|
"class" : "org.owasp.csrfguard.CsrfGuardServletContextListener"
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"class" : "org.owasp.csrfguard.CsrfGuardHttpSessionListener"
|
||||||
|
}
|
||||||
|
],
|
||||||
|
"servlets" : [
|
||||||
|
{
|
||||||
|
"name" : "JavaScriptServlet",
|
||||||
|
"class" : "org.owasp.csrfguard.servlet.JavaScriptServlet"
|
||||||
|
}
|
||||||
|
],
|
||||||
|
"servletMappings" : [
|
||||||
|
{
|
||||||
|
"name" : "JavaScriptServlet",
|
||||||
|
"url" : "/csrf.js"
|
||||||
|
}
|
||||||
|
],
|
||||||
|
"contextParams" : [
|
||||||
|
{
|
||||||
|
"name" : "Owasp.CsrfGuard.Config",
|
||||||
|
"value" : "repository/conf/security/Owasp.CsrfGuard.dashboard.properties"
|
||||||
|
}
|
||||||
|
]
|
||||||
|
}
|
||||||
@ -0,0 +1,45 @@
|
|||||||
|
{
|
||||||
|
"appName": "UUF Template App",
|
||||||
|
"cachingEnabled": false,
|
||||||
|
"debuggingEnabled": false,
|
||||||
|
"permissionRoot": "/",
|
||||||
|
"loginPage": "uuf.page.sign-in",
|
||||||
|
"adminServicesUrl": "https://${server.ip}:${server.https_port}/admin/services/",
|
||||||
|
"authModule": {
|
||||||
|
"enabled": true,
|
||||||
|
"login": {
|
||||||
|
"onSuccess": {
|
||||||
|
"script": "/app/modules/login.js",
|
||||||
|
"page": "uuf.page.home"
|
||||||
|
},
|
||||||
|
"onFail": {
|
||||||
|
"script": "/app/modules/login.js",
|
||||||
|
"page": "uuf.page.sign-in"
|
||||||
|
}
|
||||||
|
},
|
||||||
|
"logout": {
|
||||||
|
"onSuccess": {
|
||||||
|
"script": "/app/modules/logout.js",
|
||||||
|
"page": "uuf.page.sign-in"
|
||||||
|
},
|
||||||
|
"onFail": {
|
||||||
|
"script": "/app/modules/logout.js",
|
||||||
|
"page": "uuf.page.home"
|
||||||
|
}
|
||||||
|
},
|
||||||
|
"sso": {
|
||||||
|
"enabled": false,
|
||||||
|
"issuer": "uuf",
|
||||||
|
"responseSigningEnabled": true,
|
||||||
|
"keyStoreName": "repository/resources/security/wso2carbon.jks",
|
||||||
|
"keyStorePassword": "wso2carbon",
|
||||||
|
"identityProviderAlias": "wso2carbon",
|
||||||
|
"identityProviderUrl": "https://${server.ip}:${server.https_port}/samlsso",
|
||||||
|
"intermediatePage": "uuf.page.sso-intermediate"
|
||||||
|
}
|
||||||
|
},
|
||||||
|
"errorPages": {
|
||||||
|
"404": "uuf.page.error",
|
||||||
|
"default": "uuf.page.error"
|
||||||
|
}
|
||||||
|
}
|
||||||
@ -0,0 +1,4 @@
|
|||||||
|
{
|
||||||
|
"displayName": "UUF Template App",
|
||||||
|
"logLevel": "debug"
|
||||||
|
}
|
||||||
@ -0,0 +1,67 @@
|
|||||||
|
{{!--
|
||||||
|
* Copyright (c) 2016, WSO2 Inc. (http://www.wso2.org) All Rights Reserved.
|
||||||
|
*
|
||||||
|
* WSO2 Inc. licenses this file to you under the Apache License,
|
||||||
|
* Version 2.0 (the "License"); you may not use this file except
|
||||||
|
* in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing,
|
||||||
|
* software distributed under the License is distributed on an
|
||||||
|
* "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||||
|
* KIND, either express or implied. See the License for the
|
||||||
|
* specific language governing permissions and limitations
|
||||||
|
* under the License.
|
||||||
|
--}}
|
||||||
|
|
||||||
|
<!DOCTYPE html>
|
||||||
|
<html lang="en">
|
||||||
|
<head>
|
||||||
|
<meta charset="utf-8">
|
||||||
|
<meta http-equiv="X-UA-Compatible" content="IE=edge">
|
||||||
|
<meta name="viewport" content="width=device-width, initial-scale=1">
|
||||||
|
|
||||||
|
<title>{{#defineZone "title"}}WSO2 Template{{/defineZone}}</title>
|
||||||
|
{{defineZone "favicon"}}
|
||||||
|
{{defineZone "topCss"}}
|
||||||
|
{{defineZone "topJs"}}
|
||||||
|
</head>
|
||||||
|
<body>
|
||||||
|
<!-- header -->
|
||||||
|
{{defineZone "header"}}
|
||||||
|
<!-- /header -->
|
||||||
|
|
||||||
|
<!-- navbars -->
|
||||||
|
<div class="navbar-wrapper">
|
||||||
|
{{defineZone "navbars"}}
|
||||||
|
</div>
|
||||||
|
<!-- /navbars -->
|
||||||
|
|
||||||
|
<!-- sidepanes -->
|
||||||
|
{{defineZone "sidePanes"}}
|
||||||
|
<!-- /sidepanes -->
|
||||||
|
|
||||||
|
<!-- page-content-wrapper -->
|
||||||
|
<div class="page-content-wrapper">
|
||||||
|
{{defineZone "contentTitle"}}
|
||||||
|
<div class="container-fluid ">
|
||||||
|
<div class="body-wrapper">
|
||||||
|
{{defineZone "content"}}
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
<!-- /page-content-wrapper -->
|
||||||
|
|
||||||
|
<!-- footer -->
|
||||||
|
<footer class="footer">
|
||||||
|
<div class="container-fluid">
|
||||||
|
{{defineZone "footer"}}
|
||||||
|
</div>
|
||||||
|
</footer>
|
||||||
|
<!-- /footer -->
|
||||||
|
|
||||||
|
{{defineZone "bottomJs"}}
|
||||||
|
</body>
|
||||||
|
</html>
|
||||||
@ -0,0 +1,56 @@
|
|||||||
|
{{!--
|
||||||
|
* Copyright (c) 2016, WSO2 Inc. (http://www.wso2.org) All Rights Reserved.
|
||||||
|
*
|
||||||
|
* WSO2 Inc. licenses this file to you under the Apache License,
|
||||||
|
* Version 2.0 (the "License"); you may not use this file except
|
||||||
|
* in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing,
|
||||||
|
* software distributed under the License is distributed on an
|
||||||
|
* "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||||
|
* KIND, either express or implied. See the License for the
|
||||||
|
* specific language governing permissions and limitations
|
||||||
|
* under the License.
|
||||||
|
--}}
|
||||||
|
|
||||||
|
<!DOCTYPE html>
|
||||||
|
<html lang="en">
|
||||||
|
<head>
|
||||||
|
<meta charset="utf-8">
|
||||||
|
<meta http-equiv="X-UA-Compatible" content="IE=edge">
|
||||||
|
<meta name="viewport" content="width=device-width, initial-scale=1">
|
||||||
|
|
||||||
|
<title>{{#defineZone "title"}}WSO2 Template{{/defineZone}}</title>
|
||||||
|
{{defineZone "favicon"}}
|
||||||
|
{{defineZone "topCss"}}
|
||||||
|
{{defineZone "topJs"}}
|
||||||
|
</head>
|
||||||
|
<body>
|
||||||
|
<!-- header -->
|
||||||
|
{{defineZone "header"}}
|
||||||
|
<!-- /header -->
|
||||||
|
|
||||||
|
<!-- page-content-wrapper -->
|
||||||
|
<div class="page-content-wrapper">
|
||||||
|
<div class="container-fluid ">
|
||||||
|
<div class="body-wrapper">
|
||||||
|
{{defineZone "content"}}
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
<!-- /page-content-wrapper -->
|
||||||
|
|
||||||
|
<!-- footer -->
|
||||||
|
<footer class="footer">
|
||||||
|
<div class="container-fluid">
|
||||||
|
{{defineZone "footer"}}
|
||||||
|
</div>
|
||||||
|
</footer>
|
||||||
|
<!-- /footer -->
|
||||||
|
|
||||||
|
{{defineZone "bottomJs"}}
|
||||||
|
</body>
|
||||||
|
</html>
|
||||||
@ -0,0 +1,38 @@
|
|||||||
|
{{!
|
||||||
|
Copyright (c) 2016, WSO2 Inc. (http://www.wso2.org) All Rights Reserved.
|
||||||
|
|
||||||
|
WSO2 Inc. licenses this file to you under the Apache License,
|
||||||
|
Version 2.0 (the "License"); you may not use this file except
|
||||||
|
in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing,
|
||||||
|
software distributed under the License is distributed on an
|
||||||
|
"AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||||
|
KIND, either express or implied. See the License for the
|
||||||
|
specific language governing permissions and limitations
|
||||||
|
under the License.
|
||||||
|
}}
|
||||||
|
{{#zone "title"}}Error | {{@app.conf.appName}}{{/zone}}
|
||||||
|
|
||||||
|
{{#zone "breadcrumbs"}}
|
||||||
|
<li>
|
||||||
|
<a href="{{@app.context}}/">
|
||||||
|
<i class="icon fw fw-home"></i>
|
||||||
|
</a>
|
||||||
|
</li>
|
||||||
|
{{/zone}}
|
||||||
|
|
||||||
|
{{#zone "content"}}
|
||||||
|
<div class="message message-danger">
|
||||||
|
<h4><i class="icon fw fw-error"></i>An Error Occurred!</h4>
|
||||||
|
|
||||||
|
<div style="padding-left: 25px;">
|
||||||
|
<h5><b>HTTP Status : {{@page.params.status}}</b></h5>
|
||||||
|
|
||||||
|
<p style="white-space: pre-wrap;">{{@page.params.message}}</p>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
{{/zone}}
|
||||||
@ -0,0 +1,6 @@
|
|||||||
|
{
|
||||||
|
"version": "1.0.0",
|
||||||
|
"uri": "/error/default",
|
||||||
|
"layout": "uuf.layout.default",
|
||||||
|
"isAnonymous": true
|
||||||
|
}
|
||||||
@ -0,0 +1,24 @@
|
|||||||
|
$(document).ready(function(){
|
||||||
|
$("#signInForm").validate({
|
||||||
|
rules: {
|
||||||
|
username: {
|
||||||
|
required: true,
|
||||||
|
minlength: 3
|
||||||
|
},
|
||||||
|
password: {
|
||||||
|
required: true,
|
||||||
|
minlength: 3
|
||||||
|
}
|
||||||
|
},
|
||||||
|
messages: {
|
||||||
|
username: {
|
||||||
|
required: "Please enter a username",
|
||||||
|
minlength: "Your username must consist of at least 3 characters"
|
||||||
|
},
|
||||||
|
password: {
|
||||||
|
required: "Please provide a password",
|
||||||
|
minlength: "Your password must be at least 3 characters long"
|
||||||
|
}
|
||||||
|
}
|
||||||
|
});
|
||||||
|
});
|
||||||
@ -0,0 +1,63 @@
|
|||||||
|
{{!
|
||||||
|
Copyright (c) 2016, WSO2 Inc. (http://www.wso2.org) All Rights Reserved.
|
||||||
|
|
||||||
|
WSO2 Inc. licenses this file to you under the Apache License,
|
||||||
|
Version 2.0 (the "License"); you may not use this file except
|
||||||
|
in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing,
|
||||||
|
software distributed under the License is distributed on an
|
||||||
|
"AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||||
|
KIND, either express or implied. See the License for the
|
||||||
|
specific language governing permissions and limitations
|
||||||
|
under the License.
|
||||||
|
}}
|
||||||
|
{{#zone "title"}}Sign In | {{@app.conf.appName}}{{/zone}}
|
||||||
|
|
||||||
|
{{~#zone "content"}}
|
||||||
|
<div class="col-sm-7 col-md-4 center-block" style="float: none; margin-top: 10%;">
|
||||||
|
<div class="panel panel-default">
|
||||||
|
<div class="panel-heading">
|
||||||
|
<h4 class="panel-title">
|
||||||
|
{{#defineZone "signIn-title" scope="protected"}}Sign In to UUF Template App{{/defineZone}}
|
||||||
|
</h4>
|
||||||
|
</div>
|
||||||
|
<div class="panel-body">
|
||||||
|
{{#if message}}
|
||||||
|
<div id="_uuf_login-error-msg" class="alert alert-danger">
|
||||||
|
<i class="icon fw fw-warning"></i> {{message}}!
|
||||||
|
</div>
|
||||||
|
{{/if}}
|
||||||
|
<form id="signInForm" method="POST"
|
||||||
|
class="{{defineZone "signInForm-class" scope="protected"}}"
|
||||||
|
action="{{#defineZone "signInForm-action" scope="protected"}}{{@app.context}}/uuf/login{{/defineZone}}">
|
||||||
|
<div class="form-group">
|
||||||
|
<input type="text" name="username" class="form-control"
|
||||||
|
placeholder="User Name" required="required" autofocus="autofocus" />
|
||||||
|
</div>
|
||||||
|
<div class="form-group">
|
||||||
|
<input type="password" name="password" class="form-control" autocomplete="off"
|
||||||
|
placeholder="Password" required="required" />
|
||||||
|
</div>
|
||||||
|
{{#if referer}}
|
||||||
|
<input type="hidden" name="referer" value="{{referer}}" />
|
||||||
|
{{/if}}
|
||||||
|
<div class="form-group" style="padding-top: 10px;">
|
||||||
|
<input type="submit" name="signInBtn" class="btn btn-primary btn-block"
|
||||||
|
value="Sign In" />
|
||||||
|
</div>
|
||||||
|
{{defineZone "signInForm-below" scope="protected"}}
|
||||||
|
</form>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
{{/zone}}
|
||||||
|
|
||||||
|
{{! sign-in form validation}}
|
||||||
|
{{~unit "uuf.unit.lib.form-validation"}}
|
||||||
|
{{~#zone "bottomJs"}}
|
||||||
|
{{~js "js/sign-in-validations.js"}}
|
||||||
|
{{/zone}}
|
||||||
@ -0,0 +1,30 @@
|
|||||||
|
function onRequest(context) {
|
||||||
|
var authModuleConfigs = context.app.conf["authModule"];
|
||||||
|
if (authModuleConfigs && (authModuleConfigs["enabled"].toString() == "true")) {
|
||||||
|
// Auth module is enabled.
|
||||||
|
if (context.user) {
|
||||||
|
// User is already logged in.
|
||||||
|
response.sendRedirect(context.app.context + "/");
|
||||||
|
exit();
|
||||||
|
} else {
|
||||||
|
// User is not logged in.
|
||||||
|
var ssoConfigs = authModuleConfigs["sso"];
|
||||||
|
if (ssoConfigs && (ssoConfigs["enabled"].toString() == "true")) {
|
||||||
|
// SSO is enabled in Auth module.
|
||||||
|
var redirectUri = context.app.context + "/uuf/login";
|
||||||
|
var queryString = request.getQueryString();
|
||||||
|
if (queryString && (queryString.length > 0)) {
|
||||||
|
redirectUri = redirectUri + "?" + queryString;
|
||||||
|
}
|
||||||
|
response.sendRedirect(encodeURI(redirectUri));
|
||||||
|
exit();
|
||||||
|
} else {
|
||||||
|
// Generic login process is enabled.
|
||||||
|
return {
|
||||||
|
message: request.getParameter("error"),
|
||||||
|
referer: request.getParameter("referer")
|
||||||
|
};
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@ -0,0 +1,6 @@
|
|||||||
|
{
|
||||||
|
"version": "1.0.0",
|
||||||
|
"uri": "/signin",
|
||||||
|
"layout": "uuf.layout.sign-in",
|
||||||
|
"isAnonymous": true
|
||||||
|
}
|
||||||
@ -0,0 +1,18 @@
|
|||||||
|
{{!
|
||||||
|
Copyright (c) 2016, WSO2 Inc. (http://www.wso2.org) All Rights Reserved.
|
||||||
|
|
||||||
|
WSO2 Inc. licenses this file to you under the Apache License,
|
||||||
|
Version 2.0 (the "License"); you may not use this file except
|
||||||
|
in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing,
|
||||||
|
software distributed under the License is distributed on an
|
||||||
|
"AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||||
|
KIND, either express or implied. See the License for the
|
||||||
|
specific language governing permissions and limitations
|
||||||
|
under the License.
|
||||||
|
}}
|
||||||
|
{{! This template won't be rendered. So nothing is here }}
|
||||||
@ -0,0 +1,16 @@
|
|||||||
|
function onRequest(context) {
|
||||||
|
var authModuleConfigs = context.app.conf["authModule"];
|
||||||
|
if (authModuleConfigs && (authModuleConfigs["enabled"].toString() == "true")) {
|
||||||
|
// Auth module is enabled.
|
||||||
|
if (context.user) {
|
||||||
|
// User is logged in.
|
||||||
|
response.sendRedirect(context.app.context + "/uuf/logout");
|
||||||
|
exit();
|
||||||
|
} else {
|
||||||
|
// User is already logged out.
|
||||||
|
response.sendRedirect(context.app.context + "/");
|
||||||
|
exit();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
@ -0,0 +1,5 @@
|
|||||||
|
{
|
||||||
|
"version": "1.0.0",
|
||||||
|
"uri": "/signout",
|
||||||
|
"layout": "uuf.layout.sign-in"
|
||||||
|
}
|
||||||
@ -0,0 +1,45 @@
|
|||||||
|
{{!
|
||||||
|
Copyright (c) 2016, WSO2 Inc. (http://www.wso2.org) All Rights Reserved.
|
||||||
|
|
||||||
|
WSO2 Inc. licenses this file to you under the Apache License,
|
||||||
|
Version 2.0 (the "License"); you may not use this file except
|
||||||
|
in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing,
|
||||||
|
software distributed under the License is distributed on an
|
||||||
|
"AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||||
|
KIND, either express or implied. See the License for the
|
||||||
|
specific language governing permissions and limitations
|
||||||
|
under the License.
|
||||||
|
}}
|
||||||
|
{{#zone "title"}}Sign In | {{@app.conf.appName}}{{/zone}}
|
||||||
|
|
||||||
|
{{unit "uuf.unit.theme"}}
|
||||||
|
{{unit "uuf.unit.header.logo"}}{{unit "uuf.unit.header"}}
|
||||||
|
{{unit "uuf.unit.footer"}}
|
||||||
|
|
||||||
|
{{#zone "content"}}
|
||||||
|
<div class="jumbotron">
|
||||||
|
<p>
|
||||||
|
You are now being redirected to Identity Server. If the redirection fails, please click
|
||||||
|
on the button below.
|
||||||
|
</p>
|
||||||
|
|
||||||
|
<div>
|
||||||
|
<form method="post" action="{{@page.params.identityProviderUrl}}">
|
||||||
|
<input type="hidden" name="SAMLRequest"
|
||||||
|
value="{{@page.params.encodedSAMLAuthRequest}}" />
|
||||||
|
<input type="hidden" name="RelayState" value="{{@page.params.relayState}}" />
|
||||||
|
<input type="hidden" name="SSOAuthSessionID" value="{{@page.params.sessionId}}" />
|
||||||
|
<button type="submit" class="btn btn-primary">Redirect manually</button>
|
||||||
|
</form>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
{{/zone}}
|
||||||
|
|
||||||
|
{{#zone "bottomJs"}}
|
||||||
|
<script type="text/javascript">document.forms[0].submit();</script>
|
||||||
|
{{/zone}}
|
||||||
@ -0,0 +1,6 @@
|
|||||||
|
{
|
||||||
|
"version": "1.0.0",
|
||||||
|
"uri": "//",
|
||||||
|
"layout": "uuf.layout.sign-in",
|
||||||
|
"isAnonymous": true
|
||||||
|
}
|
||||||
@ -0,0 +1,27 @@
|
|||||||
|
{{!
|
||||||
|
Copyright (c) 2016, WSO2 Inc. (http://www.wso2.org) All Rights Reserved.
|
||||||
|
|
||||||
|
WSO2 Inc. licenses this file to you under the Apache License,
|
||||||
|
Version 2.0 (the "License"); you may not use this file except
|
||||||
|
in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing,
|
||||||
|
software distributed under the License is distributed on an
|
||||||
|
"AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||||
|
KIND, either express or implied. See the License for the
|
||||||
|
specific language governing permissions and limitations
|
||||||
|
under the License.
|
||||||
|
}}
|
||||||
|
<div {{#if @unit.params.id}}id="{{@unit.params.id}}" {{/if~}}
|
||||||
|
class="alert alert-{{@unit.params.type}}" role="alert">
|
||||||
|
<i class="icon fw fw-{{icon}}"></i>
|
||||||
|
<strong>{{@unit.params.title}}</strong> {{{@unit.params.message}}}
|
||||||
|
{{#if @unit.params.dismissable}}
|
||||||
|
<button type="button" class="close" aria-label="close" data-dismiss="alert">
|
||||||
|
<span aria-hidden="true"><i class="fw fw-cancel"></i></span>
|
||||||
|
</button>
|
||||||
|
{{/if}}
|
||||||
|
</div>
|
||||||
@ -0,0 +1,15 @@
|
|||||||
|
function onRequest(context) {
|
||||||
|
var type = context.unit.params.type;
|
||||||
|
switch (type) {
|
||||||
|
case "success":
|
||||||
|
return {icon: "ok"};
|
||||||
|
case "info":
|
||||||
|
return {icon: "info"};
|
||||||
|
case "warning":
|
||||||
|
return {icon: "warning"};
|
||||||
|
case "danger":
|
||||||
|
return {icon: "error"};
|
||||||
|
default:
|
||||||
|
return {icon: "ok"};
|
||||||
|
}
|
||||||
|
}
|
||||||
@ -0,0 +1,4 @@
|
|||||||
|
{
|
||||||
|
"version": "1.0.0",
|
||||||
|
"isAnonymous": true
|
||||||
|
}
|
||||||
@ -0,0 +1,24 @@
|
|||||||
|
{{!
|
||||||
|
Copyright (c) 2016, WSO2 Inc. (http://www.wso2.org) All Rights Reserved.
|
||||||
|
|
||||||
|
WSO2 Inc. licenses this file to you under the Apache License,
|
||||||
|
Version 2.0 (the "License"); you may not use this file except
|
||||||
|
in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing,
|
||||||
|
software distributed under the License is distributed on an
|
||||||
|
"AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||||
|
KIND, either express or implied. See the License for the
|
||||||
|
specific language governing permissions and limitations
|
||||||
|
under the License.
|
||||||
|
}}
|
||||||
|
{{#zone "favicon"}}
|
||||||
|
{{#if isCloud}}
|
||||||
|
<link rel="shortcut icon" href="{{@unit.publicUri}}/img/cloud-favicon.png" />
|
||||||
|
{{else}}
|
||||||
|
<link rel="shortcut icon" href="{{@unit.publicUri}}/img/favicon.png" />
|
||||||
|
{{/if}}
|
||||||
|
{{/zone}}
|
||||||
@ -0,0 +1,8 @@
|
|||||||
|
function onRequest(context) {
|
||||||
|
|
||||||
|
var deviceMgtProps = require("/app/modules/conf-reader/main.js")["conf"];
|
||||||
|
var viewModel = {};
|
||||||
|
viewModel.isCloud = deviceMgtProps.isCloud;
|
||||||
|
return viewModel;
|
||||||
|
|
||||||
|
}
|
||||||
@ -0,0 +1,8 @@
|
|||||||
|
{
|
||||||
|
"version": "1.0.0",
|
||||||
|
"pushedUris": [
|
||||||
|
"/",
|
||||||
|
"/{+any}"
|
||||||
|
],
|
||||||
|
"isAnonymous": true
|
||||||
|
}
|
||||||
|
After Width: | Height: | Size: 882 B |
|
After Width: | Height: | Size: 1.9 KiB |
@ -0,0 +1,23 @@
|
|||||||
|
{{!
|
||||||
|
Copyright (c) 2016, WSO2 Inc. (http://www.wso2.org) All Rights Reserved.
|
||||||
|
|
||||||
|
WSO2 Inc. licenses this file to you under the Apache License,
|
||||||
|
Version 2.0 (the "License"); you may not use this file except
|
||||||
|
in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing,
|
||||||
|
software distributed under the License is distributed on an
|
||||||
|
"AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||||
|
KIND, either express or implied. See the License for the
|
||||||
|
specific language governing permissions and limitations
|
||||||
|
under the License.
|
||||||
|
}}
|
||||||
|
{{#zone "footer"}}
|
||||||
|
<p>
|
||||||
|
WSO2 | © 2015
|
||||||
|
<a href="http://wso2.com/" target="_blank"><i class="icon fw fw-wso2"></i> Inc</a>.
|
||||||
|
</p>
|
||||||
|
{{/zone}}
|
||||||
@ -0,0 +1,8 @@
|
|||||||
|
{
|
||||||
|
"version": "1.0.0",
|
||||||
|
"pushedUris": [
|
||||||
|
"/",
|
||||||
|
"/{+any}"
|
||||||
|
],
|
||||||
|
"isAnonymous": true
|
||||||
|
}
|
||||||
@ -0,0 +1,27 @@
|
|||||||
|
{{!
|
||||||
|
Copyright (c) 2016, WSO2 Inc. (http://www.wso2.org) All Rights Reserved.
|
||||||
|
|
||||||
|
WSO2 Inc. licenses this file to you under the Apache License,
|
||||||
|
Version 2.0 (the "License"); you may not use this file except
|
||||||
|
in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing,
|
||||||
|
software distributed under the License is distributed on an
|
||||||
|
"AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||||
|
KIND, either express or implied. See the License for the
|
||||||
|
specific language governing permissions and limitations
|
||||||
|
under the License.
|
||||||
|
}}
|
||||||
|
{{#zone "brand"}}
|
||||||
|
<a href="{{#defineZone "productUri"}}{{@app.context}}/{{/defineZone}}">
|
||||||
|
<img src="{{@unit.publicUri}}/img/logo.png" alt="{{defineZone "productName"}}"
|
||||||
|
title="{{defineZone "productName"}}" class="logo" />
|
||||||
|
<h1>
|
||||||
|
<span class="hidden-xs">{{#defineZone "productName"}}Unified UI Template App{{/defineZone}}</span>
|
||||||
|
<span class="visible-xs-inline">{{#defineZone "productNameResponsive"}}UUI Tmpl. App{{/defineZone}}</span>
|
||||||
|
</h1>
|
||||||
|
</a>
|
||||||
|
{{/zone}}
|
||||||
@ -0,0 +1,9 @@
|
|||||||
|
{
|
||||||
|
"version": "1.0.0",
|
||||||
|
"index": 9100,
|
||||||
|
"pushedUris": [
|
||||||
|
"/",
|
||||||
|
"/{+any}"
|
||||||
|
],
|
||||||
|
"isAnonymous": true
|
||||||
|
}
|
||||||
|
After Width: | Height: | Size: 3.0 KiB |
@ -0,0 +1,39 @@
|
|||||||
|
{{!
|
||||||
|
Copyright (c) 2016, WSO2 Inc. (http://www.wso2.org) All Rights Reserved.
|
||||||
|
|
||||||
|
WSO2 Inc. licenses this file to you under the Apache License,
|
||||||
|
Version 2.0 (the "License"); you may not use this file except
|
||||||
|
in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing,
|
||||||
|
software distributed under the License is distributed on an
|
||||||
|
"AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||||
|
KIND, either express or implied. See the License for the
|
||||||
|
specific language governing permissions and limitations
|
||||||
|
under the License.
|
||||||
|
}}
|
||||||
|
{{#zone "userMenu"}}
|
||||||
|
<ul class="nav navbar-right float-remove-xs text-center-xs">
|
||||||
|
<li class="visible-inline-block">
|
||||||
|
<a href="#" class="dropdown" data-toggle="dropdown">
|
||||||
|
<span class="icon fw-stack fw-lg">
|
||||||
|
<i class="fw fw-circle fw-stack-2x"></i>
|
||||||
|
<i class="fw fw-user fw-stack-1x fw-inverse"></i>
|
||||||
|
</span>
|
||||||
|
<span class="hidden-xs add-padding-left-1x">
|
||||||
|
{{@user.username}}<span class="caret"></span>
|
||||||
|
</span>
|
||||||
|
</a>
|
||||||
|
<ul class="dropdown-menu dropdown-menu-right slideInDown" role="menu">
|
||||||
|
{{#defineZone "userMenu-items"}}
|
||||||
|
<li>
|
||||||
|
<a href="{{@app.context}}/signout">Sign Out</a>
|
||||||
|
</li>
|
||||||
|
{{/defineZone}}
|
||||||
|
</ul>
|
||||||
|
</li>
|
||||||
|
</ul>
|
||||||
|
{{/zone}}
|
||||||
@ -0,0 +1,8 @@
|
|||||||
|
{
|
||||||
|
"version": "1.0.0",
|
||||||
|
"index": 9110,
|
||||||
|
"pushedUris": [
|
||||||
|
"/",
|
||||||
|
"/{+any}"
|
||||||
|
]
|
||||||
|
}
|
||||||
@ -0,0 +1,32 @@
|
|||||||
|
{{!
|
||||||
|
Copyright (c) 2016, WSO2 Inc. (http://www.wso2.org) All Rights Reserved.
|
||||||
|
|
||||||
|
WSO2 Inc. licenses this file to you under the Apache License,
|
||||||
|
Version 2.0 (the "License"); you may not use this file except
|
||||||
|
in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing,
|
||||||
|
software distributed under the License is distributed on an
|
||||||
|
"AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||||
|
KIND, either express or implied. See the License for the
|
||||||
|
specific language governing permissions and limitations
|
||||||
|
under the License.
|
||||||
|
}}
|
||||||
|
{{#zone "header"}}
|
||||||
|
<header class="header header-default">
|
||||||
|
<div class="container-fluid">
|
||||||
|
<div class="pull-left brand">
|
||||||
|
{{defineZone "brand"}}
|
||||||
|
</div>
|
||||||
|
<div class="pull-left brand">
|
||||||
|
{{defineZone "cloudMenu"}}
|
||||||
|
</div>
|
||||||
|
<div class="pull-right auth">
|
||||||
|
{{defineZone "userMenu"}}
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</header>
|
||||||
|
{{/zone}}
|
||||||
@ -0,0 +1,9 @@
|
|||||||
|
{
|
||||||
|
"version": "1.0.0",
|
||||||
|
"index": 9199,
|
||||||
|
"pushedUris": [
|
||||||
|
"/",
|
||||||
|
"/{+any}"
|
||||||
|
],
|
||||||
|
"isAnonymous": true
|
||||||
|
}
|
||||||
@ -0,0 +1,27 @@
|
|||||||
|
{{!
|
||||||
|
Copyright (c) 2016, WSO2 Inc. (http://www.wso2.org) All Rights Reserved.
|
||||||
|
|
||||||
|
WSO2 Inc. licenses this file to you under the Apache License,
|
||||||
|
Version 2.0 (the "License"); you may not use this file except
|
||||||
|
in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing,
|
||||||
|
software distributed under the License is distributed on an
|
||||||
|
"AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
|
||||||
|
KIND, either express or implied. See the License for the
|
||||||
|
specific language governing permissions and limitations
|
||||||
|
under the License.
|
||||||
|
}}
|
||||||
|
{{#zone "topCss"}}
|
||||||
|
{{~css "data-tables_1.10.7/extensions/Bootstrap/css/dataTables.bootstrap.css"}}
|
||||||
|
{{~css "data-tables_1.10.7/extensions/Responsive/css/dataTables.responsive.css"}}
|
||||||
|
{{/zone}}
|
||||||
|
|
||||||
|
{{~#zone "bottomJs"}}
|
||||||
|
{{~js "data-tables_1.10.7/media/js/jquery.dataTables.min.js"}}
|
||||||
|
{{~js "data-tables_1.10.7/extensions/Bootstrap/js/dataTables.bootstrap.js"}}
|
||||||
|
{{~js "data-tables_1.10.7/extensions/Responsive/js/dataTables.responsive.js"}}
|
||||||
|
{{/zone}}
|
||||||
@ -0,0 +1,4 @@
|
|||||||
|
{
|
||||||
|
"version": "1.0.0",
|
||||||
|
"isAnonymous": true
|
||||||
|
}
|
||||||
@ -0,0 +1,24 @@
|
|||||||
|
/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||||
|
* AutoFill styles
|
||||||
|
*/
|
||||||
|
|
||||||
|
div.AutoFill_filler {
|
||||||
|
display: none;
|
||||||
|
position: absolute;
|
||||||
|
height: 14px;
|
||||||
|
width: 14px;
|
||||||
|
background: url(../images/filler.png) no-repeat center center;
|
||||||
|
z-index: 1002;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.AutoFill_border {
|
||||||
|
display: none;
|
||||||
|
position: absolute;
|
||||||
|
background-color: #0063dc;
|
||||||
|
z-index: 1001;
|
||||||
|
|
||||||
|
box-shadow: 0px 0px 5px #76b4ff;
|
||||||
|
-moz-box-shadow: 0px 0px 5px #76b4ff;
|
||||||
|
-webkit-box-shadow: 0px 0px 5px #76b4ff;
|
||||||
|
}
|
||||||
|
|
||||||
@ -0,0 +1 @@
|
|||||||
|
div.AutoFill_filler{display:none;position:absolute;height:14px;width:14px;background:url(../images/filler.png) no-repeat center center;z-index:1002}div.AutoFill_border{display:none;position:absolute;background-color:#0063dc;z-index:1001;box-shadow:0px 0px 5px #76b4ff;-moz-box-shadow:0px 0px 5px #76b4ff;-webkit-box-shadow:0px 0px 5px #76b4ff}
|
||||||
|
After Width: | Height: | Size: 1.0 KiB |
@ -0,0 +1,855 @@
|
|||||||
|
/*! AutoFill 1.2.1
|
||||||
|
* ©2008-2014 SpryMedia Ltd - datatables.net/license
|
||||||
|
*/
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @summary AutoFill
|
||||||
|
* @description Add Excel like click and drag auto-fill options to DataTables
|
||||||
|
* @version 1.2.1
|
||||||
|
* @file dataTables.autoFill.js
|
||||||
|
* @author SpryMedia Ltd (www.sprymedia.co.uk)
|
||||||
|
* @contact www.sprymedia.co.uk/contact
|
||||||
|
* @copyright Copyright 2010-2014 SpryMedia Ltd.
|
||||||
|
*
|
||||||
|
* This source file is free software, available under the following license:
|
||||||
|
* MIT license - http://datatables.net/license/mit
|
||||||
|
*
|
||||||
|
* This source file is distributed in the hope that it will be useful, but
|
||||||
|
* WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY
|
||||||
|
* or FITNESS FOR A PARTICULAR PURPOSE. See the license files for details.
|
||||||
|
*
|
||||||
|
* For details please refer to: http://www.datatables.net
|
||||||
|
*/
|
||||||
|
|
||||||
|
(function( window, document, undefined ) {
|
||||||
|
|
||||||
|
var factory = function( $, DataTable ) {
|
||||||
|
"use strict";
|
||||||
|
|
||||||
|
/**
|
||||||
|
* AutoFill provides Excel like auto-fill features for a DataTable
|
||||||
|
*
|
||||||
|
* @class AutoFill
|
||||||
|
* @constructor
|
||||||
|
* @param {object} oTD DataTables settings object
|
||||||
|
* @param {object} oConfig Configuration object for AutoFill
|
||||||
|
*/
|
||||||
|
var AutoFill = function( oDT, oConfig )
|
||||||
|
{
|
||||||
|
/* Sanity check that we are a new instance */
|
||||||
|
if ( ! (this instanceof AutoFill) ) {
|
||||||
|
throw( "Warning: AutoFill must be initialised with the keyword 'new'" );
|
||||||
|
}
|
||||||
|
|
||||||
|
if ( ! $.fn.dataTableExt.fnVersionCheck('1.7.0') ) {
|
||||||
|
throw( "Warning: AutoFill requires DataTables 1.7 or greater");
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||||
|
* Public class variables
|
||||||
|
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */
|
||||||
|
|
||||||
|
this.c = {};
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @namespace Settings object which contains customisable information for AutoFill instance
|
||||||
|
*/
|
||||||
|
this.s = {
|
||||||
|
/**
|
||||||
|
* @namespace Cached information about the little dragging icon (the filler)
|
||||||
|
*/
|
||||||
|
"filler": {
|
||||||
|
"height": 0,
|
||||||
|
"width": 0
|
||||||
|
},
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @namespace Cached information about the border display
|
||||||
|
*/
|
||||||
|
"border": {
|
||||||
|
"width": 2
|
||||||
|
},
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @namespace Store for live information for the current drag
|
||||||
|
*/
|
||||||
|
"drag": {
|
||||||
|
"startX": -1,
|
||||||
|
"startY": -1,
|
||||||
|
"startTd": null,
|
||||||
|
"endTd": null,
|
||||||
|
"dragging": false
|
||||||
|
},
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @namespace Data cache for information that we need for scrolling the screen when we near
|
||||||
|
* the edges
|
||||||
|
*/
|
||||||
|
"screen": {
|
||||||
|
"interval": null,
|
||||||
|
"y": 0,
|
||||||
|
"height": 0,
|
||||||
|
"scrollTop": 0
|
||||||
|
},
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @namespace Data cache for the position of the DataTables scrolling element (when scrolling
|
||||||
|
* is enabled)
|
||||||
|
*/
|
||||||
|
"scroller": {
|
||||||
|
"top": 0,
|
||||||
|
"bottom": 0
|
||||||
|
},
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @namespace Information stored for each column. An array of objects
|
||||||
|
*/
|
||||||
|
"columns": []
|
||||||
|
};
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @namespace Common and useful DOM elements for the class instance
|
||||||
|
*/
|
||||||
|
this.dom = {
|
||||||
|
"table": null,
|
||||||
|
"filler": null,
|
||||||
|
"borderTop": null,
|
||||||
|
"borderRight": null,
|
||||||
|
"borderBottom": null,
|
||||||
|
"borderLeft": null,
|
||||||
|
"currentTarget": null
|
||||||
|
};
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||||
|
* Public class methods
|
||||||
|
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Retreieve the settings object from an instance
|
||||||
|
* @method fnSettings
|
||||||
|
* @returns {object} AutoFill settings object
|
||||||
|
*/
|
||||||
|
this.fnSettings = function () {
|
||||||
|
return this.s;
|
||||||
|
};
|
||||||
|
|
||||||
|
|
||||||
|
/* Constructor logic */
|
||||||
|
this._fnInit( oDT, oConfig );
|
||||||
|
return this;
|
||||||
|
};
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
AutoFill.prototype = {
|
||||||
|
/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||||
|
* Private methods (they are of course public in JS, but recommended as private)
|
||||||
|
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Initialisation
|
||||||
|
* @method _fnInit
|
||||||
|
* @param {object} dt DataTables settings object
|
||||||
|
* @param {object} config Configuration object for AutoFill
|
||||||
|
* @returns void
|
||||||
|
*/
|
||||||
|
"_fnInit": function ( dt, config )
|
||||||
|
{
|
||||||
|
var
|
||||||
|
that = this,
|
||||||
|
i, iLen;
|
||||||
|
|
||||||
|
// Use DataTables API to get the settings allowing selectors, instances
|
||||||
|
// etc to be used, or for backwards compatibility get from the old
|
||||||
|
// fnSettings method
|
||||||
|
this.s.dt = DataTable.Api ?
|
||||||
|
new DataTable.Api( dt ).settings()[0] :
|
||||||
|
dt.fnSettings();
|
||||||
|
this.s.init = config || {};
|
||||||
|
this.dom.table = this.s.dt.nTable;
|
||||||
|
|
||||||
|
$.extend( true, this.c, AutoFill.defaults, config );
|
||||||
|
|
||||||
|
/* Add and configure the columns */
|
||||||
|
this._initColumns();
|
||||||
|
|
||||||
|
/* Auto Fill click and drag icon */
|
||||||
|
var filler = $('<div/>', {
|
||||||
|
'class': 'AutoFill_filler'
|
||||||
|
} )
|
||||||
|
.appendTo( 'body' );
|
||||||
|
this.dom.filler = filler[0];
|
||||||
|
|
||||||
|
// Get the height / width of the click element
|
||||||
|
this.s.filler.height = filler.height();
|
||||||
|
this.s.filler.width = filler.width();
|
||||||
|
filler[0].style.display = "none";
|
||||||
|
|
||||||
|
/* Border display - one div for each side. We can't just use a single
|
||||||
|
* one with a border, as we want the events to effectively pass through
|
||||||
|
* the transparent bit of the box
|
||||||
|
*/
|
||||||
|
var border;
|
||||||
|
var appender = document.body;
|
||||||
|
if ( that.s.dt.oScroll.sY !== "" ) {
|
||||||
|
that.s.dt.nTable.parentNode.style.position = "relative";
|
||||||
|
appender = that.s.dt.nTable.parentNode;
|
||||||
|
}
|
||||||
|
|
||||||
|
border = $('<div/>', {
|
||||||
|
"class": "AutoFill_border"
|
||||||
|
} );
|
||||||
|
this.dom.borderTop = border.clone().appendTo( appender )[0];
|
||||||
|
this.dom.borderRight = border.clone().appendTo( appender )[0];
|
||||||
|
this.dom.borderBottom = border.clone().appendTo( appender )[0];
|
||||||
|
this.dom.borderLeft = border.clone().appendTo( appender )[0];
|
||||||
|
|
||||||
|
/* Events */
|
||||||
|
filler.on( 'mousedown.DTAF', function (e) {
|
||||||
|
this.onselectstart = function() { return false; };
|
||||||
|
that._fnFillerDragStart.call( that, e );
|
||||||
|
return false;
|
||||||
|
} );
|
||||||
|
|
||||||
|
$('tbody', this.dom.table).on(
|
||||||
|
'mouseover.DTAF mouseout.DTAF',
|
||||||
|
'>tr>td, >tr>th',
|
||||||
|
function (e) {
|
||||||
|
that._fnFillerDisplay.call( that, e );
|
||||||
|
}
|
||||||
|
);
|
||||||
|
|
||||||
|
$(this.dom.table).on( 'destroy.dt.DTAF', function () {
|
||||||
|
filler.off( 'mousedown.DTAF' ).remove();
|
||||||
|
$('tbody', this.dom.table).off( 'mouseover.DTAF mouseout.DTAF' );
|
||||||
|
} );
|
||||||
|
},
|
||||||
|
|
||||||
|
|
||||||
|
_initColumns: function ( )
|
||||||
|
{
|
||||||
|
var that = this;
|
||||||
|
var i, ien;
|
||||||
|
var dt = this.s.dt;
|
||||||
|
var config = this.s.init;
|
||||||
|
|
||||||
|
for ( i=0, ien=dt.aoColumns.length ; i<ien ; i++ ) {
|
||||||
|
this.s.columns[i] = $.extend( true, {}, AutoFill.defaults.column );
|
||||||
|
}
|
||||||
|
|
||||||
|
dt.oApi._fnApplyColumnDefs(
|
||||||
|
dt,
|
||||||
|
config.aoColumnDefs || config.columnDefs,
|
||||||
|
config.aoColumns || config.columns,
|
||||||
|
function (colIdx, def) {
|
||||||
|
that._fnColumnOptions( colIdx, def );
|
||||||
|
}
|
||||||
|
);
|
||||||
|
|
||||||
|
// For columns which don't have read, write, step functions defined,
|
||||||
|
// use the default ones
|
||||||
|
for ( i=0, ien=dt.aoColumns.length ; i<ien ; i++ ) {
|
||||||
|
var column = this.s.columns[i];
|
||||||
|
|
||||||
|
if ( ! column.read ) {
|
||||||
|
column.read = this._fnReadCell;
|
||||||
|
}
|
||||||
|
if ( ! column.write ) {
|
||||||
|
column.read = this._fnWriteCell;
|
||||||
|
}
|
||||||
|
if ( ! column.step ) {
|
||||||
|
column.read = this._fnStep;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
|
|
||||||
|
"_fnColumnOptions": function ( i, opts )
|
||||||
|
{
|
||||||
|
var column = this.s.columns[ i ];
|
||||||
|
var set = function ( outProp, inProp ) {
|
||||||
|
if ( opts[ inProp[0] ] !== undefined ) {
|
||||||
|
column[ outProp ] = opts[ inProp[0] ];
|
||||||
|
}
|
||||||
|
if ( opts[ inProp[1] ] !== undefined ) {
|
||||||
|
column[ outProp ] = opts[ inProp[1] ];
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
// Compatibility with the old Hungarian style of notation
|
||||||
|
set( 'enable', ['bEnable', 'enable'] );
|
||||||
|
set( 'read', ['fnRead', 'read'] );
|
||||||
|
set( 'write', ['fnWrite', 'write'] );
|
||||||
|
set( 'step', ['fnStep', 'step'] );
|
||||||
|
set( 'increment', ['bIncrement', 'increment'] );
|
||||||
|
},
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Find out the coordinates of a given TD cell in a table
|
||||||
|
* @method _fnTargetCoords
|
||||||
|
* @param {Node} nTd
|
||||||
|
* @returns {Object} x and y properties, for the position of the cell in the tables DOM
|
||||||
|
*/
|
||||||
|
"_fnTargetCoords": function ( nTd )
|
||||||
|
{
|
||||||
|
var nTr = $(nTd).parents('tr')[0];
|
||||||
|
var position = this.s.dt.oInstance.fnGetPosition( nTd );
|
||||||
|
|
||||||
|
return {
|
||||||
|
"x": $('td', nTr).index(nTd),
|
||||||
|
"y": $('tr', nTr.parentNode).index(nTr),
|
||||||
|
"row": position[0],
|
||||||
|
"column": position[2]
|
||||||
|
};
|
||||||
|
},
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Display the border around one or more cells (from start to end)
|
||||||
|
* @method _fnUpdateBorder
|
||||||
|
* @param {Node} nStart Starting cell
|
||||||
|
* @param {Node} nEnd Ending cell
|
||||||
|
* @returns void
|
||||||
|
*/
|
||||||
|
"_fnUpdateBorder": function ( nStart, nEnd )
|
||||||
|
{
|
||||||
|
var
|
||||||
|
border = this.s.border.width,
|
||||||
|
offsetStart = $(nStart).offset(),
|
||||||
|
offsetEnd = $(nEnd).offset(),
|
||||||
|
x1 = offsetStart.left - border,
|
||||||
|
x2 = offsetEnd.left + $(nEnd).outerWidth(),
|
||||||
|
y1 = offsetStart.top - border,
|
||||||
|
y2 = offsetEnd.top + $(nEnd).outerHeight(),
|
||||||
|
width = offsetEnd.left + $(nEnd).outerWidth() - offsetStart.left + (2*border),
|
||||||
|
height = offsetEnd.top + $(nEnd).outerHeight() - offsetStart.top + (2*border),
|
||||||
|
oStyle;
|
||||||
|
|
||||||
|
// Recalculate start and end (when dragging "backwards")
|
||||||
|
if( offsetStart.left > offsetEnd.left) {
|
||||||
|
x1 = offsetEnd.left - border;
|
||||||
|
x2 = offsetStart.left + $(nStart).outerWidth();
|
||||||
|
width = offsetStart.left + $(nStart).outerWidth() - offsetEnd.left + (2*border);
|
||||||
|
}
|
||||||
|
|
||||||
|
if ( this.s.dt.oScroll.sY !== "" )
|
||||||
|
{
|
||||||
|
/* The border elements are inside the DT scroller - so position relative to that */
|
||||||
|
var
|
||||||
|
offsetScroll = $(this.s.dt.nTable.parentNode).offset(),
|
||||||
|
scrollTop = $(this.s.dt.nTable.parentNode).scrollTop(),
|
||||||
|
scrollLeft = $(this.s.dt.nTable.parentNode).scrollLeft();
|
||||||
|
|
||||||
|
x1 -= offsetScroll.left - scrollLeft;
|
||||||
|
x2 -= offsetScroll.left - scrollLeft;
|
||||||
|
y1 -= offsetScroll.top - scrollTop;
|
||||||
|
y2 -= offsetScroll.top - scrollTop;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* Top */
|
||||||
|
oStyle = this.dom.borderTop.style;
|
||||||
|
oStyle.top = y1+"px";
|
||||||
|
oStyle.left = x1+"px";
|
||||||
|
oStyle.height = this.s.border.width+"px";
|
||||||
|
oStyle.width = width+"px";
|
||||||
|
|
||||||
|
/* Bottom */
|
||||||
|
oStyle = this.dom.borderBottom.style;
|
||||||
|
oStyle.top = y2+"px";
|
||||||
|
oStyle.left = x1+"px";
|
||||||
|
oStyle.height = this.s.border.width+"px";
|
||||||
|
oStyle.width = width+"px";
|
||||||
|
|
||||||
|
/* Left */
|
||||||
|
oStyle = this.dom.borderLeft.style;
|
||||||
|
oStyle.top = y1+"px";
|
||||||
|
oStyle.left = x1+"px";
|
||||||
|
oStyle.height = height+"px";
|
||||||
|
oStyle.width = this.s.border.width+"px";
|
||||||
|
|
||||||
|
/* Right */
|
||||||
|
oStyle = this.dom.borderRight.style;
|
||||||
|
oStyle.top = y1+"px";
|
||||||
|
oStyle.left = x2+"px";
|
||||||
|
oStyle.height = height+"px";
|
||||||
|
oStyle.width = this.s.border.width+"px";
|
||||||
|
},
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Mouse down event handler for starting a drag
|
||||||
|
* @method _fnFillerDragStart
|
||||||
|
* @param {Object} e Event object
|
||||||
|
* @returns void
|
||||||
|
*/
|
||||||
|
"_fnFillerDragStart": function (e)
|
||||||
|
{
|
||||||
|
var that = this;
|
||||||
|
var startingTd = this.dom.currentTarget;
|
||||||
|
|
||||||
|
this.s.drag.dragging = true;
|
||||||
|
|
||||||
|
that.dom.borderTop.style.display = "block";
|
||||||
|
that.dom.borderRight.style.display = "block";
|
||||||
|
that.dom.borderBottom.style.display = "block";
|
||||||
|
that.dom.borderLeft.style.display = "block";
|
||||||
|
|
||||||
|
var coords = this._fnTargetCoords( startingTd );
|
||||||
|
this.s.drag.startX = coords.x;
|
||||||
|
this.s.drag.startY = coords.y;
|
||||||
|
|
||||||
|
this.s.drag.startTd = startingTd;
|
||||||
|
this.s.drag.endTd = startingTd;
|
||||||
|
|
||||||
|
this._fnUpdateBorder( startingTd, startingTd );
|
||||||
|
|
||||||
|
$(document).bind('mousemove.AutoFill', function (e) {
|
||||||
|
that._fnFillerDragMove.call( that, e );
|
||||||
|
} );
|
||||||
|
|
||||||
|
$(document).bind('mouseup.AutoFill', function (e) {
|
||||||
|
that._fnFillerFinish.call( that, e );
|
||||||
|
} );
|
||||||
|
|
||||||
|
/* Scrolling information cache */
|
||||||
|
this.s.screen.y = e.pageY;
|
||||||
|
this.s.screen.height = $(window).height();
|
||||||
|
this.s.screen.scrollTop = $(document).scrollTop();
|
||||||
|
|
||||||
|
if ( this.s.dt.oScroll.sY !== "" )
|
||||||
|
{
|
||||||
|
this.s.scroller.top = $(this.s.dt.nTable.parentNode).offset().top;
|
||||||
|
this.s.scroller.bottom = this.s.scroller.top + $(this.s.dt.nTable.parentNode).height();
|
||||||
|
}
|
||||||
|
|
||||||
|
/* Scrolling handler - we set an interval (which is cancelled on mouse up) which will fire
|
||||||
|
* regularly and see if we need to do any scrolling
|
||||||
|
*/
|
||||||
|
this.s.screen.interval = setInterval( function () {
|
||||||
|
var iScrollTop = $(document).scrollTop();
|
||||||
|
var iScrollDelta = iScrollTop - that.s.screen.scrollTop;
|
||||||
|
that.s.screen.y += iScrollDelta;
|
||||||
|
|
||||||
|
if ( that.s.screen.height - that.s.screen.y + iScrollTop < 50 )
|
||||||
|
{
|
||||||
|
$('html, body').animate( {
|
||||||
|
"scrollTop": iScrollTop + 50
|
||||||
|
}, 240, 'linear' );
|
||||||
|
}
|
||||||
|
else if ( that.s.screen.y - iScrollTop < 50 )
|
||||||
|
{
|
||||||
|
$('html, body').animate( {
|
||||||
|
"scrollTop": iScrollTop - 50
|
||||||
|
}, 240, 'linear' );
|
||||||
|
}
|
||||||
|
|
||||||
|
if ( that.s.dt.oScroll.sY !== "" )
|
||||||
|
{
|
||||||
|
if ( that.s.screen.y > that.s.scroller.bottom - 50 )
|
||||||
|
{
|
||||||
|
$(that.s.dt.nTable.parentNode).animate( {
|
||||||
|
"scrollTop": $(that.s.dt.nTable.parentNode).scrollTop() + 50
|
||||||
|
}, 240, 'linear' );
|
||||||
|
}
|
||||||
|
else if ( that.s.screen.y < that.s.scroller.top + 50 )
|
||||||
|
{
|
||||||
|
$(that.s.dt.nTable.parentNode).animate( {
|
||||||
|
"scrollTop": $(that.s.dt.nTable.parentNode).scrollTop() - 50
|
||||||
|
}, 240, 'linear' );
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}, 250 );
|
||||||
|
},
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Mouse move event handler for during a move. See if we want to update the display based on the
|
||||||
|
* new cursor position
|
||||||
|
* @method _fnFillerDragMove
|
||||||
|
* @param {Object} e Event object
|
||||||
|
* @returns void
|
||||||
|
*/
|
||||||
|
"_fnFillerDragMove": function (e)
|
||||||
|
{
|
||||||
|
if ( e.target && e.target.nodeName.toUpperCase() == "TD" &&
|
||||||
|
e.target != this.s.drag.endTd )
|
||||||
|
{
|
||||||
|
var coords = this._fnTargetCoords( e.target );
|
||||||
|
|
||||||
|
if ( this.c.mode == "y" && coords.x != this.s.drag.startX )
|
||||||
|
{
|
||||||
|
e.target = $('tbody>tr:eq('+coords.y+')>td:eq('+this.s.drag.startX+')', this.dom.table)[0];
|
||||||
|
}
|
||||||
|
if ( this.c.mode == "x" && coords.y != this.s.drag.startY )
|
||||||
|
{
|
||||||
|
e.target = $('tbody>tr:eq('+this.s.drag.startY+')>td:eq('+coords.x+')', this.dom.table)[0];
|
||||||
|
}
|
||||||
|
|
||||||
|
if ( this.c.mode == "either")
|
||||||
|
{
|
||||||
|
if(coords.x != this.s.drag.startX )
|
||||||
|
{
|
||||||
|
e.target = $('tbody>tr:eq('+this.s.drag.startY+')>td:eq('+coords.x+')', this.dom.table)[0];
|
||||||
|
}
|
||||||
|
else if ( coords.y != this.s.drag.startY ) {
|
||||||
|
e.target = $('tbody>tr:eq('+coords.y+')>td:eq('+this.s.drag.startX+')', this.dom.table)[0];
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// update coords
|
||||||
|
if ( this.c.mode !== "both" ) {
|
||||||
|
coords = this._fnTargetCoords( e.target );
|
||||||
|
}
|
||||||
|
|
||||||
|
var drag = this.s.drag;
|
||||||
|
drag.endTd = e.target;
|
||||||
|
|
||||||
|
if ( coords.y >= this.s.drag.startY ) {
|
||||||
|
this._fnUpdateBorder( drag.startTd, drag.endTd );
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
this._fnUpdateBorder( drag.endTd, drag.startTd );
|
||||||
|
}
|
||||||
|
this._fnFillerPosition( e.target );
|
||||||
|
}
|
||||||
|
|
||||||
|
/* Update the screen information so we can perform scrolling */
|
||||||
|
this.s.screen.y = e.pageY;
|
||||||
|
this.s.screen.scrollTop = $(document).scrollTop();
|
||||||
|
|
||||||
|
if ( this.s.dt.oScroll.sY !== "" )
|
||||||
|
{
|
||||||
|
this.s.scroller.scrollTop = $(this.s.dt.nTable.parentNode).scrollTop();
|
||||||
|
this.s.scroller.top = $(this.s.dt.nTable.parentNode).offset().top;
|
||||||
|
this.s.scroller.bottom = this.s.scroller.top + $(this.s.dt.nTable.parentNode).height();
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Mouse release handler - end the drag and take action to update the cells with the needed values
|
||||||
|
* @method _fnFillerFinish
|
||||||
|
* @param {Object} e Event object
|
||||||
|
* @returns void
|
||||||
|
*/
|
||||||
|
"_fnFillerFinish": function (e)
|
||||||
|
{
|
||||||
|
var that = this, i, iLen, j;
|
||||||
|
|
||||||
|
$(document).unbind('mousemove.AutoFill mouseup.AutoFill');
|
||||||
|
|
||||||
|
this.dom.borderTop.style.display = "none";
|
||||||
|
this.dom.borderRight.style.display = "none";
|
||||||
|
this.dom.borderBottom.style.display = "none";
|
||||||
|
this.dom.borderLeft.style.display = "none";
|
||||||
|
|
||||||
|
this.s.drag.dragging = false;
|
||||||
|
|
||||||
|
clearInterval( this.s.screen.interval );
|
||||||
|
|
||||||
|
var cells = [];
|
||||||
|
var table = this.dom.table;
|
||||||
|
var coordsStart = this._fnTargetCoords( this.s.drag.startTd );
|
||||||
|
var coordsEnd = this._fnTargetCoords( this.s.drag.endTd );
|
||||||
|
var columnIndex = function ( visIdx ) {
|
||||||
|
return that.s.dt.oApi._fnVisibleToColumnIndex( that.s.dt, visIdx );
|
||||||
|
};
|
||||||
|
|
||||||
|
// xxx - urgh - there must be a way of reducing this...
|
||||||
|
if ( coordsStart.y <= coordsEnd.y ) {
|
||||||
|
for ( i=coordsStart.y ; i<=coordsEnd.y ; i++ ) {
|
||||||
|
if ( coordsStart.x <= coordsEnd.x ) {
|
||||||
|
for ( j=coordsStart.x ; j<=coordsEnd.x ; j++ ) {
|
||||||
|
cells.push( {
|
||||||
|
node: $('tbody>tr:eq('+i+')>td:eq('+j+')', table)[0],
|
||||||
|
x: j - coordsStart.x,
|
||||||
|
y: i - coordsStart.y,
|
||||||
|
colIdx: columnIndex( j )
|
||||||
|
} );
|
||||||
|
}
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
for ( j=coordsStart.x ; j>=coordsEnd.x ; j-- ) {
|
||||||
|
cells.push( {
|
||||||
|
node: $('tbody>tr:eq('+i+')>td:eq('+j+')', table)[0],
|
||||||
|
x: j - coordsStart.x,
|
||||||
|
y: i - coordsStart.y,
|
||||||
|
colIdx: columnIndex( j )
|
||||||
|
} );
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
for ( i=coordsStart.y ; i>=coordsEnd.y ; i-- ) {
|
||||||
|
if ( coordsStart.x <= coordsEnd.x ) {
|
||||||
|
for ( j=coordsStart.x ; j<=coordsEnd.x ; j++ ) {
|
||||||
|
cells.push( {
|
||||||
|
node: $('tbody>tr:eq('+i+')>td:eq('+j+')', table)[0],
|
||||||
|
x: j - coordsStart.x,
|
||||||
|
y: i - coordsStart.y,
|
||||||
|
colIdx: columnIndex( j )
|
||||||
|
} );
|
||||||
|
}
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
for ( j=coordsStart.x ; j>=coordsEnd.x ; j-- ) {
|
||||||
|
cells.push( {
|
||||||
|
node: $('tbody>tr:eq('+i+')>td:eq('+j+')', table)[0],
|
||||||
|
x: coordsStart.x - j,
|
||||||
|
y: coordsStart.y - i,
|
||||||
|
colIdx: columnIndex( j )
|
||||||
|
} );
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// An auto-fill requires 2 or more cells
|
||||||
|
if ( cells.length <= 1 ) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
var edited = [];
|
||||||
|
var previous;
|
||||||
|
|
||||||
|
for ( i=0, iLen=cells.length ; i<iLen ; i++ ) {
|
||||||
|
var cell = cells[i];
|
||||||
|
var column = this.s.columns[ cell.colIdx ];
|
||||||
|
var read = column.read.call( column, cell.node );
|
||||||
|
var stepValue = column.step.call( column, cell.node, read, previous, i, cell.x, cell.y );
|
||||||
|
|
||||||
|
column.write.call( column, cell.node, stepValue );
|
||||||
|
|
||||||
|
previous = stepValue;
|
||||||
|
edited.push( {
|
||||||
|
cell: cell,
|
||||||
|
colIdx: cell.colIdx,
|
||||||
|
newValue: stepValue,
|
||||||
|
oldValue: read
|
||||||
|
} );
|
||||||
|
}
|
||||||
|
|
||||||
|
if ( this.c.complete !== null ) {
|
||||||
|
this.c.complete.call( this, edited );
|
||||||
|
}
|
||||||
|
|
||||||
|
// In 1.10 we can do a static draw
|
||||||
|
if ( DataTable.Api ) {
|
||||||
|
new DataTable.Api( this.s.dt ).draw( false );
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
this.s.dt.oInstance.fnDraw();
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Display the drag handle on mouse over cell
|
||||||
|
* @method _fnFillerDisplay
|
||||||
|
* @param {Object} e Event object
|
||||||
|
* @returns void
|
||||||
|
*/
|
||||||
|
"_fnFillerDisplay": function (e)
|
||||||
|
{
|
||||||
|
var filler = this.dom.filler;
|
||||||
|
|
||||||
|
/* Don't display automatically when dragging */
|
||||||
|
if ( this.s.drag.dragging)
|
||||||
|
{
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* Check that we are allowed to AutoFill this column or not */
|
||||||
|
var nTd = (e.target.nodeName.toLowerCase() == 'td') ? e.target : $(e.target).parents('td')[0];
|
||||||
|
var iX = this._fnTargetCoords(nTd).column;
|
||||||
|
if ( !this.s.columns[iX].enable )
|
||||||
|
{
|
||||||
|
filler.style.display = "none";
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (e.type == 'mouseover')
|
||||||
|
{
|
||||||
|
this.dom.currentTarget = nTd;
|
||||||
|
this._fnFillerPosition( nTd );
|
||||||
|
|
||||||
|
filler.style.display = "block";
|
||||||
|
}
|
||||||
|
else if ( !e.relatedTarget || !e.relatedTarget.className.match(/AutoFill/) )
|
||||||
|
{
|
||||||
|
filler.style.display = "none";
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Position the filler icon over a cell
|
||||||
|
* @method _fnFillerPosition
|
||||||
|
* @param {Node} nTd Cell to position filler icon over
|
||||||
|
* @returns void
|
||||||
|
*/
|
||||||
|
"_fnFillerPosition": function ( nTd )
|
||||||
|
{
|
||||||
|
var offset = $(nTd).offset();
|
||||||
|
var filler = this.dom.filler;
|
||||||
|
filler.style.top = (offset.top - (this.s.filler.height / 2)-1 + $(nTd).outerHeight())+"px";
|
||||||
|
filler.style.left = (offset.left - (this.s.filler.width / 2)-1 + $(nTd).outerWidth())+"px";
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
|
||||||
|
// Alias for access
|
||||||
|
DataTable.AutoFill = AutoFill;
|
||||||
|
DataTable.AutoFill = AutoFill;
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||||
|
* Constants
|
||||||
|
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */
|
||||||
|
|
||||||
|
/**
|
||||||
|
* AutoFill version
|
||||||
|
* @constant version
|
||||||
|
* @type String
|
||||||
|
* @default See code
|
||||||
|
*/
|
||||||
|
AutoFill.version = "1.2.1";
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* AutoFill defaults
|
||||||
|
* @namespace
|
||||||
|
*/
|
||||||
|
AutoFill.defaults = {
|
||||||
|
/**
|
||||||
|
* Mode for dragging (restrict to y-axis only, x-axis only, either one or none):
|
||||||
|
*
|
||||||
|
* * `y` - y-axis only (default)
|
||||||
|
* * `x` - x-axis only
|
||||||
|
* * `either` - either one, but not both axis at the same time
|
||||||
|
* * `both` - multiple cells allowed
|
||||||
|
*
|
||||||
|
* @type {string}
|
||||||
|
* @default `y`
|
||||||
|
*/
|
||||||
|
mode: 'y',
|
||||||
|
|
||||||
|
complete: null,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Column definition defaults
|
||||||
|
* @namespace
|
||||||
|
*/
|
||||||
|
column: {
|
||||||
|
/**
|
||||||
|
* If AutoFill should be enabled on this column
|
||||||
|
*
|
||||||
|
* @type {boolean}
|
||||||
|
* @default true
|
||||||
|
*/
|
||||||
|
enable: true,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Allow automatic increment / decrement on this column if a number
|
||||||
|
* is found.
|
||||||
|
*
|
||||||
|
* @type {boolean}
|
||||||
|
* @default true
|
||||||
|
*/
|
||||||
|
increment: true,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Cell read function
|
||||||
|
*
|
||||||
|
* Default function will simply read the value from the HTML of the
|
||||||
|
* cell.
|
||||||
|
*
|
||||||
|
* @type {function}
|
||||||
|
* @param {node} cell `th` / `td` element to read the value from
|
||||||
|
* @return {string} Data that has been read
|
||||||
|
*/
|
||||||
|
read: function ( cell ) {
|
||||||
|
return $(cell).html();
|
||||||
|
},
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Cell write function
|
||||||
|
*
|
||||||
|
* Default function will simply write to the HTML and tell the DataTable
|
||||||
|
* to update.
|
||||||
|
*
|
||||||
|
* @type {function}
|
||||||
|
* @param {node} cell `th` / `td` element to write the value to
|
||||||
|
* @return {string} Data two write
|
||||||
|
*/
|
||||||
|
write: function ( cell, val ) {
|
||||||
|
var table = $(cell).parents('table');
|
||||||
|
if ( DataTable.Api ) {
|
||||||
|
// 1.10
|
||||||
|
table.DataTable().cell( cell ).data( val );
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
// 1.9
|
||||||
|
var dt = table.dataTable();
|
||||||
|
var pos = dt.fnGetPosition( cell );
|
||||||
|
dt.fnUpdate( val, pos[0], pos[2], false );
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Step function. This provides the ability to customise how the values
|
||||||
|
* are incremented.
|
||||||
|
*
|
||||||
|
* @param {node} cell `th` / `td` element that is being operated upon
|
||||||
|
* @param {string} read Cell value from `read` function
|
||||||
|
* @param {string} last Value of the previous cell
|
||||||
|
* @param {integer} i Loop counter
|
||||||
|
* @param {integer} x Cell x-position in the current auto-fill. The
|
||||||
|
* starting cell is coordinate 0 regardless of its physical position
|
||||||
|
* in the DataTable.
|
||||||
|
* @param {integer} y Cell y-position in the current auto-fill. The
|
||||||
|
* starting cell is coordinate 0 regardless of its physical position
|
||||||
|
* in the DataTable.
|
||||||
|
* @return {string} Value to write
|
||||||
|
*/
|
||||||
|
step: function ( cell, read, last, i, x, y ) {
|
||||||
|
// Increment a number if it is found
|
||||||
|
var re = /(\-?\d+)/;
|
||||||
|
var match = this.increment && last ? last.match(re) : null;
|
||||||
|
if ( match ) {
|
||||||
|
return last.replace( re, parseInt(match[1],10) + (x<0 || y<0 ? -1 : 1) );
|
||||||
|
}
|
||||||
|
return last === undefined ?
|
||||||
|
read :
|
||||||
|
last;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
return AutoFill;
|
||||||
|
};
|
||||||
|
|
||||||
|
|
||||||
|
// Define as an AMD module if possible
|
||||||
|
if ( typeof define === 'function' && define.amd ) {
|
||||||
|
define( ['jquery', 'datatables'], factory );
|
||||||
|
}
|
||||||
|
else if ( typeof exports === 'object' ) {
|
||||||
|
// Node/CommonJS
|
||||||
|
factory( require('jquery'), require('datatables') );
|
||||||
|
}
|
||||||
|
else if ( jQuery && !jQuery.fn.dataTable.AutoFill ) {
|
||||||
|
// Otherwise simply initialise as normal, stopping multiple evaluation
|
||||||
|
factory( jQuery, jQuery.fn.dataTable );
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
}(window, document));
|
||||||
|
|
||||||
@ -0,0 +1,22 @@
|
|||||||
|
/*!
|
||||||
|
AutoFill 1.2.1
|
||||||
|
©2008-2014 SpryMedia Ltd - datatables.net/license
|
||||||
|
*/
|
||||||
|
(function(o,j,m){var l=function(c,k){var h=function(d,b){if(!(this instanceof h))throw"Warning: AutoFill must be initialised with the keyword 'new'";if(!c.fn.dataTableExt.fnVersionCheck("1.7.0"))throw"Warning: AutoFill requires DataTables 1.7 or greater";this.c={};this.s={filler:{height:0,width:0},border:{width:2},drag:{startX:-1,startY:-1,startTd:null,endTd:null,dragging:!1},screen:{interval:null,y:0,height:0,scrollTop:0},scroller:{top:0,bottom:0},columns:[]};this.dom={table:null,filler:null,borderTop:null,
|
||||||
|
borderRight:null,borderBottom:null,borderLeft:null,currentTarget:null};this.fnSettings=function(){return this.s};this._fnInit(d,b);return this};h.prototype={_fnInit:function(d,b){var a=this;this.s.dt=k.Api?(new k.Api(d)).settings()[0]:d.fnSettings();this.s.init=b||{};this.dom.table=this.s.dt.nTable;c.extend(!0,this.c,h.defaults,b);this._initColumns();var e=c("<div/>",{"class":"AutoFill_filler"}).appendTo("body");this.dom.filler=e[0];this.s.filler.height=e.height();this.s.filler.width=e.width();e[0].style.display=
|
||||||
|
"none";var g,f=j.body;""!==a.s.dt.oScroll.sY&&(a.s.dt.nTable.parentNode.style.position="relative",f=a.s.dt.nTable.parentNode);g=c("<div/>",{"class":"AutoFill_border"});this.dom.borderTop=g.clone().appendTo(f)[0];this.dom.borderRight=g.clone().appendTo(f)[0];this.dom.borderBottom=g.clone().appendTo(f)[0];this.dom.borderLeft=g.clone().appendTo(f)[0];e.on("mousedown.DTAF",function(b){this.onselectstart=function(){return false};a._fnFillerDragStart.call(a,b);return false});c("tbody",this.dom.table).on("mouseover.DTAF mouseout.DTAF",
|
||||||
|
">tr>td, >tr>th",function(b){a._fnFillerDisplay.call(a,b)});c(this.dom.table).on("destroy.dt.DTAF",function(){e.off("mousedown.DTAF").remove();c("tbody",this.dom.table).off("mouseover.DTAF mouseout.DTAF")})},_initColumns:function(){var d=this,b,a,e=this.s.dt,g=this.s.init;b=0;for(a=e.aoColumns.length;b<a;b++)this.s.columns[b]=c.extend(!0,{},h.defaults.column);e.oApi._fnApplyColumnDefs(e,g.aoColumnDefs||g.columnDefs,g.aoColumns||g.columns,function(a,b){d._fnColumnOptions(a,b)});b=0;for(a=e.aoColumns.length;b<
|
||||||
|
a;b++)if(e=this.s.columns[b],e.read||(e.read=this._fnReadCell),e.write||(e.read=this._fnWriteCell),!e.step)e.read=this._fnStep},_fnColumnOptions:function(d,b){var a=this.s.columns[d],c=function(c,d){b[d[0]]!==m&&(a[c]=b[d[0]]);b[d[1]]!==m&&(a[c]=b[d[1]])};c("enable",["bEnable","enable"]);c("read",["fnRead","read"]);c("write",["fnWrite","write"]);c("step",["fnStep","step"]);c("increment",["bIncrement","increment"])},_fnTargetCoords:function(d){var b=c(d).parents("tr")[0],a=this.s.dt.oInstance.fnGetPosition(d);
|
||||||
|
return{x:c("td",b).index(d),y:c("tr",b.parentNode).index(b),row:a[0],column:a[2]}},_fnUpdateBorder:function(d,b){var a=this.s.border.width,e=c(d).offset(),g=c(b).offset(),f=e.left-a,i=g.left+c(b).outerWidth(),n=e.top-a,h=g.top+c(b).outerHeight(),j=g.left+c(b).outerWidth()-e.left+2*a,k=g.top+c(b).outerHeight()-e.top+2*a;e.left>g.left&&(f=g.left-a,i=e.left+c(d).outerWidth(),j=e.left+c(d).outerWidth()-g.left+2*a);""!==this.s.dt.oScroll.sY&&(a=c(this.s.dt.nTable.parentNode).offset(),e=c(this.s.dt.nTable.parentNode).scrollTop(),
|
||||||
|
g=c(this.s.dt.nTable.parentNode).scrollLeft(),f-=a.left-g,i-=a.left-g,n-=a.top-e,h-=a.top-e);a=this.dom.borderTop.style;a.top=n+"px";a.left=f+"px";a.height=this.s.border.width+"px";a.width=j+"px";a=this.dom.borderBottom.style;a.top=h+"px";a.left=f+"px";a.height=this.s.border.width+"px";a.width=j+"px";a=this.dom.borderLeft.style;a.top=n+"px";a.left=f+"px";a.height=k+"px";a.width=this.s.border.width+"px";a=this.dom.borderRight.style;a.top=n+"px";a.left=i+"px";a.height=k+"px";a.width=this.s.border.width+
|
||||||
|
"px"},_fnFillerDragStart:function(d){var b=this,a=this.dom.currentTarget;this.s.drag.dragging=!0;b.dom.borderTop.style.display="block";b.dom.borderRight.style.display="block";b.dom.borderBottom.style.display="block";b.dom.borderLeft.style.display="block";var e=this._fnTargetCoords(a);this.s.drag.startX=e.x;this.s.drag.startY=e.y;this.s.drag.startTd=a;this.s.drag.endTd=a;this._fnUpdateBorder(a,a);c(j).bind("mousemove.AutoFill",function(a){b._fnFillerDragMove.call(b,a)});c(j).bind("mouseup.AutoFill",
|
||||||
|
function(a){b._fnFillerFinish.call(b,a)});this.s.screen.y=d.pageY;this.s.screen.height=c(o).height();this.s.screen.scrollTop=c(j).scrollTop();""!==this.s.dt.oScroll.sY&&(this.s.scroller.top=c(this.s.dt.nTable.parentNode).offset().top,this.s.scroller.bottom=this.s.scroller.top+c(this.s.dt.nTable.parentNode).height());this.s.screen.interval=setInterval(function(){var a=c(j).scrollTop();b.s.screen.y=b.s.screen.y+(a-b.s.screen.scrollTop);b.s.screen.height-b.s.screen.y+a<50?c("html, body").animate({scrollTop:a+
|
||||||
|
50},240,"linear"):b.s.screen.y-a<50&&c("html, body").animate({scrollTop:a-50},240,"linear");b.s.dt.oScroll.sY!==""&&(b.s.screen.y>b.s.scroller.bottom-50?c(b.s.dt.nTable.parentNode).animate({scrollTop:c(b.s.dt.nTable.parentNode).scrollTop()+50},240,"linear"):b.s.screen.y<b.s.scroller.top+50&&c(b.s.dt.nTable.parentNode).animate({scrollTop:c(b.s.dt.nTable.parentNode).scrollTop()-50},240,"linear"))},250)},_fnFillerDragMove:function(d){if(d.target&&"TD"==d.target.nodeName.toUpperCase()&&d.target!=this.s.drag.endTd){var b=
|
||||||
|
this._fnTargetCoords(d.target);"y"==this.c.mode&&b.x!=this.s.drag.startX&&(d.target=c("tbody>tr:eq("+b.y+")>td:eq("+this.s.drag.startX+")",this.dom.table)[0]);"x"==this.c.mode&&b.y!=this.s.drag.startY&&(d.target=c("tbody>tr:eq("+this.s.drag.startY+")>td:eq("+b.x+")",this.dom.table)[0]);"either"==this.c.mode&&(b.x!=this.s.drag.startX?d.target=c("tbody>tr:eq("+this.s.drag.startY+")>td:eq("+b.x+")",this.dom.table)[0]:b.y!=this.s.drag.startY&&(d.target=c("tbody>tr:eq("+b.y+")>td:eq("+this.s.drag.startX+
|
||||||
|
")",this.dom.table)[0]));"both"!==this.c.mode&&(b=this._fnTargetCoords(d.target));var a=this.s.drag;a.endTd=d.target;b.y>=this.s.drag.startY?this._fnUpdateBorder(a.startTd,a.endTd):this._fnUpdateBorder(a.endTd,a.startTd);this._fnFillerPosition(d.target)}this.s.screen.y=d.pageY;this.s.screen.scrollTop=c(j).scrollTop();""!==this.s.dt.oScroll.sY&&(this.s.scroller.scrollTop=c(this.s.dt.nTable.parentNode).scrollTop(),this.s.scroller.top=c(this.s.dt.nTable.parentNode).offset().top,this.s.scroller.bottom=
|
||||||
|
this.s.scroller.top+c(this.s.dt.nTable.parentNode).height())},_fnFillerFinish:function(){var d=this,b,a;c(j).unbind("mousemove.AutoFill mouseup.AutoFill");this.dom.borderTop.style.display="none";this.dom.borderRight.style.display="none";this.dom.borderBottom.style.display="none";this.dom.borderLeft.style.display="none";this.s.drag.dragging=!1;clearInterval(this.s.screen.interval);var e=[],g=this.dom.table,f=this._fnTargetCoords(this.s.drag.startTd),i=this._fnTargetCoords(this.s.drag.endTd),h=function(a){return d.s.dt.oApi._fnVisibleToColumnIndex(d.s.dt,
|
||||||
|
a)};if(f.y<=i.y)for(b=f.y;b<=i.y;b++)if(f.x<=i.x)for(a=f.x;a<=i.x;a++)e.push({node:c("tbody>tr:eq("+b+")>td:eq("+a+")",g)[0],x:a-f.x,y:b-f.y,colIdx:h(a)});else for(a=f.x;a>=i.x;a--)e.push({node:c("tbody>tr:eq("+b+")>td:eq("+a+")",g)[0],x:a-f.x,y:b-f.y,colIdx:h(a)});else for(b=f.y;b>=i.y;b--)if(f.x<=i.x)for(a=f.x;a<=i.x;a++)e.push({node:c("tbody>tr:eq("+b+")>td:eq("+a+")",g)[0],x:a-f.x,y:b-f.y,colIdx:h(a)});else for(a=f.x;a>=i.x;a--)e.push({node:c("tbody>tr:eq("+b+")>td:eq("+a+")",g)[0],x:f.x-a,y:f.y-
|
||||||
|
b,colIdx:h(a)});if(!(1>=e.length)){var g=[],m;b=0;for(a=e.length;b<a;b++){var f=e[b],i=this.s.columns[f.colIdx],h=i.read.call(i,f.node),l=i.step.call(i,f.node,h,m,b,f.x,f.y);i.write.call(i,f.node,l);m=l;g.push({cell:f,colIdx:f.colIdx,newValue:l,oldValue:h})}null!==this.c.complete&&this.c.complete.call(this,g);k.Api?(new k.Api(this.s.dt)).draw(!1):this.s.dt.oInstance.fnDraw()}},_fnFillerDisplay:function(d){var b=this.dom.filler;if(!this.s.drag.dragging){var a="td"==d.target.nodeName.toLowerCase()?
|
||||||
|
d.target:c(d.target).parents("td")[0],e=this._fnTargetCoords(a).column;if(this.s.columns[e].enable)if("mouseover"==d.type)this.dom.currentTarget=a,this._fnFillerPosition(a),b.style.display="block";else{if(!d.relatedTarget||!d.relatedTarget.className.match(/AutoFill/))b.style.display="none"}else b.style.display="none"}},_fnFillerPosition:function(d){var b=c(d).offset(),a=this.dom.filler;a.style.top=b.top-this.s.filler.height/2-1+c(d).outerHeight()+"px";a.style.left=b.left-this.s.filler.width/2-1+c(d).outerWidth()+
|
||||||
|
"px"}};k.AutoFill=h;k.AutoFill=h;h.version="1.2.1";h.defaults={mode:"y",complete:null,column:{enable:!0,increment:!0,read:function(d){return c(d).html()},write:function(d,b){var a=c(d).parents("table");if(k.Api)a.DataTable().cell(d).data(b);else{var a=a.dataTable(),e=a.fnGetPosition(d);a.fnUpdate(b,e[0],e[2],!1)}},step:function(c,b,a,e,g,f){c=/(\-?\d+)/;return(e=this.increment&&a?a.match(c):null)?a.replace(c,parseInt(e[1],10)+(0>g||0>f?-1:1)):a===m?b:a}}};return h};"function"===typeof define&&define.amd?
|
||||||
|
define(["jquery","datatables"],l):"object"===typeof exports?l(require("jquery"),require("datatables")):jQuery&&!jQuery.fn.dataTable.AutoFill&&l(jQuery,jQuery.fn.dataTable)})(window,document);
|
||||||
@ -0,0 +1,372 @@
|
|||||||
|
div.dataTables_length label {
|
||||||
|
font-weight: normal;
|
||||||
|
text-align: left;
|
||||||
|
white-space: nowrap;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.dataTables_length select {
|
||||||
|
width: 75px;
|
||||||
|
display: inline-block;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.dataTables_filter {
|
||||||
|
text-align: right;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.dataTables_filter label {
|
||||||
|
font-weight: normal;
|
||||||
|
white-space: nowrap;
|
||||||
|
text-align: left;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.dataTables_filter input {
|
||||||
|
margin-left: 0.5em;
|
||||||
|
display: inline-block;
|
||||||
|
width: auto;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.dataTables_info {
|
||||||
|
padding-top: 8px;
|
||||||
|
white-space: nowrap;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.dataTables_paginate {
|
||||||
|
margin: 0;
|
||||||
|
white-space: nowrap;
|
||||||
|
text-align: right;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.dataTables_paginate ul.pagination {
|
||||||
|
margin: 2px 0;
|
||||||
|
white-space: nowrap;
|
||||||
|
}
|
||||||
|
|
||||||
|
@media screen and (max-width: 767px) {
|
||||||
|
div.dataTables_wrapper > div.row > div,
|
||||||
|
div.dataTables_length,
|
||||||
|
div.dataTables_filter,
|
||||||
|
div.dataTables_info,
|
||||||
|
div.dataTables_paginate {
|
||||||
|
text-align: center;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.DTTT {
|
||||||
|
margin-bottom: 0.5em;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
table.dataTable td,
|
||||||
|
table.dataTable th {
|
||||||
|
-webkit-box-sizing: content-box;
|
||||||
|
-moz-box-sizing: content-box;
|
||||||
|
box-sizing: content-box;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
table.dataTable {
|
||||||
|
clear: both;
|
||||||
|
margin-top: 6px !important;
|
||||||
|
margin-bottom: 6px !important;
|
||||||
|
max-width: none !important;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.dataTable thead .sorting,
|
||||||
|
table.dataTable thead .sorting_asc,
|
||||||
|
table.dataTable thead .sorting_desc,
|
||||||
|
table.dataTable thead .sorting_asc_disabled,
|
||||||
|
table.dataTable thead .sorting_desc_disabled {
|
||||||
|
cursor: pointer;
|
||||||
|
position: relative;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.dataTable thead .sorting:after,
|
||||||
|
table.dataTable thead .sorting_asc:after,
|
||||||
|
table.dataTable thead .sorting_desc:after {
|
||||||
|
position: absolute;
|
||||||
|
top: 8px;
|
||||||
|
right: 8px;
|
||||||
|
display: block;
|
||||||
|
font-family: 'Glyphicons Halflings';
|
||||||
|
opacity: 0.5;
|
||||||
|
}
|
||||||
|
table.dataTable thead .sorting:after {
|
||||||
|
opacity: 0.2;
|
||||||
|
content: "\e150"; /* sort */
|
||||||
|
}
|
||||||
|
table.dataTable thead .sorting_asc:after {
|
||||||
|
content: "\e155"; /* sort-by-attributes */
|
||||||
|
}
|
||||||
|
table.dataTable thead .sorting_desc:after {
|
||||||
|
content: "\e156"; /* sort-by-attributes-alt */
|
||||||
|
}
|
||||||
|
div.dataTables_scrollBody table.dataTable thead .sorting:after,
|
||||||
|
div.dataTables_scrollBody table.dataTable thead .sorting_asc:after,
|
||||||
|
div.dataTables_scrollBody table.dataTable thead .sorting_desc:after {
|
||||||
|
display: none;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.dataTable thead .sorting_asc_disabled:after,
|
||||||
|
table.dataTable thead .sorting_desc_disabled:after {
|
||||||
|
color: #eee;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.dataTable thead > tr > th {
|
||||||
|
padding-right: 30px;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.dataTable th:active {
|
||||||
|
outline: none;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/* Condensed */
|
||||||
|
table.dataTable.table-condensed thead > tr > th {
|
||||||
|
padding-right: 20px;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.dataTable.table-condensed thead .sorting:after,
|
||||||
|
table.dataTable.table-condensed thead .sorting_asc:after,
|
||||||
|
table.dataTable.table-condensed thead .sorting_desc:after {
|
||||||
|
top: 6px;
|
||||||
|
right: 6px;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* Scrolling */
|
||||||
|
div.dataTables_scrollHead table {
|
||||||
|
margin-bottom: 0 !important;
|
||||||
|
border-bottom-left-radius: 0;
|
||||||
|
border-bottom-right-radius: 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.dataTables_scrollHead table thead tr:last-child th:first-child,
|
||||||
|
div.dataTables_scrollHead table thead tr:last-child td:first-child {
|
||||||
|
border-bottom-left-radius: 0 !important;
|
||||||
|
border-bottom-right-radius: 0 !important;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.dataTables_scrollBody table {
|
||||||
|
border-top: none;
|
||||||
|
margin-top: 0 !important;
|
||||||
|
margin-bottom: 0 !important;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.dataTables_scrollBody tbody tr:first-child th,
|
||||||
|
div.dataTables_scrollBody tbody tr:first-child td {
|
||||||
|
border-top: none;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.dataTables_scrollFoot table {
|
||||||
|
margin-top: 0 !important;
|
||||||
|
border-top: none;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* Frustratingly the border-collapse:collapse used by Bootstrap makes the column
|
||||||
|
width calculations when using scrolling impossible to align columns. We have
|
||||||
|
to use separate
|
||||||
|
*/
|
||||||
|
table.table-bordered.dataTable {
|
||||||
|
border-collapse: separate !important;
|
||||||
|
}
|
||||||
|
table.table-bordered thead th,
|
||||||
|
table.table-bordered thead td {
|
||||||
|
border-left-width: 0;
|
||||||
|
border-top-width: 0;
|
||||||
|
}
|
||||||
|
table.table-bordered tbody th,
|
||||||
|
table.table-bordered tbody td {
|
||||||
|
border-left-width: 0;
|
||||||
|
border-bottom-width: 0;
|
||||||
|
}
|
||||||
|
table.table-bordered tfoot th,
|
||||||
|
table.table-bordered tfoot td {
|
||||||
|
border-left-width: 0;
|
||||||
|
border-bottom-width: 0;
|
||||||
|
}
|
||||||
|
table.table-bordered th:last-child,
|
||||||
|
table.table-bordered td:last-child {
|
||||||
|
border-right-width: 0;
|
||||||
|
}
|
||||||
|
div.dataTables_scrollHead table.table-bordered {
|
||||||
|
border-bottom-width: 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
/*
|
||||||
|
* TableTools styles
|
||||||
|
*/
|
||||||
|
.table.dataTable tbody tr.active td,
|
||||||
|
.table.dataTable tbody tr.active th {
|
||||||
|
background-color: #08C;
|
||||||
|
color: white;
|
||||||
|
}
|
||||||
|
|
||||||
|
.table.dataTable tbody tr.active:hover td,
|
||||||
|
.table.dataTable tbody tr.active:hover th {
|
||||||
|
background-color: #0075b0 !important;
|
||||||
|
}
|
||||||
|
|
||||||
|
.table.dataTable tbody tr.active th > a,
|
||||||
|
.table.dataTable tbody tr.active td > a {
|
||||||
|
color: white;
|
||||||
|
}
|
||||||
|
|
||||||
|
.table-striped.dataTable tbody tr.active:nth-child(odd) td,
|
||||||
|
.table-striped.dataTable tbody tr.active:nth-child(odd) th {
|
||||||
|
background-color: #017ebc;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.DTTT_selectable tbody tr {
|
||||||
|
cursor: pointer;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.DTTT .btn:hover {
|
||||||
|
text-decoration: none !important;
|
||||||
|
}
|
||||||
|
|
||||||
|
ul.DTTT_dropdown.dropdown-menu {
|
||||||
|
z-index: 2003;
|
||||||
|
}
|
||||||
|
|
||||||
|
ul.DTTT_dropdown.dropdown-menu a {
|
||||||
|
color: #333 !important; /* needed only when demo_page.css is included */
|
||||||
|
}
|
||||||
|
|
||||||
|
ul.DTTT_dropdown.dropdown-menu li {
|
||||||
|
position: relative;
|
||||||
|
}
|
||||||
|
|
||||||
|
ul.DTTT_dropdown.dropdown-menu li:hover a {
|
||||||
|
background-color: #0088cc;
|
||||||
|
color: white !important;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.DTTT_collection_background {
|
||||||
|
z-index: 2002;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* TableTools information display */
|
||||||
|
div.DTTT_print_info {
|
||||||
|
position: fixed;
|
||||||
|
top: 50%;
|
||||||
|
left: 50%;
|
||||||
|
width: 400px;
|
||||||
|
height: 150px;
|
||||||
|
margin-left: -200px;
|
||||||
|
margin-top: -75px;
|
||||||
|
text-align: center;
|
||||||
|
color: #333;
|
||||||
|
padding: 10px 30px;
|
||||||
|
opacity: 0.95;
|
||||||
|
|
||||||
|
background-color: white;
|
||||||
|
border: 1px solid rgba(0, 0, 0, 0.2);
|
||||||
|
border-radius: 6px;
|
||||||
|
|
||||||
|
-webkit-box-shadow: 0 3px 7px rgba(0, 0, 0, 0.5);
|
||||||
|
box-shadow: 0 3px 7px rgba(0, 0, 0, 0.5);
|
||||||
|
}
|
||||||
|
|
||||||
|
div.DTTT_print_info h6 {
|
||||||
|
font-weight: normal;
|
||||||
|
font-size: 28px;
|
||||||
|
line-height: 28px;
|
||||||
|
margin: 1em;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.DTTT_print_info p {
|
||||||
|
font-size: 14px;
|
||||||
|
line-height: 20px;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.dataTables_processing {
|
||||||
|
position: absolute;
|
||||||
|
top: 50%;
|
||||||
|
left: 50%;
|
||||||
|
width: 100%;
|
||||||
|
height: 60px;
|
||||||
|
margin-left: -50%;
|
||||||
|
margin-top: -25px;
|
||||||
|
padding-top: 20px;
|
||||||
|
padding-bottom: 20px;
|
||||||
|
text-align: center;
|
||||||
|
font-size: 1.2em;
|
||||||
|
background-color: white;
|
||||||
|
background: -webkit-gradient(linear, left top, right top, color-stop(0%, rgba(255,255,255,0)), color-stop(25%, rgba(255,255,255,0.9)), color-stop(75%, rgba(255,255,255,0.9)), color-stop(100%, rgba(255,255,255,0)));
|
||||||
|
background: -webkit-linear-gradient(left, rgba(255,255,255,0) 0%, rgba(255,255,255,0.9) 25%, rgba(255,255,255,0.9) 75%, rgba(255,255,255,0) 100%);
|
||||||
|
background: -moz-linear-gradient(left, rgba(255,255,255,0) 0%, rgba(255,255,255,0.9) 25%, rgba(255,255,255,0.9) 75%, rgba(255,255,255,0) 100%);
|
||||||
|
background: -ms-linear-gradient(left, rgba(255,255,255,0) 0%, rgba(255,255,255,0.9) 25%, rgba(255,255,255,0.9) 75%, rgba(255,255,255,0) 100%);
|
||||||
|
background: -o-linear-gradient(left, rgba(255,255,255,0) 0%, rgba(255,255,255,0.9) 25%, rgba(255,255,255,0.9) 75%, rgba(255,255,255,0) 100%);
|
||||||
|
background: linear-gradient(to right, rgba(255,255,255,0) 0%, rgba(255,255,255,0.9) 25%, rgba(255,255,255,0.9) 75%, rgba(255,255,255,0) 100%);
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
/*
|
||||||
|
* FixedColumns styles
|
||||||
|
*/
|
||||||
|
div.DTFC_LeftHeadWrapper table,
|
||||||
|
div.DTFC_LeftFootWrapper table,
|
||||||
|
div.DTFC_RightHeadWrapper table,
|
||||||
|
div.DTFC_RightFootWrapper table,
|
||||||
|
table.DTFC_Cloned tr.even {
|
||||||
|
background-color: white;
|
||||||
|
margin-bottom: 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.DTFC_RightHeadWrapper table ,
|
||||||
|
div.DTFC_LeftHeadWrapper table {
|
||||||
|
border-bottom: none !important;
|
||||||
|
margin-bottom: 0 !important;
|
||||||
|
border-top-right-radius: 0 !important;
|
||||||
|
border-bottom-left-radius: 0 !important;
|
||||||
|
border-bottom-right-radius: 0 !important;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.DTFC_RightHeadWrapper table thead tr:last-child th:first-child,
|
||||||
|
div.DTFC_RightHeadWrapper table thead tr:last-child td:first-child,
|
||||||
|
div.DTFC_LeftHeadWrapper table thead tr:last-child th:first-child,
|
||||||
|
div.DTFC_LeftHeadWrapper table thead tr:last-child td:first-child {
|
||||||
|
border-bottom-left-radius: 0 !important;
|
||||||
|
border-bottom-right-radius: 0 !important;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.DTFC_RightBodyWrapper table,
|
||||||
|
div.DTFC_LeftBodyWrapper table {
|
||||||
|
border-top: none;
|
||||||
|
margin: 0 !important;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.DTFC_RightBodyWrapper tbody tr:first-child th,
|
||||||
|
div.DTFC_RightBodyWrapper tbody tr:first-child td,
|
||||||
|
div.DTFC_LeftBodyWrapper tbody tr:first-child th,
|
||||||
|
div.DTFC_LeftBodyWrapper tbody tr:first-child td {
|
||||||
|
border-top: none;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.DTFC_RightFootWrapper table,
|
||||||
|
div.DTFC_LeftFootWrapper table {
|
||||||
|
border-top: none;
|
||||||
|
margin-top: 0 !important;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
div.DTFC_LeftBodyWrapper table.dataTable thead .sorting:after,
|
||||||
|
div.DTFC_LeftBodyWrapper table.dataTable thead .sorting_asc:after,
|
||||||
|
div.DTFC_LeftBodyWrapper table.dataTable thead .sorting_desc:after,
|
||||||
|
div.DTFC_RightBodyWrapper table.dataTable thead .sorting:after,
|
||||||
|
div.DTFC_RightBodyWrapper table.dataTable thead .sorting_asc:after,
|
||||||
|
div.DTFC_RightBodyWrapper table.dataTable thead .sorting_desc:after {
|
||||||
|
display: none;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/*
|
||||||
|
* FixedHeader styles
|
||||||
|
*/
|
||||||
|
div.FixedHeader_Cloned table {
|
||||||
|
margin: 0 !important
|
||||||
|
}
|
||||||
|
|
||||||
@ -0,0 +1,206 @@
|
|||||||
|
/*! DataTables Bootstrap 3 integration
|
||||||
|
* ©2011-2014 SpryMedia Ltd - datatables.net/license
|
||||||
|
*/
|
||||||
|
|
||||||
|
/**
|
||||||
|
* DataTables integration for Bootstrap 3. This requires Bootstrap 3 and
|
||||||
|
* DataTables 1.10 or newer.
|
||||||
|
*
|
||||||
|
* This file sets the defaults and adds options to DataTables to style its
|
||||||
|
* controls using Bootstrap. See http://datatables.net/manual/styling/bootstrap
|
||||||
|
* for further information.
|
||||||
|
*/
|
||||||
|
(function(window, document, undefined){
|
||||||
|
|
||||||
|
var factory = function( $, DataTable ) {
|
||||||
|
"use strict";
|
||||||
|
|
||||||
|
|
||||||
|
/* Set the defaults for DataTables initialisation */
|
||||||
|
$.extend( true, DataTable.defaults, {
|
||||||
|
dom:
|
||||||
|
"<'row'<'col-sm-6'l><'col-sm-6'f>>" +
|
||||||
|
"<'row'<'col-sm-12'tr>>" +
|
||||||
|
"<'row'<'col-sm-5'i><'col-sm-7'p>>",
|
||||||
|
renderer: 'bootstrap'
|
||||||
|
} );
|
||||||
|
|
||||||
|
|
||||||
|
/* Default class modification */
|
||||||
|
$.extend( DataTable.ext.classes, {
|
||||||
|
sWrapper: "dataTables_wrapper form-inline dt-bootstrap",
|
||||||
|
sFilterInput: "form-control input-sm",
|
||||||
|
sLengthSelect: "form-control input-sm"
|
||||||
|
} );
|
||||||
|
|
||||||
|
|
||||||
|
/* Bootstrap paging button renderer */
|
||||||
|
DataTable.ext.renderer.pageButton.bootstrap = function ( settings, host, idx, buttons, page, pages ) {
|
||||||
|
var api = new DataTable.Api( settings );
|
||||||
|
var classes = settings.oClasses;
|
||||||
|
var lang = settings.oLanguage.oPaginate;
|
||||||
|
var btnDisplay, btnClass, counter=0;
|
||||||
|
|
||||||
|
var attach = function( container, buttons ) {
|
||||||
|
var i, ien, node, button;
|
||||||
|
var clickHandler = function ( e ) {
|
||||||
|
e.preventDefault();
|
||||||
|
if ( !$(e.currentTarget).hasClass('disabled') ) {
|
||||||
|
api.page( e.data.action ).draw( false );
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
for ( i=0, ien=buttons.length ; i<ien ; i++ ) {
|
||||||
|
button = buttons[i];
|
||||||
|
|
||||||
|
if ( $.isArray( button ) ) {
|
||||||
|
attach( container, button );
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
btnDisplay = '';
|
||||||
|
btnClass = '';
|
||||||
|
|
||||||
|
switch ( button ) {
|
||||||
|
case 'ellipsis':
|
||||||
|
btnDisplay = '…';
|
||||||
|
btnClass = 'disabled';
|
||||||
|
break;
|
||||||
|
|
||||||
|
case 'first':
|
||||||
|
btnDisplay = lang.sFirst;
|
||||||
|
btnClass = button + (page > 0 ?
|
||||||
|
'' : ' disabled');
|
||||||
|
break;
|
||||||
|
|
||||||
|
case 'previous':
|
||||||
|
btnDisplay = lang.sPrevious;
|
||||||
|
btnClass = button + (page > 0 ?
|
||||||
|
'' : ' disabled');
|
||||||
|
break;
|
||||||
|
|
||||||
|
case 'next':
|
||||||
|
btnDisplay = lang.sNext;
|
||||||
|
btnClass = button + (page < pages-1 ?
|
||||||
|
'' : ' disabled');
|
||||||
|
break;
|
||||||
|
|
||||||
|
case 'last':
|
||||||
|
btnDisplay = lang.sLast;
|
||||||
|
btnClass = button + (page < pages-1 ?
|
||||||
|
'' : ' disabled');
|
||||||
|
break;
|
||||||
|
|
||||||
|
default:
|
||||||
|
btnDisplay = button + 1;
|
||||||
|
btnClass = page === button ?
|
||||||
|
'active' : '';
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
|
||||||
|
if ( btnDisplay ) {
|
||||||
|
node = $('<li>', {
|
||||||
|
'class': classes.sPageButton+' '+btnClass,
|
||||||
|
'id': idx === 0 && typeof button === 'string' ?
|
||||||
|
settings.sTableId +'_'+ button :
|
||||||
|
null
|
||||||
|
} )
|
||||||
|
.append( $('<a>', {
|
||||||
|
'href': '#',
|
||||||
|
'aria-controls': settings.sTableId,
|
||||||
|
'data-dt-idx': counter,
|
||||||
|
'tabindex': settings.iTabIndex
|
||||||
|
} )
|
||||||
|
.html( btnDisplay )
|
||||||
|
)
|
||||||
|
.appendTo( container );
|
||||||
|
|
||||||
|
settings.oApi._fnBindAction(
|
||||||
|
node, {action: button}, clickHandler
|
||||||
|
);
|
||||||
|
|
||||||
|
counter++;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
// IE9 throws an 'unknown error' if document.activeElement is used
|
||||||
|
// inside an iframe or frame.
|
||||||
|
var activeEl;
|
||||||
|
|
||||||
|
try {
|
||||||
|
// Because this approach is destroying and recreating the paging
|
||||||
|
// elements, focus is lost on the select button which is bad for
|
||||||
|
// accessibility. So we want to restore focus once the draw has
|
||||||
|
// completed
|
||||||
|
activeEl = $(document.activeElement).data('dt-idx');
|
||||||
|
}
|
||||||
|
catch (e) {}
|
||||||
|
|
||||||
|
attach(
|
||||||
|
$(host).empty().html('<ul class="pagination"/>').children('ul'),
|
||||||
|
buttons
|
||||||
|
);
|
||||||
|
|
||||||
|
if ( activeEl ) {
|
||||||
|
$(host).find( '[data-dt-idx='+activeEl+']' ).focus();
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
|
||||||
|
/*
|
||||||
|
* TableTools Bootstrap compatibility
|
||||||
|
* Required TableTools 2.1+
|
||||||
|
*/
|
||||||
|
if ( DataTable.TableTools ) {
|
||||||
|
// Set the classes that TableTools uses to something suitable for Bootstrap
|
||||||
|
$.extend( true, DataTable.TableTools.classes, {
|
||||||
|
"container": "DTTT btn-group",
|
||||||
|
"buttons": {
|
||||||
|
"normal": "btn btn-default",
|
||||||
|
"disabled": "disabled"
|
||||||
|
},
|
||||||
|
"collection": {
|
||||||
|
"container": "DTTT_dropdown dropdown-menu",
|
||||||
|
"buttons": {
|
||||||
|
"normal": "",
|
||||||
|
"disabled": "disabled"
|
||||||
|
}
|
||||||
|
},
|
||||||
|
"print": {
|
||||||
|
"info": "DTTT_print_info"
|
||||||
|
},
|
||||||
|
"select": {
|
||||||
|
"row": "active"
|
||||||
|
}
|
||||||
|
} );
|
||||||
|
|
||||||
|
// Have the collection use a bootstrap compatible drop down
|
||||||
|
$.extend( true, DataTable.TableTools.DEFAULTS.oTags, {
|
||||||
|
"collection": {
|
||||||
|
"container": "ul",
|
||||||
|
"button": "li",
|
||||||
|
"liner": "a"
|
||||||
|
}
|
||||||
|
} );
|
||||||
|
}
|
||||||
|
|
||||||
|
}; // /factory
|
||||||
|
|
||||||
|
|
||||||
|
// Define as an AMD module if possible
|
||||||
|
if ( typeof define === 'function' && define.amd ) {
|
||||||
|
define( ['jquery', 'datatables'], factory );
|
||||||
|
}
|
||||||
|
else if ( typeof exports === 'object' ) {
|
||||||
|
// Node/CommonJS
|
||||||
|
factory( require('jquery'), require('datatables') );
|
||||||
|
}
|
||||||
|
else if ( jQuery ) {
|
||||||
|
// Otherwise simply initialise as normal, stopping multiple evaluation
|
||||||
|
factory( jQuery, jQuery.fn.dataTable );
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
})(window, document);
|
||||||
|
|
||||||
@ -0,0 +1,14 @@
|
|||||||
|
/*
|
||||||
|
* Namespace DTCR - "DataTables ColReorder" plug-in
|
||||||
|
*/
|
||||||
|
|
||||||
|
table.DTCR_clonedTable {
|
||||||
|
background-color: rgba(255, 255, 255, 0.7);
|
||||||
|
z-index: 202;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.DTCR_pointer {
|
||||||
|
width: 1px;
|
||||||
|
background-color: #0259C4;
|
||||||
|
z-index: 201;
|
||||||
|
}
|
||||||
@ -0,0 +1 @@
|
|||||||
|
table.DTCR_clonedTable{background-color:rgba(255,255,255,0.7);z-index:202}div.DTCR_pointer{width:1px;background-color:#0259C4;z-index:201}
|
||||||
|
After Width: | Height: | Size: 1.8 KiB |
@ -0,0 +1,26 @@
|
|||||||
|
/*!
|
||||||
|
ColReorder 1.1.3
|
||||||
|
©2010-2014 SpryMedia Ltd - datatables.net/license
|
||||||
|
*/
|
||||||
|
(function(o,r,s){function p(d){for(var f=[],a=0,b=d.length;a<b;a++)f[d[a]]=a;return f}function l(d,f,a){f=d.splice(f,1)[0];d.splice(a,0,f)}function q(d,f,a){for(var b=[],e=0,h=d.childNodes.length;e<h;e++)1==d.childNodes[e].nodeType&&b.push(d.childNodes[e]);f=b[f];null!==a?d.insertBefore(f,b[a]):d.appendChild(f)}o=function(d){d.fn.dataTableExt.oApi.fnColReorder=function(a,b,e){var h=d.fn.dataTable.Api?!0:!1,c,g,f,m,n=a.aoColumns.length,i,j;i=function(a,b,c){if(a[b]){var e=a[b].split("."),d=e.shift();
|
||||||
|
isNaN(1*d)||(a[b]=c[1*d]+"."+e.join("."))}};if(b!=e)if(0>b||b>=n)this.oApi._fnLog(a,1,"ColReorder 'from' index is out of bounds: "+b);else if(0>e||e>=n)this.oApi._fnLog(a,1,"ColReorder 'to' index is out of bounds: "+e);else{f=[];c=0;for(g=n;c<g;c++)f[c]=c;l(f,b,e);var k=p(f);c=0;for(g=a.aaSorting.length;c<g;c++)a.aaSorting[c][0]=k[a.aaSorting[c][0]];if(null!==a.aaSortingFixed){c=0;for(g=a.aaSortingFixed.length;c<g;c++)a.aaSortingFixed[c][0]=k[a.aaSortingFixed[c][0]]}c=0;for(g=n;c<g;c++){j=a.aoColumns[c];
|
||||||
|
f=0;for(m=j.aDataSort.length;f<m;f++)j.aDataSort[f]=k[j.aDataSort[f]];h&&(j.idx=k[j.idx])}h&&d.each(a.aLastSort,function(b,c){a.aLastSort[b].src=k[c.src]});c=0;for(g=n;c<g;c++)j=a.aoColumns[c],"number"==typeof j.mData?(j.mData=k[j.mData],a.oApi._fnColumnOptions(a,c,{})):d.isPlainObject(j.mData)&&(i(j.mData,"_",k),i(j.mData,"filter",k),i(j.mData,"sort",k),i(j.mData,"type",k),a.oApi._fnColumnOptions(a,c,{}));if(a.aoColumns[b].bVisible){f=this.oApi._fnColumnIndexToVisible(a,b);m=null;for(c=e<b?e:e+1;null===
|
||||||
|
m&&c<n;)m=this.oApi._fnColumnIndexToVisible(a,c),c++;i=a.nTHead.getElementsByTagName("tr");c=0;for(g=i.length;c<g;c++)q(i[c],f,m);if(null!==a.nTFoot){i=a.nTFoot.getElementsByTagName("tr");c=0;for(g=i.length;c<g;c++)q(i[c],f,m)}c=0;for(g=a.aoData.length;c<g;c++)null!==a.aoData[c].nTr&&q(a.aoData[c].nTr,f,m)}l(a.aoColumns,b,e);l(a.aoPreSearchCols,b,e);c=0;for(g=a.aoData.length;c<g;c++)i=a.aoData[c],h?(i.anCells&&l(i.anCells,b,e),"dom"!==i.src&&d.isArray(i._aData)&&l(i._aData,b,e)):(d.isArray(i._aData)&&
|
||||||
|
l(i._aData,b,e),l(i._anHidden,b,e));c=0;for(g=a.aoHeader.length;c<g;c++)l(a.aoHeader[c],b,e);if(null!==a.aoFooter){c=0;for(g=a.aoFooter.length;c<g;c++)l(a.aoFooter[c],b,e)}h&&(new d.fn.dataTable.Api(a)).rows().invalidate();c=0;for(g=n;c<g;c++)d(a.aoColumns[c].nTh).off("click.DT"),this.oApi._fnSortAttachListener(a,a.aoColumns[c].nTh,c);d(a.oInstance).trigger("column-reorder",[a,{iFrom:b,iTo:e,aiInvertMapping:k}])}};var f=function(a,b){var e;d.fn.dataTable.Api?e=(new d.fn.dataTable.Api(a)).settings()[0]:
|
||||||
|
a.fnSettings?e=a.fnSettings():"string"===typeof a?d.fn.dataTable.fnIsDataTable(d(a)[0])&&(e=d(a).eq(0).dataTable().fnSettings()):a.nodeName&&"table"===a.nodeName.toLowerCase()?d.fn.dataTable.fnIsDataTable(a.nodeName)&&(e=d(a.nodeName).dataTable().fnSettings()):a instanceof jQuery?d.fn.dataTable.fnIsDataTable(a[0])&&(e=a.eq(0).dataTable().fnSettings()):e=a;if(e._colReorder)throw"ColReorder already initialised on table #"+e.nTable.id;var h=d.fn.dataTable.camelToHungarian;h&&(h(f.defaults,f.defaults,
|
||||||
|
!0),h(f.defaults,b||{}));this.s={dt:null,init:d.extend(!0,{},f.defaults,b),fixed:0,fixedRight:0,reorderCallback:null,mouse:{startX:-1,startY:-1,offsetX:-1,offsetY:-1,target:-1,targetIndex:-1,fromIndex:-1},aoTargets:[]};this.dom={drag:null,pointer:null};this.s.dt=e;this.s.dt._colReorder=this;this._fnConstruct();e.oApi._fnCallbackReg(e,"aoDestroyCallback",d.proxy(this._fnDestroy,this),"ColReorder");return this};f.prototype={fnReset:function(){for(var a=[],b=0,e=this.s.dt.aoColumns.length;b<e;b++)a.push(this.s.dt.aoColumns[b]._ColReorder_iOrigCol);
|
||||||
|
this._fnOrderColumns(a);return this},fnGetCurrentOrder:function(){return this.fnOrder()},fnOrder:function(a){if(a===s){for(var a=[],b=0,e=this.s.dt.aoColumns.length;b<e;b++)a.push(this.s.dt.aoColumns[b]._ColReorder_iOrigCol);return a}this._fnOrderColumns(p(a));return this},_fnConstruct:function(){var a=this,b=this.s.dt.aoColumns.length,e;this.s.init.iFixedColumns&&(this.s.fixed=this.s.init.iFixedColumns);this.s.fixedRight=this.s.init.iFixedColumnsRight?this.s.init.iFixedColumnsRight:0;this.s.init.fnReorderCallback&&
|
||||||
|
(this.s.reorderCallback=this.s.init.fnReorderCallback);for(e=0;e<b;e++)e>this.s.fixed-1&&e<b-this.s.fixedRight&&this._fnMouseListener(e,this.s.dt.aoColumns[e].nTh),this.s.dt.aoColumns[e]._ColReorder_iOrigCol=e;this.s.dt.oApi._fnCallbackReg(this.s.dt,"aoStateSaveParams",function(b,c){a._fnStateSave.call(a,c)},"ColReorder_State");var d=null;this.s.init.aiOrder&&(d=this.s.init.aiOrder.slice());this.s.dt.oLoadedState&&("undefined"!=typeof this.s.dt.oLoadedState.ColReorder&&this.s.dt.oLoadedState.ColReorder.length==
|
||||||
|
this.s.dt.aoColumns.length)&&(d=this.s.dt.oLoadedState.ColReorder);if(d)if(a.s.dt._bInitComplete)b=p(d),a._fnOrderColumns.call(a,b);else{var c=!1;this.s.dt.aoDrawCallback.push({fn:function(){if(!a.s.dt._bInitComplete&&!c){c=true;var b=p(d);a._fnOrderColumns.call(a,b)}},sName:"ColReorder_Pre"})}else this._fnSetColumnIndexes()},_fnOrderColumns:function(a){if(a.length!=this.s.dt.aoColumns.length)this.s.dt.oInstance.oApi._fnLog(this.s.dt,1,"ColReorder - array reorder does not match known number of columns. Skipping.");
|
||||||
|
else{for(var b=0,e=a.length;b<e;b++){var h=d.inArray(b,a);b!=h&&(l(a,h,b),this.s.dt.oInstance.fnColReorder(h,b))}(""!==this.s.dt.oScroll.sX||""!==this.s.dt.oScroll.sY)&&this.s.dt.oInstance.fnAdjustColumnSizing(!1);this.s.dt.oInstance.oApi._fnSaveState(this.s.dt);this._fnSetColumnIndexes();null!==this.s.reorderCallback&&this.s.reorderCallback.call(this)}},_fnStateSave:function(a){var b,e,h,c=this.s.dt.aoColumns;a.ColReorder=[];if(a.aaSorting){for(b=0;b<a.aaSorting.length;b++)a.aaSorting[b][0]=c[a.aaSorting[b][0]]._ColReorder_iOrigCol;
|
||||||
|
var f=d.extend(!0,[],a.aoSearchCols);b=0;for(e=c.length;b<e;b++)h=c[b]._ColReorder_iOrigCol,a.aoSearchCols[h]=f[b],a.abVisCols[h]=c[b].bVisible,a.ColReorder.push(h)}else if(a.order){for(b=0;b<a.order.length;b++)a.order[b][0]=c[a.order[b][0]]._ColReorder_iOrigCol;f=d.extend(!0,[],a.columns);b=0;for(e=c.length;b<e;b++)h=c[b]._ColReorder_iOrigCol,a.columns[h]=f[b],a.ColReorder.push(h)}},_fnMouseListener:function(a,b){var e=this;d(b).on("mousedown.ColReorder",function(a){a.preventDefault();e._fnMouseDown.call(e,
|
||||||
|
a,b)})},_fnMouseDown:function(a,b){var e=this,f=d(a.target).closest("th, td").offset(),c=parseInt(d(b).attr("data-column-index"),10);c!==s&&(this.s.mouse.startX=a.pageX,this.s.mouse.startY=a.pageY,this.s.mouse.offsetX=a.pageX-f.left,this.s.mouse.offsetY=a.pageY-f.top,this.s.mouse.target=this.s.dt.aoColumns[c].nTh,this.s.mouse.targetIndex=c,this.s.mouse.fromIndex=c,this._fnRegions(),d(r).on("mousemove.ColReorder",function(a){e._fnMouseMove.call(e,a)}).on("mouseup.ColReorder",function(a){e._fnMouseUp.call(e,
|
||||||
|
a)}))},_fnMouseMove:function(a){if(null===this.dom.drag){if(5>Math.pow(Math.pow(a.pageX-this.s.mouse.startX,2)+Math.pow(a.pageY-this.s.mouse.startY,2),0.5))return;this._fnCreateDragNode()}this.dom.drag.css({left:a.pageX-this.s.mouse.offsetX,top:a.pageY-this.s.mouse.offsetY});for(var b=!1,e=this.s.mouse.toIndex,d=1,c=this.s.aoTargets.length;d<c;d++)if(a.pageX<this.s.aoTargets[d-1].x+(this.s.aoTargets[d].x-this.s.aoTargets[d-1].x)/2){this.dom.pointer.css("left",this.s.aoTargets[d-1].x);this.s.mouse.toIndex=
|
||||||
|
this.s.aoTargets[d-1].to;b=!0;break}b||(this.dom.pointer.css("left",this.s.aoTargets[this.s.aoTargets.length-1].x),this.s.mouse.toIndex=this.s.aoTargets[this.s.aoTargets.length-1].to);this.s.init.bRealtime&&e!==this.s.mouse.toIndex&&(this.s.dt.oInstance.fnColReorder(this.s.mouse.fromIndex,this.s.mouse.toIndex),this.s.mouse.fromIndex=this.s.mouse.toIndex,this._fnRegions())},_fnMouseUp:function(){d(r).off("mousemove.ColReorder mouseup.ColReorder");null!==this.dom.drag&&(this.dom.drag.remove(),this.dom.pointer.remove(),
|
||||||
|
this.dom.drag=null,this.dom.pointer=null,this.s.dt.oInstance.fnColReorder(this.s.mouse.fromIndex,this.s.mouse.toIndex),this._fnSetColumnIndexes(),(""!==this.s.dt.oScroll.sX||""!==this.s.dt.oScroll.sY)&&this.s.dt.oInstance.fnAdjustColumnSizing(!1),this.s.dt.oInstance.oApi._fnSaveState(this.s.dt),null!==this.s.reorderCallback&&this.s.reorderCallback.call(this))},_fnRegions:function(){var a=this.s.dt.aoColumns;this.s.aoTargets.splice(0,this.s.aoTargets.length);this.s.aoTargets.push({x:d(this.s.dt.nTable).offset().left,
|
||||||
|
to:0});for(var b=0,e=0,f=a.length;e<f;e++)e!=this.s.mouse.fromIndex&&b++,a[e].bVisible&&this.s.aoTargets.push({x:d(a[e].nTh).offset().left+d(a[e].nTh).outerWidth(),to:b});0!==this.s.fixedRight&&this.s.aoTargets.splice(this.s.aoTargets.length-this.s.fixedRight);0!==this.s.fixed&&this.s.aoTargets.splice(0,this.s.fixed)},_fnCreateDragNode:function(){var a=""!==this.s.dt.oScroll.sX||""!==this.s.dt.oScroll.sY,b=this.s.dt.aoColumns[this.s.mouse.targetIndex].nTh,e=b.parentNode,f=e.parentNode,c=f.parentNode,
|
||||||
|
g=d(b).clone();this.dom.drag=d(c.cloneNode(!1)).addClass("DTCR_clonedTable").append(d(f.cloneNode(!1)).append(d(e.cloneNode(!1)).append(g[0]))).css({position:"absolute",top:0,left:0,width:d(b).outerWidth(),height:d(b).outerHeight()}).appendTo("body");this.dom.pointer=d("<div></div>").addClass("DTCR_pointer").css({position:"absolute",top:a?d("div.dataTables_scroll",this.s.dt.nTableWrapper).offset().top:d(this.s.dt.nTable).offset().top,height:a?d("div.dataTables_scroll",this.s.dt.nTableWrapper).height():
|
||||||
|
d(this.s.dt.nTable).height()}).appendTo("body")},_fnDestroy:function(){var a,b;a=0;for(b=this.s.dt.aoDrawCallback.length;a<b;a++)if("ColReorder_Pre"===this.s.dt.aoDrawCallback[a].sName){this.s.dt.aoDrawCallback.splice(a,1);break}d(this.s.dt.nTHead).find("*").off(".ColReorder");d.each(this.s.dt.aoColumns,function(a,b){d(b.nTh).removeAttr("data-column-index")});this.s=this.s.dt._colReorder=null},_fnSetColumnIndexes:function(){d.each(this.s.dt.aoColumns,function(a,b){d(b.nTh).attr("data-column-index",
|
||||||
|
a)})}};f.defaults={aiOrder:null,bRealtime:!1,iFixedColumns:0,iFixedColumnsRight:0,fnReorderCallback:null};f.version="1.1.3";d.fn.dataTable.ColReorder=f;d.fn.DataTable.ColReorder=f;"function"==typeof d.fn.dataTable&&"function"==typeof d.fn.dataTableExt.fnVersionCheck&&d.fn.dataTableExt.fnVersionCheck("1.9.3")?d.fn.dataTableExt.aoFeatures.push({fnInit:function(a){var b=a.oInstance;a._colReorder?b.oApi._fnLog(a,1,"ColReorder attempted to initialise twice. Ignoring second"):(b=a.oInit,new f(a,b.colReorder||
|
||||||
|
b.oColReorder||{}));return null},cFeature:"R",sFeature:"ColReorder"}):alert("Warning: ColReorder requires DataTables 1.9.3 or greater - www.datatables.net/download");d.fn.dataTable.Api&&(d.fn.dataTable.Api.register("colReorder.reset()",function(){return this.iterator("table",function(a){a._colReorder.fnReset()})}),d.fn.dataTable.Api.register("colReorder.order()",function(a){return a?this.iterator("table",function(b){b._colReorder.fnOrder(a)}):this.context.length?this.context[0]._colReorder.fnOrder():
|
||||||
|
null}));return f};"function"===typeof define&&define.amd?define(["jquery","datatables"],o):"object"===typeof exports?o(require("jquery"),require("datatables")):jQuery&&!jQuery.fn.dataTable.ColReorder&&o(jQuery,jQuery.fn.dataTable)})(window,document);
|
||||||
@ -0,0 +1,185 @@
|
|||||||
|
|
||||||
|
/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||||
|
* ColVis styles
|
||||||
|
*/
|
||||||
|
div.ColVis {
|
||||||
|
float: right;
|
||||||
|
margin-bottom: 1em;
|
||||||
|
}
|
||||||
|
|
||||||
|
button.ColVis_Button,
|
||||||
|
ul.ColVis_collection li {
|
||||||
|
position: relative;
|
||||||
|
float: left;
|
||||||
|
margin-right: 3px;
|
||||||
|
padding: 5px 8px;
|
||||||
|
border: 1px solid #999;
|
||||||
|
cursor: pointer;
|
||||||
|
*cursor: hand;
|
||||||
|
font-size: 0.88em;
|
||||||
|
color: black !important;
|
||||||
|
white-space: nowrap;
|
||||||
|
|
||||||
|
-webkit-border-radius: 2px;
|
||||||
|
-moz-border-radius: 2px;
|
||||||
|
-ms-border-radius: 2px;
|
||||||
|
-o-border-radius: 2px;
|
||||||
|
border-radius: 2px;
|
||||||
|
|
||||||
|
-webkit-box-shadow: 1px 1px 3px #ccc;
|
||||||
|
-moz-box-shadow: 1px 1px 3px #ccc;
|
||||||
|
-ms-box-shadow: 1px 1px 3px #ccc;
|
||||||
|
-o-box-shadow: 1px 1px 3px #ccc;
|
||||||
|
box-shadow: 1px 1px 3px #ccc;
|
||||||
|
|
||||||
|
/* Generated by http://www.colorzilla.com/gradient-editor/ */
|
||||||
|
background: #ffffff; /* Old browsers */
|
||||||
|
background: -webkit-linear-gradient(top, #ffffff 0%,#f3f3f3 89%,#f9f9f9 100%); /* Chrome10+,Safari5.1+ */
|
||||||
|
background: -moz-linear-gradient(top, #ffffff 0%,#f3f3f3 89%,#f9f9f9 100%); /* FF3.6+ */
|
||||||
|
background: -ms-linear-gradient(top, #ffffff 0%,#f3f3f3 89%,#f9f9f9 100%); /* IE10+ */
|
||||||
|
background: -o-linear-gradient(top, #ffffff 0%,#f3f3f3 89%,#f9f9f9 100%); /* Opera 11.10+ */
|
||||||
|
background: linear-gradient(top, #ffffff 0%,#f3f3f3 89%,#f9f9f9 100%); /* W3C */
|
||||||
|
filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#ffffff', endColorstr='#f9f9f9',GradientType=0 ); /* IE6-9 */
|
||||||
|
}
|
||||||
|
|
||||||
|
.ColVis_Button:hover,
|
||||||
|
ul.ColVis_collection li:hover {
|
||||||
|
border: 1px solid #666;
|
||||||
|
text-decoration: none !important;
|
||||||
|
|
||||||
|
-webkit-box-shadow: 1px 1px 3px #999;
|
||||||
|
-moz-box-shadow: 1px 1px 3px #999;
|
||||||
|
-ms-box-shadow: 1px 1px 3px #999;
|
||||||
|
-o-box-shadow: 1px 1px 3px #999;
|
||||||
|
box-shadow: 1px 1px 3px #999;
|
||||||
|
|
||||||
|
background: #f3f3f3; /* Old browsers */
|
||||||
|
background: -webkit-linear-gradient(top, #f3f3f3 0%,#e2e2e2 89%,#f4f4f4 100%); /* Chrome10+,Safari5.1+ */
|
||||||
|
background: -moz-linear-gradient(top, #f3f3f3 0%,#e2e2e2 89%,#f4f4f4 100%); /* FF3.6+ */
|
||||||
|
background: -ms-linear-gradient(top, #f3f3f3 0%,#e2e2e2 89%,#f4f4f4 100%); /* IE10+ */
|
||||||
|
background: -o-linear-gradient(top, #f3f3f3 0%,#e2e2e2 89%,#f4f4f4 100%); /* Opera 11.10+ */
|
||||||
|
background: linear-gradient(top, #f3f3f3 0%,#e2e2e2 89%,#f4f4f4 100%); /* W3C */
|
||||||
|
filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#f3f3f3', endColorstr='#f4f4f4',GradientType=0 ); /* IE6-9 */
|
||||||
|
}
|
||||||
|
|
||||||
|
button.ColVis_Button {
|
||||||
|
height: 30px;
|
||||||
|
padding: 3px 8px;
|
||||||
|
}
|
||||||
|
|
||||||
|
button.ColVis_Button::-moz-focus-inner {
|
||||||
|
border: none !important;
|
||||||
|
padding: 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
button.ColVis_Button:active {
|
||||||
|
outline: none;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
div.ColVis_collectionBackground {
|
||||||
|
position: fixed;
|
||||||
|
top: 0;
|
||||||
|
left: 0;
|
||||||
|
height: 100%;
|
||||||
|
width: 100%;
|
||||||
|
background-color: black;
|
||||||
|
z-index: 1100;
|
||||||
|
}
|
||||||
|
|
||||||
|
ul.ColVis_collection {
|
||||||
|
list-style: none;
|
||||||
|
width: 150px;
|
||||||
|
padding: 8px 8px 4px 8px;
|
||||||
|
margin: 0;
|
||||||
|
border: 1px solid #ccc;
|
||||||
|
border: 1px solid rgba( 0, 0, 0, 0.4 );
|
||||||
|
background-color: #f3f3f3;
|
||||||
|
background-color: rgba( 255, 255, 255, 0.3 );
|
||||||
|
overflow: hidden;
|
||||||
|
z-index: 2002;
|
||||||
|
|
||||||
|
-webkit-border-radius: 5px;
|
||||||
|
-moz-border-radius: 5px;
|
||||||
|
-ms-border-radius: 5px;
|
||||||
|
-o-border-radius: 5px;
|
||||||
|
border-radius: 5px;
|
||||||
|
|
||||||
|
-webkit-box-shadow: 3px 3px 5px rgba(0, 0, 0, 0.3);
|
||||||
|
-moz-box-shadow: 3px 3px 5px rgba(0, 0, 0, 0.3);
|
||||||
|
-ms-box-shadow: 3px 3px 5px rgba(0, 0, 0, 0.3);
|
||||||
|
-o-box-shadow: 3px 3px 5px rgba(0, 0, 0, 0.3);
|
||||||
|
box-shadow: 3px 3px 5px rgba(0, 0, 0, 0.3);
|
||||||
|
}
|
||||||
|
|
||||||
|
ul.ColVis_collection li {
|
||||||
|
position: relative;
|
||||||
|
height: auto;
|
||||||
|
left: 0;
|
||||||
|
right: 0;
|
||||||
|
padding: 0.5em;
|
||||||
|
|
||||||
|
display: block;
|
||||||
|
float: none;
|
||||||
|
margin-bottom: 4px;
|
||||||
|
|
||||||
|
-webkit-box-shadow: 1px 1px 3px #999;
|
||||||
|
-moz-box-shadow: 1px 1px 3px #999;
|
||||||
|
-ms-box-shadow: 1px 1px 3px #999;
|
||||||
|
-o-box-shadow: 1px 1px 3px #999;
|
||||||
|
box-shadow: 1px 1px 3px #999;
|
||||||
|
}
|
||||||
|
|
||||||
|
ul.ColVis_collection li {
|
||||||
|
text-align: left;
|
||||||
|
}
|
||||||
|
|
||||||
|
ul.ColVis_collection li.ColVis_Button:hover {
|
||||||
|
border: 1px solid #999;
|
||||||
|
background-color: #f0f0f0;
|
||||||
|
}
|
||||||
|
|
||||||
|
ul.ColVis_collection li span {
|
||||||
|
display: inline-block;
|
||||||
|
padding-left: 0.5em;
|
||||||
|
cursor: pointer;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
ul.ColVis_collection li.ColVis_Special {
|
||||||
|
border-color: #555;
|
||||||
|
background: rgb(237,237,237); /* Old browsers */
|
||||||
|
background: -webkit-linear-gradient(top, rgba(237,237,237,1) 0%,rgba(214,214,214,1) 77%,rgba(232,232,232,1) 100%); /* Chrome10+,Safari5.1+ */
|
||||||
|
background: -moz-linear-gradient(top, rgba(237,237,237,1) 0%, rgba(214,214,214,1) 77%, rgba(232,232,232,1) 100%); /* FF3.6+ */
|
||||||
|
background: -ms-linear-gradient(top, rgba(237,237,237,1) 0%,rgba(214,214,214,1) 77%,rgba(232,232,232,1) 100%); /* IE10+ */
|
||||||
|
background: -o-linear-gradient(top, rgba(237,237,237,1) 0%,rgba(214,214,214,1) 77%,rgba(232,232,232,1) 100%); /* Opera 11.10+ */
|
||||||
|
background: linear-gradient(to bottom, rgba(237,237,237,1) 0%,rgba(214,214,214,1) 77%,rgba(232,232,232,1) 100%); /* W3C */
|
||||||
|
filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#ededed', endColorstr='#e8e8e8',GradientType=0 ); /* IE6-9 */
|
||||||
|
}
|
||||||
|
|
||||||
|
ul.ColVis_collection li.ColVis_Special:hover {
|
||||||
|
background: #e2e2e2; /* Old browsers */
|
||||||
|
background: -webkit-linear-gradient(top, #d0d0d0 0%,#d5d5d5 89%,#e2e2e2 100%); /* Chrome10+,Safari5.1+ */
|
||||||
|
background: -moz-linear-gradient(top, #d0d0d0 0%,#d5d5d5 89%,#e2e2e2 100%); /* FF3.6+ */
|
||||||
|
background: -ms-linear-gradient(top, #d0d0d0 0%,#d5d5d5 89%,#e2e2e2 100%); /* IE10+ */
|
||||||
|
background: -o-linear-gradient(top, #d0d0d0 0%,#d5d5d5 89%,#e2e2e2 100%); /* Opera 11.10+ */
|
||||||
|
background: linear-gradient(top, #d0d0d0 0%,#d5d5d5 89%,#e2e2e2 100%); /* W3C */
|
||||||
|
filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#f3f3f3', endColorstr='#e2e2e2',GradientType=0 ); /* IE6-9 */
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
span.ColVis_radio {
|
||||||
|
display: inline-block;
|
||||||
|
width: 20px;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.ColVis_catcher {
|
||||||
|
position: absolute;
|
||||||
|
z-index: 1101;
|
||||||
|
}
|
||||||
|
|
||||||
|
.disabled {
|
||||||
|
color: #999;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
@ -0,0 +1 @@
|
|||||||
|
div.ColVis{float:right;margin-bottom:1em}button.ColVis_Button,ul.ColVis_collection li{position:relative;float:left;margin-right:3px;padding:5px 8px;border:1px solid #999;cursor:pointer;*cursor:hand;font-size:0.88em;color:black !important;white-space:nowrap;-webkit-border-radius:2px;-moz-border-radius:2px;-ms-border-radius:2px;-o-border-radius:2px;border-radius:2px;-webkit-box-shadow:1px 1px 3px #ccc;-moz-box-shadow:1px 1px 3px #ccc;-ms-box-shadow:1px 1px 3px #ccc;-o-box-shadow:1px 1px 3px #ccc;box-shadow:1px 1px 3px #ccc;background:#ffffff;background:-webkit-linear-gradient(top, #fff 0%, #f3f3f3 89%, #f9f9f9 100%);background:-moz-linear-gradient(top, #fff 0%, #f3f3f3 89%, #f9f9f9 100%);background:-ms-linear-gradient(top, #fff 0%, #f3f3f3 89%, #f9f9f9 100%);background:-o-linear-gradient(top, #fff 0%, #f3f3f3 89%, #f9f9f9 100%);background:linear-gradient(top, #fff 0%, #f3f3f3 89%, #f9f9f9 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#f9f9f9',GradientType=0 )}.ColVis_Button:hover,ul.ColVis_collection li:hover{border:1px solid #666;text-decoration:none !important;-webkit-box-shadow:1px 1px 3px #999;-moz-box-shadow:1px 1px 3px #999;-ms-box-shadow:1px 1px 3px #999;-o-box-shadow:1px 1px 3px #999;box-shadow:1px 1px 3px #999;background:#f3f3f3;background:-webkit-linear-gradient(top, #f3f3f3 0%, #e2e2e2 89%, #f4f4f4 100%);background:-moz-linear-gradient(top, #f3f3f3 0%, #e2e2e2 89%, #f4f4f4 100%);background:-ms-linear-gradient(top, #f3f3f3 0%, #e2e2e2 89%, #f4f4f4 100%);background:-o-linear-gradient(top, #f3f3f3 0%, #e2e2e2 89%, #f4f4f4 100%);background:linear-gradient(top, #f3f3f3 0%, #e2e2e2 89%, #f4f4f4 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#f3f3f3', endColorstr='#f4f4f4',GradientType=0 )}button.ColVis_Button{height:30px;padding:3px 8px}button.ColVis_Button::-moz-focus-inner{border:none !important;padding:0}button.ColVis_Button:active{outline:none}div.ColVis_collectionBackground{position:fixed;top:0;left:0;height:100%;width:100%;background-color:black;z-index:1100}ul.ColVis_collection{list-style:none;width:150px;padding:8px 8px 4px 8px;margin:0;border:1px solid #ccc;border:1px solid rgba(0,0,0,0.4);background-color:#f3f3f3;background-color:rgba(255,255,255,0.3);overflow:hidden;z-index:2002;-webkit-border-radius:5px;-moz-border-radius:5px;-ms-border-radius:5px;-o-border-radius:5px;border-radius:5px;-webkit-box-shadow:3px 3px 5px rgba(0,0,0,0.3);-moz-box-shadow:3px 3px 5px rgba(0,0,0,0.3);-ms-box-shadow:3px 3px 5px rgba(0,0,0,0.3);-o-box-shadow:3px 3px 5px rgba(0,0,0,0.3);box-shadow:3px 3px 5px rgba(0,0,0,0.3)}ul.ColVis_collection li{position:relative;height:auto;left:0;right:0;padding:0.5em;display:block;float:none;margin-bottom:4px;-webkit-box-shadow:1px 1px 3px #999;-moz-box-shadow:1px 1px 3px #999;-ms-box-shadow:1px 1px 3px #999;-o-box-shadow:1px 1px 3px #999;box-shadow:1px 1px 3px #999}ul.ColVis_collection li{text-align:left}ul.ColVis_collection li.ColVis_Button:hover{border:1px solid #999;background-color:#f0f0f0}ul.ColVis_collection li span{display:inline-block;padding-left:0.5em;cursor:pointer}ul.ColVis_collection li.ColVis_Special{border-color:#555;background:#ededed;background:-webkit-linear-gradient(top, #ededed 0%, #d6d6d6 77%, #e8e8e8 100%);background:-moz-linear-gradient(top, #ededed 0%, #d6d6d6 77%, #e8e8e8 100%);background:-ms-linear-gradient(top, #ededed 0%, #d6d6d6 77%, #e8e8e8 100%);background:-o-linear-gradient(top, #ededed 0%, #d6d6d6 77%, #e8e8e8 100%);background:linear-gradient(to bottom, #ededed 0%, #d6d6d6 77%, #e8e8e8 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ededed', endColorstr='#e8e8e8',GradientType=0 )}ul.ColVis_collection li.ColVis_Special:hover{background:#e2e2e2;background:-webkit-linear-gradient(top, #d0d0d0 0%, #d5d5d5 89%, #e2e2e2 100%);background:-moz-linear-gradient(top, #d0d0d0 0%, #d5d5d5 89%, #e2e2e2 100%);background:-ms-linear-gradient(top, #d0d0d0 0%, #d5d5d5 89%, #e2e2e2 100%);background:-o-linear-gradient(top, #d0d0d0 0%, #d5d5d5 89%, #e2e2e2 100%);background:linear-gradient(top, #d0d0d0 0%, #d5d5d5 89%, #e2e2e2 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#f3f3f3', endColorstr='#e2e2e2',GradientType=0 )}span.ColVis_radio{display:inline-block;width:20px}div.ColVis_catcher{position:absolute;z-index:1101}.disabled{color:#999}
|
||||||
@ -0,0 +1,41 @@
|
|||||||
|
|
||||||
|
button.ColVis_Button,
|
||||||
|
ul.ColVis_collection li {
|
||||||
|
padding: 0.5em;
|
||||||
|
}
|
||||||
|
|
||||||
|
ul.ColVis_collection {
|
||||||
|
margin: 0;
|
||||||
|
padding: 0;
|
||||||
|
overflow: hidden;
|
||||||
|
z-index: 2002;
|
||||||
|
}
|
||||||
|
|
||||||
|
ul.ColVis_collection li {
|
||||||
|
clear: both;
|
||||||
|
display: block;
|
||||||
|
text-align: left;
|
||||||
|
margin: -1px 0 0 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
ul.ColVis_collection li span {
|
||||||
|
display: inline-block;
|
||||||
|
padding-left: 0.5em;
|
||||||
|
cursor: pointer;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.ColVis_collectionBackground {
|
||||||
|
position: fixed;
|
||||||
|
top: 0;
|
||||||
|
left: 0;
|
||||||
|
height: 100%;
|
||||||
|
width: 100%;
|
||||||
|
background-color: black;
|
||||||
|
z-index: 1100;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
div.ColVis_catcher {
|
||||||
|
position: absolute;
|
||||||
|
z-index: 1101;
|
||||||
|
}
|
||||||
@ -0,0 +1,24 @@
|
|||||||
|
/*!
|
||||||
|
ColVis 1.1.2
|
||||||
|
©2010-2015 SpryMedia Ltd - datatables.net/license
|
||||||
|
*/
|
||||||
|
(function(j,i,k){j=function(d){var e=function(a,b){(!this.CLASS||"ColVis"!=this.CLASS)&&alert("Warning: ColVis must be initialised with the keyword 'new'");"undefined"==typeof b&&(b={});var c=d.fn.dataTable.camelToHungarian;c&&(c(e.defaults,e.defaults,!0),c(e.defaults,b));this.s={dt:null,oInit:b,hidden:!0,abOriginal:[]};this.dom={wrapper:null,button:null,collection:null,background:null,catcher:null,buttons:[],groupButtons:[],restore:null};e.aInstances.push(this);this.s.dt=d.fn.dataTable.Api?(new d.fn.dataTable.Api(a)).settings()[0]:
|
||||||
|
a;this._fnConstruct(b);return this};e.prototype={button:function(){return this.dom.wrapper},fnRebuild:function(){this.rebuild()},rebuild:function(){for(var a=this.dom.buttons.length-1;0<=a;a--)this.dom.collection.removeChild(this.dom.buttons[a]);this.dom.buttons.splice(0,this.dom.buttons.length);this.dom.groupButtons.splice(0,this.dom.groupButtons.length);this.dom.restore&&this.dom.restore.parentNode(this.dom.restore);this._fnAddGroups();this._fnAddButtons();this._fnDrawCallback()},_fnConstruct:function(a){this._fnApplyCustomisation(a);
|
||||||
|
var b=this,c,f;this.dom.wrapper=i.createElement("div");this.dom.wrapper.className="ColVis";this.dom.button=d("<button />",{"class":!this.s.dt.bJUI?"ColVis_Button ColVis_MasterButton":"ColVis_Button ColVis_MasterButton ui-button ui-state-default"}).append("<span>"+this.s.buttonText+"</span>").bind("mouseover"==this.s.activate?"mouseover":"click",function(a){a.preventDefault();b._fnCollectionShow()}).appendTo(this.dom.wrapper)[0];this.dom.catcher=this._fnDomCatcher();this.dom.collection=this._fnDomCollection();
|
||||||
|
this.dom.background=this._fnDomBackground();this._fnAddGroups();this._fnAddButtons();c=0;for(f=this.s.dt.aoColumns.length;c<f;c++)this.s.abOriginal.push(this.s.dt.aoColumns[c].bVisible);this.s.dt.aoDrawCallback.push({fn:function(){b._fnDrawCallback.call(b)},sName:"ColVis"});d(this.s.dt.oInstance).bind("column-reorder.dt",function(a,d,e){c=0;for(f=b.s.aiExclude.length;c<f;c++)b.s.aiExclude[c]=e.aiInvertMapping[b.s.aiExclude[c]];a=b.s.abOriginal.splice(e.iFrom,1)[0];b.s.abOriginal.splice(e.iTo,0,a);
|
||||||
|
b.fnRebuild()});d(this.s.dt.oInstance).bind("destroy.dt",function(){d(b.dom.wrapper).remove()});this._fnDrawCallback()},_fnApplyCustomisation:function(a){d.extend(!0,this.s,e.defaults,a);!this.s.showAll&&this.s.bShowAll&&(this.s.showAll=this.s.sShowAll);!this.s.restore&&this.s.bRestore&&(this.s.restore=this.s.sRestore);var a=this.s.groups,b=this.s.aoGroups;if(a)for(var c=0,f=a.length;c<f;c++)if(a[c].title&&(b[c].sTitle=a[c].title),a[c].columns)b[c].aiColumns=a[c].columns},_fnDrawCallback:function(){for(var a=
|
||||||
|
this.s.dt.aoColumns,b=this.dom.buttons,c=this.s.aoGroups,f,g=0,h=b.length;g<h;g++)f=b[g],f.__columnIdx!==k&&d("input",f).prop("checked",a[f.__columnIdx].bVisible);b=0;for(f=c.length;b<f;b++){a:{for(var g=c[b].aiColumns,h=0,e=g.length;h<e;h++)if(!1===a[g[h]].bVisible){g=!1;break a}g=!0}if(g)d("input",this.dom.groupButtons[b]).prop("checked",!0),d("input",this.dom.groupButtons[b]).prop("indeterminate",!1);else{a:{g=c[b].aiColumns;h=0;for(e=g.length;h<e;h++)if(!0===a[g[h]].bVisible){g=!1;break a}g=!0}g?
|
||||||
|
(d("input",this.dom.groupButtons[b]).prop("checked",!1),d("input",this.dom.groupButtons[b]).prop("indeterminate",!1)):d("input",this.dom.groupButtons[b]).prop("indeterminate",!0)}}},_fnAddGroups:function(){var a;if("undefined"!=typeof this.s.aoGroups)for(var b=0,c=this.s.aoGroups.length;b<c;b++)a=this._fnDomGroupButton(b),this.dom.groupButtons.push(a),this.dom.buttons.push(a),this.dom.collection.appendChild(a)},_fnAddButtons:function(){var a,b=this.s.dt.aoColumns;if(-1===d.inArray("all",this.s.aiExclude))for(var c=
|
||||||
|
0,f=b.length;c<f;c++)-1===d.inArray(c,this.s.aiExclude)&&(a=this._fnDomColumnButton(c),a.__columnIdx=c,this.dom.buttons.push(a));"alpha"===this.s.order&&this.dom.buttons.sort(function(a,c){var d=b[a.__columnIdx].sTitle,f=b[c.__columnIdx].sTitle;return d===f?0:d<f?-1:1});this.s.restore&&(a=this._fnDomRestoreButton(),a.className+=" ColVis_Restore",this.dom.buttons.push(a));this.s.showAll&&(a=this._fnDomShowXButton(this.s.showAll,!0),a.className+=" ColVis_ShowAll",this.dom.buttons.push(a));this.s.showNone&&
|
||||||
|
(a=this._fnDomShowXButton(this.s.showNone,!1),a.className+=" ColVis_ShowNone",this.dom.buttons.push(a));d(this.dom.collection).append(this.dom.buttons)},_fnDomRestoreButton:function(){var a=this;return d('<li class="ColVis_Special '+(this.s.dt.bJUI?"ui-button ui-state-default":"")+'">'+this.s.restore+"</li>").click(function(){for(var b=0,c=a.s.abOriginal.length;b<c;b++)a.s.dt.oInstance.fnSetColumnVis(b,a.s.abOriginal[b],!1);a._fnAdjustOpenRows();a.s.dt.oInstance.fnAdjustColumnSizing(!1);a.s.dt.oInstance.fnDraw(!1)})[0]},
|
||||||
|
_fnDomShowXButton:function(a,b){var c=this;return d('<li class="ColVis_Special '+(this.s.dt.bJUI?"ui-button ui-state-default":"")+'">'+a+"</li>").click(function(){for(var a=0,d=c.s.abOriginal.length;a<d;a++)-1===c.s.aiExclude.indexOf(a)&&c.s.dt.oInstance.fnSetColumnVis(a,b,!1);c._fnAdjustOpenRows();c.s.dt.oInstance.fnAdjustColumnSizing(!1);c.s.dt.oInstance.fnDraw(!1)})[0]},_fnDomGroupButton:function(a){var b=this,c=this.s.aoGroups[a];return d('<li class="ColVis_Special '+(this.s.dt.bJUI?"ui-button ui-state-default":
|
||||||
|
"")+'"><label><input type="checkbox" /><span>'+c.sTitle+"</span></label></li>").click(function(a){var g=!d("input",this).is(":checked");"li"!==a.target.nodeName.toLowerCase()&&(g=!g);for(a=0;a<c.aiColumns.length;a++)b.s.dt.oInstance.fnSetColumnVis(c.aiColumns[a],g)})[0]},_fnDomColumnButton:function(a){var b=this,c=this.s.dt.aoColumns[a],f=this.s.dt,c=null===this.s.fnLabel?c.sTitle:this.s.fnLabel(a,c.sTitle,c.nTh);return d("<li "+(f.bJUI?'class="ui-button ui-state-default"':"")+'><label><input type="checkbox" /><span>'+
|
||||||
|
c+"</span></label></li>").click(function(c){var e=!d("input",this).is(":checked");if("li"!==c.target.nodeName.toLowerCase()&&("input"==c.target.nodeName.toLowerCase()||null===b.s.fnStateChange))e=!e;var i=d.fn.dataTableExt.iApiIndex;d.fn.dataTableExt.iApiIndex=b._fnDataTablesApiIndex.call(b);f.oFeatures.bServerSide?(b.s.dt.oInstance.fnSetColumnVis(a,e,!1),b.s.dt.oInstance.fnAdjustColumnSizing(!1),(""!==f.oScroll.sX||""!==f.oScroll.sY)&&b.s.dt.oInstance.oApi._fnScrollDraw(b.s.dt),b._fnDrawCallback()):
|
||||||
|
b.s.dt.oInstance.fnSetColumnVis(a,e);d.fn.dataTableExt.iApiIndex=i;null!==b.s.fnStateChange&&("span"==c.target.nodeName.toLowerCase()&&c.preventDefault(),b.s.fnStateChange.call(b,a,e))})[0]},_fnDataTablesApiIndex:function(){for(var a=0,b=this.s.dt.oInstance.length;a<b;a++)if(this.s.dt.oInstance[a]==this.s.dt.nTable)return a;return 0},_fnDomCollection:function(){return d("<ul />",{"class":!this.s.dt.bJUI?"ColVis_collection":"ColVis_collection ui-buttonset ui-buttonset-multi"}).css({display:"none",
|
||||||
|
opacity:0,position:!this.s.bCssPosition?"absolute":""})[0]},_fnDomCatcher:function(){var a=this,b=i.createElement("div");b.className="ColVis_catcher";d(b).click(function(){a._fnCollectionHide.call(a,null,null)});return b},_fnDomBackground:function(){var a=this,b=d("<div></div>").addClass("ColVis_collectionBackground").css("opacity",0).click(function(){a._fnCollectionHide.call(a,null,null)});"mouseover"==this.s.activate&&b.mouseover(function(){a.s.overcollection=!1;a._fnCollectionHide.call(a,null,
|
||||||
|
null)});return b[0]},_fnCollectionShow:function(){var a=this,b;b=d(this.dom.button).offset();var c=this.dom.collection,f=this.dom.background,e=parseInt(b.left,10),h=parseInt(b.top+d(this.dom.button).outerHeight(),10);this.s.bCssPosition||(c.style.top=h+"px",c.style.left=e+"px");d(c).css({display:"block",opacity:0});f.style.bottom="0px";f.style.right="0px";h=this.dom.catcher.style;h.height=d(this.dom.button).outerHeight()+"px";h.width=d(this.dom.button).outerWidth()+"px";h.top=b.top+"px";h.left=e+
|
||||||
|
"px";i.body.appendChild(f);i.body.appendChild(c);i.body.appendChild(this.dom.catcher);d(c).animate({opacity:1},a.s.iOverlayFade);d(f).animate({opacity:0.1},a.s.iOverlayFade,"linear",function(){d.browser&&(d.browser.msie&&d.browser.version=="6.0")&&a._fnDrawCallback()});this.s.bCssPosition||(b="left"==this.s.sAlign?e:e-d(c).outerWidth()+d(this.dom.button).outerWidth(),c.style.left=b+"px",f=d(c).outerWidth(),d(c).outerHeight(),e=d(i).width(),b+f>e&&(c.style.left=e-f+"px"));this.s.hidden=!1},_fnCollectionHide:function(){var a=
|
||||||
|
this;!this.s.hidden&&null!==this.dom.collection&&(this.s.hidden=!0,d(this.dom.collection).animate({opacity:0},a.s.iOverlayFade,function(){this.style.display="none"}),d(this.dom.background).animate({opacity:0},a.s.iOverlayFade,function(){i.body.removeChild(a.dom.background);i.body.removeChild(a.dom.catcher)}))},_fnAdjustOpenRows:function(){for(var a=this.s.dt.aoOpenRows,b=this.s.dt.oApi._fnVisbleColumns(this.s.dt),c=0,d=a.length;c<d;c++)a[c].nTr.getElementsByTagName("td")[0].colSpan=b}};e.fnRebuild=
|
||||||
|
function(a){var b=null;"undefined"!=typeof a&&(b=d.fn.dataTable.Api?(new d.fn.dataTable.Api(a)).table().node():a.fnSettings().nTable);for(var c=0,f=e.aInstances.length;c<f;c++)("undefined"==typeof a||b==e.aInstances[c].s.dt.nTable)&&e.aInstances[c].fnRebuild()};e.defaults={active:"click",buttonText:"Show / hide columns",aiExclude:[],bRestore:!1,sRestore:"Restore original",bShowAll:!1,sShowAll:"Show All",sAlign:"left",fnStateChange:null,iOverlayFade:500,fnLabel:null,bCssPosition:!1,aoGroups:[],order:"column"};
|
||||||
|
e.aInstances=[];e.prototype.CLASS="ColVis";e.VERSION="1.1.2";e.prototype.VERSION=e.VERSION;"function"==typeof d.fn.dataTable&&"function"==typeof d.fn.dataTableExt.fnVersionCheck&&d.fn.dataTableExt.fnVersionCheck("1.7.0")?d.fn.dataTableExt.aoFeatures.push({fnInit:function(a){var b=a.oInit;return(new e(a,b.colVis||b.oColVis||{})).button()},cFeature:"C",sFeature:"ColVis"}):alert("Warning: ColVis requires DataTables 1.7 or greater - www.datatables.net/download");d.fn.dataTable.ColVis=e;return d.fn.DataTable.ColVis=
|
||||||
|
e};"function"===typeof define&&define.amd?define(["jquery","datatables"],j):"object"===typeof exports?j(require("jquery"),require("datatables")):jQuery&&!jQuery.fn.dataTable.ColVis&&j(jQuery,jQuery.fn.dataTable)})(window,document);
|
||||||
@ -0,0 +1,25 @@
|
|||||||
|
|
||||||
|
|
||||||
|
/* Block out what is behind the fixed column's header and footer */
|
||||||
|
table.DTFC_Cloned thead,
|
||||||
|
table.DTFC_Cloned tfoot {
|
||||||
|
background-color: white;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* Block out the gap above the scrollbar on the right, when there is a fixed
|
||||||
|
* right column
|
||||||
|
*/
|
||||||
|
div.DTFC_Blocker {
|
||||||
|
background-color: white;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.DTFC_LeftWrapper table.dataTable,
|
||||||
|
div.DTFC_RightWrapper table.dataTable {
|
||||||
|
margin-bottom: 0;
|
||||||
|
z-index: 2;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.DTFC_LeftWrapper table.dataTable.no-footer,
|
||||||
|
div.DTFC_RightWrapper table.dataTable.no-footer {
|
||||||
|
border-bottom: none;
|
||||||
|
}
|
||||||
@ -0,0 +1 @@
|
|||||||
|
table.DTFC_Cloned thead,table.DTFC_Cloned tfoot{background-color:white}div.DTFC_Blocker{background-color:white}div.DTFC_LeftWrapper table.dataTable,div.DTFC_RightWrapper table.dataTable{margin-bottom:0;z-index:2}div.DTFC_LeftWrapper table.dataTable.no-footer,div.DTFC_RightWrapper table.dataTable.no-footer{border-bottom:none}
|
||||||
@ -0,0 +1,30 @@
|
|||||||
|
/*!
|
||||||
|
FixedColumns 3.0.4
|
||||||
|
©2010-2014 SpryMedia Ltd - datatables.net/license
|
||||||
|
*/
|
||||||
|
(function(r,s,t){var p=function(d){var j=function(a,b){var c=this;if(this instanceof j){"undefined"==typeof b&&(b={});var g=d.fn.dataTable.camelToHungarian;g&&(g(j.defaults,j.defaults,!0),g(j.defaults,b));g=d.fn.dataTable.Api?(new d.fn.dataTable.Api(a)).settings()[0]:a.fnSettings();this.s={dt:g,iTableColumns:g.aoColumns.length,aiOuterWidths:[],aiInnerWidths:[]};this.dom={scroller:null,header:null,body:null,footer:null,grid:{wrapper:null,dt:null,left:{wrapper:null,head:null,body:null,foot:null},right:{wrapper:null,
|
||||||
|
head:null,body:null,foot:null}},clone:{left:{header:null,body:null,footer:null},right:{header:null,body:null,footer:null}}};g._oFixedColumns=this;g._bInitComplete?this._fnConstruct(b):g.oApi._fnCallbackReg(g,"aoInitComplete",function(){c._fnConstruct(b)},"FixedColumns")}else alert("FixedColumns warning: FixedColumns must be initialised with the 'new' keyword.")};j.prototype={fnUpdate:function(){this._fnDraw(!0)},fnRedrawLayout:function(){this._fnColCalc();this._fnGridLayout();this.fnUpdate()},fnRecalculateHeight:function(a){delete a._DTTC_iHeight;
|
||||||
|
a.style.height="auto"},fnSetRowHeight:function(a,b){a.style.height=b+"px"},fnGetPosition:function(a){var b=this.s.dt.oInstance;if(d(a).parents(".DTFC_Cloned").length){if("tr"===a.nodeName.toLowerCase())return a=d(a).index(),b.fnGetPosition(d("tr",this.s.dt.nTBody)[a]);var c=d(a).index(),a=d(a.parentNode).index();return[b.fnGetPosition(d("tr",this.s.dt.nTBody)[a]),c,b.oApi._fnVisibleToColumnIndex(this.s.dt,c)]}return b.fnGetPosition(a)},_fnConstruct:function(a){var b=this;if("function"!=typeof this.s.dt.oInstance.fnVersionCheck||
|
||||||
|
!0!==this.s.dt.oInstance.fnVersionCheck("1.8.0"))alert("FixedColumns "+j.VERSION+" required DataTables 1.8.0 or later. Please upgrade your DataTables installation");else if(""===this.s.dt.oScroll.sX)this.s.dt.oInstance.oApi._fnLog(this.s.dt,1,"FixedColumns is not needed (no x-scrolling in DataTables enabled), so no action will be taken. Use 'FixedHeader' for column fixing when scrolling is not enabled");else{this.s=d.extend(!0,this.s,j.defaults,a);a=this.s.dt.oClasses;this.dom.grid.dt=d(this.s.dt.nTable).parents("div."+
|
||||||
|
a.sScrollWrapper)[0];this.dom.scroller=d("div."+a.sScrollBody,this.dom.grid.dt)[0];this._fnColCalc();this._fnGridSetup();var c;d(this.dom.scroller).on("mouseover.DTFC touchstart.DTFC",function(){c="main"}).on("scroll.DTFC",function(){if("main"===c&&(0<b.s.iLeftColumns&&(b.dom.grid.left.liner.scrollTop=b.dom.scroller.scrollTop),0<b.s.iRightColumns))b.dom.grid.right.liner.scrollTop=b.dom.scroller.scrollTop});var g="onwheel"in s.createElement("div")?"wheel.DTFC":"mousewheel.DTFC";if(0<b.s.iLeftColumns)d(b.dom.grid.left.liner).on("mouseover.DTFC touchstart.DTFC",
|
||||||
|
function(){c="left"}).on("scroll.DTFC",function(){"left"===c&&(b.dom.scroller.scrollTop=b.dom.grid.left.liner.scrollTop,0<b.s.iRightColumns&&(b.dom.grid.right.liner.scrollTop=b.dom.grid.left.liner.scrollTop))}).on(g,function(a){b.dom.scroller.scrollLeft-="wheel"===a.type?-a.originalEvent.deltaX:a.originalEvent.wheelDeltaX});if(0<b.s.iRightColumns)d(b.dom.grid.right.liner).on("mouseover.DTFC touchstart.DTFC",function(){c="right"}).on("scroll.DTFC",function(){"right"===c&&(b.dom.scroller.scrollTop=
|
||||||
|
b.dom.grid.right.liner.scrollTop,0<b.s.iLeftColumns&&(b.dom.grid.left.liner.scrollTop=b.dom.grid.right.liner.scrollTop))}).on(g,function(a){b.dom.scroller.scrollLeft-="wheel"===a.type?-a.originalEvent.deltaX:a.originalEvent.wheelDeltaX});d(r).on("resize.DTFC",function(){b._fnGridLayout.call(b)});var f=!0,e=d(this.s.dt.nTable);e.on("draw.dt.DTFC",function(){b._fnDraw.call(b,f);f=!1}).on("column-sizing.dt.DTFC",function(){b._fnColCalc();b._fnGridLayout(b)}).on("column-visibility.dt.DTFC",function(){b._fnColCalc();
|
||||||
|
b._fnGridLayout(b);b._fnDraw(!0)}).on("destroy.dt.DTFC",function(){e.off("column-sizing.dt.DTFC destroy.dt.DTFC draw.dt.DTFC");d(b.dom.scroller).off("scroll.DTFC mouseover.DTFC");d(r).off("resize.DTFC");d(b.dom.grid.left.liner).off("scroll.DTFC mouseover.DTFC "+g);d(b.dom.grid.left.wrapper).remove();d(b.dom.grid.right.liner).off("scroll.DTFC mouseover.DTFC "+g);d(b.dom.grid.right.wrapper).remove()});this._fnGridLayout();this.s.dt.oInstance.fnDraw(!1)}},_fnColCalc:function(){var a=this,b=0,c=0;this.s.aiInnerWidths=
|
||||||
|
[];this.s.aiOuterWidths=[];d.each(this.s.dt.aoColumns,function(g,f){var e=d(f.nTh),h;if(e.filter(":visible").length){var i=e.outerWidth();0===a.s.aiOuterWidths.length&&(h=d(a.s.dt.nTable).css("border-left-width"),i+="string"===typeof h?1:parseInt(h,10));a.s.aiOuterWidths.length===a.s.dt.aoColumns.length-1&&(h=d(a.s.dt.nTable).css("border-right-width"),i+="string"===typeof h?1:parseInt(h,10));a.s.aiOuterWidths.push(i);a.s.aiInnerWidths.push(e.width());g<a.s.iLeftColumns&&(b+=i);a.s.iTableColumns-a.s.iRightColumns<=
|
||||||
|
g&&(c+=i)}else a.s.aiInnerWidths.push(0),a.s.aiOuterWidths.push(0)});this.s.iLeftWidth=b;this.s.iRightWidth=c},_fnGridSetup:function(){var a=this._fnDTOverflow(),b;this.dom.body=this.s.dt.nTable;this.dom.header=this.s.dt.nTHead.parentNode;this.dom.header.parentNode.parentNode.style.position="relative";var c=d('<div class="DTFC_ScrollWrapper" style="position:relative; clear:both;"><div class="DTFC_LeftWrapper" style="position:absolute; top:0; left:0;"><div class="DTFC_LeftHeadWrapper" style="position:relative; top:0; left:0; overflow:hidden;"></div><div class="DTFC_LeftBodyWrapper" style="position:relative; top:0; left:0; overflow:hidden;"><div class="DTFC_LeftBodyLiner" style="position:relative; top:0; left:0; overflow-y:scroll;"></div></div><div class="DTFC_LeftFootWrapper" style="position:relative; top:0; left:0; overflow:hidden;"></div></div><div class="DTFC_RightWrapper" style="position:absolute; top:0; left:0;"><div class="DTFC_RightHeadWrapper" style="position:relative; top:0; left:0;"><div class="DTFC_RightHeadBlocker DTFC_Blocker" style="position:absolute; top:0; bottom:0;"></div></div><div class="DTFC_RightBodyWrapper" style="position:relative; top:0; left:0; overflow:hidden;"><div class="DTFC_RightBodyLiner" style="position:relative; top:0; left:0; overflow-y:scroll;"></div></div><div class="DTFC_RightFootWrapper" style="position:relative; top:0; left:0;"><div class="DTFC_RightFootBlocker DTFC_Blocker" style="position:absolute; top:0; bottom:0;"></div></div></div></div>')[0],
|
||||||
|
g=c.childNodes[0],f=c.childNodes[1];this.dom.grid.dt.parentNode.insertBefore(c,this.dom.grid.dt);c.appendChild(this.dom.grid.dt);this.dom.grid.wrapper=c;0<this.s.iLeftColumns&&(this.dom.grid.left.wrapper=g,this.dom.grid.left.head=g.childNodes[0],this.dom.grid.left.body=g.childNodes[1],this.dom.grid.left.liner=d("div.DTFC_LeftBodyLiner",c)[0],c.appendChild(g));0<this.s.iRightColumns&&(this.dom.grid.right.wrapper=f,this.dom.grid.right.head=f.childNodes[0],this.dom.grid.right.body=f.childNodes[1],this.dom.grid.right.liner=
|
||||||
|
d("div.DTFC_RightBodyLiner",c)[0],b=d("div.DTFC_RightHeadBlocker",c)[0],b.style.width=a.bar+"px",b.style.right=-a.bar+"px",this.dom.grid.right.headBlock=b,b=d("div.DTFC_RightFootBlocker",c)[0],b.style.width=a.bar+"px",b.style.right=-a.bar+"px",this.dom.grid.right.footBlock=b,c.appendChild(f));if(this.s.dt.nTFoot&&(this.dom.footer=this.s.dt.nTFoot.parentNode,0<this.s.iLeftColumns&&(this.dom.grid.left.foot=g.childNodes[2]),0<this.s.iRightColumns))this.dom.grid.right.foot=f.childNodes[2]},_fnGridLayout:function(){var a=
|
||||||
|
this.dom.grid,b=d(a.wrapper).width(),c=d(this.s.dt.nTable.parentNode).outerHeight(),g=d(this.s.dt.nTable.parentNode.parentNode).outerHeight(),f=this._fnDTOverflow(),e=this.s.iLeftWidth,h=this.s.iRightWidth,i=function(a,b){f.bar?a.style.width=b+f.bar+"px":(a.style.width=b+20+"px",a.style.paddingRight="20px",a.style.boxSizing="border-box")};f.x&&(c-=f.bar);a.wrapper.style.height=g+"px";0<this.s.iLeftColumns&&(a.left.wrapper.style.width=e+"px",a.left.wrapper.style.height="1px",a.left.body.style.height=
|
||||||
|
c+"px",a.left.foot&&(a.left.foot.style.top=(f.x?f.bar:0)+"px"),i(a.left.liner,e),a.left.liner.style.height=c+"px");0<this.s.iRightColumns&&(b-=h,f.y&&(b-=f.bar),a.right.wrapper.style.width=h+"px",a.right.wrapper.style.left=b+"px",a.right.wrapper.style.height="1px",a.right.body.style.height=c+"px",a.right.foot&&(a.right.foot.style.top=(f.x?f.bar:0)+"px"),i(a.right.liner,h),a.right.liner.style.height=c+"px",a.right.headBlock.style.display=f.y?"block":"none",a.right.footBlock.style.display=f.y?"block":
|
||||||
|
"none")},_fnDTOverflow:function(){var a=this.s.dt.nTable,b=a.parentNode,c={x:!1,y:!1,bar:this.s.dt.oScroll.iBarWidth};a.offsetWidth>b.clientWidth&&(c.x=!0);a.offsetHeight>b.clientHeight&&(c.y=!0);return c},_fnDraw:function(a){this._fnGridLayout();this._fnCloneLeft(a);this._fnCloneRight(a);null!==this.s.fnDrawCallback&&this.s.fnDrawCallback.call(this,this.dom.clone.left,this.dom.clone.right);d(this).trigger("draw.dtfc",{leftClone:this.dom.clone.left,rightClone:this.dom.clone.right})},_fnCloneRight:function(a){if(!(0>=
|
||||||
|
this.s.iRightColumns)){var b,c=[];for(b=this.s.iTableColumns-this.s.iRightColumns;b<this.s.iTableColumns;b++)this.s.dt.aoColumns[b].bVisible&&c.push(b);this._fnClone(this.dom.clone.right,this.dom.grid.right,c,a)}},_fnCloneLeft:function(a){if(!(0>=this.s.iLeftColumns)){var b,c=[];for(b=0;b<this.s.iLeftColumns;b++)this.s.dt.aoColumns[b].bVisible&&c.push(b);this._fnClone(this.dom.clone.left,this.dom.grid.left,c,a)}},_fnCopyLayout:function(a,b){for(var c=[],g=[],f=[],e=0,h=a.length;e<h;e++){var i=[];
|
||||||
|
i.nTr=d(a[e].nTr).clone(!0,!0)[0];for(var k=0,j=this.s.iTableColumns;k<j;k++)if(-1!==d.inArray(k,b)){var m=d.inArray(a[e][k].cell,f);-1===m?(m=d(a[e][k].cell).clone(!0,!0)[0],g.push(m),f.push(a[e][k].cell),i.push({cell:m,unique:a[e][k].unique})):i.push({cell:g[m],unique:a[e][k].unique})}c.push(i)}return c},_fnClone:function(a,b,c,g){var f=this,e,h,i,k,j,m,o,n,q,l=this.s.dt;if(g){null!==a.header&&a.header.parentNode.removeChild(a.header);a.header=d(this.dom.header).clone(!0,!0)[0];a.header.className+=
|
||||||
|
" DTFC_Cloned";a.header.style.width="100%";b.head.appendChild(a.header);n=this._fnCopyLayout(l.aoHeader,c);k=d(">thead",a.header);k.empty();e=0;for(h=n.length;e<h;e++)k[0].appendChild(n[e].nTr);l.oApi._fnDrawHead(l,n,!0)}else{n=this._fnCopyLayout(l.aoHeader,c);q=[];l.oApi._fnDetectHeader(q,d(">thead",a.header)[0]);e=0;for(h=n.length;e<h;e++){i=0;for(k=n[e].length;i<k;i++)q[e][i].cell.className=n[e][i].cell.className,d("span.DataTables_sort_icon",q[e][i].cell).each(function(){this.className=d("span.DataTables_sort_icon",
|
||||||
|
n[e][i].cell)[0].className})}}this._fnEqualiseHeights("thead",this.dom.header,a.header);"auto"==this.s.sHeightMatch&&d(">tbody>tr",f.dom.body).css("height","auto");null!==a.body&&(a.body.parentNode.removeChild(a.body),a.body=null);a.body=d(this.dom.body).clone(!0)[0];a.body.className+=" DTFC_Cloned";a.body.style.paddingBottom=l.oScroll.iBarWidth+"px";a.body.style.marginBottom=2*l.oScroll.iBarWidth+"px";null!==a.body.getAttribute("id")&&a.body.removeAttribute("id");d(">thead>tr",a.body).empty();d(">tfoot",
|
||||||
|
a.body).remove();var p=d("tbody",a.body)[0];d(p).empty();if(0<l.aiDisplay.length){h=d(">thead>tr",a.body)[0];for(o=0;o<c.length;o++)j=c[o],m=d(l.aoColumns[j].nTh).clone(!0)[0],m.innerHTML="",k=m.style,k.paddingTop="0",k.paddingBottom="0",k.borderTopWidth="0",k.borderBottomWidth="0",k.height=0,k.width=f.s.aiInnerWidths[j]+"px",h.appendChild(m);d(">tbody>tr",f.dom.body).each(function(a){var b=this.cloneNode(false);b.removeAttribute("id");a=f.s.dt.aoData[f.s.dt.oFeatures.bServerSide===false?f.s.dt.aiDisplay[f.s.dt._iDisplayStart+
|
||||||
|
a]:a].anCells||d(this).children("td, th");for(o=0;o<c.length;o++){j=c[o];if(a.length>0){m=d(a[j]).clone(true,true)[0];b.appendChild(m)}}p.appendChild(b)})}else d(">tbody>tr",f.dom.body).each(function(){m=this.cloneNode(true);m.className=m.className+" DTFC_NoData";d("td",m).html("");p.appendChild(m)});a.body.style.width="100%";a.body.style.margin="0";a.body.style.padding="0";l.oScroller!==t&&(h=l.oScroller.dom.force,b.forcer?b.forcer.style.height=h.style.height:(b.forcer=h.cloneNode(!0),b.liner.appendChild(b.forcer)));
|
||||||
|
b.liner.appendChild(a.body);this._fnEqualiseHeights("tbody",f.dom.body,a.body);if(null!==l.nTFoot){if(g){null!==a.footer&&a.footer.parentNode.removeChild(a.footer);a.footer=d(this.dom.footer).clone(!0,!0)[0];a.footer.className+=" DTFC_Cloned";a.footer.style.width="100%";b.foot.appendChild(a.footer);n=this._fnCopyLayout(l.aoFooter,c);b=d(">tfoot",a.footer);b.empty();e=0;for(h=n.length;e<h;e++)b[0].appendChild(n[e].nTr);l.oApi._fnDrawHead(l,n,!0)}else{n=this._fnCopyLayout(l.aoFooter,c);b=[];l.oApi._fnDetectHeader(b,
|
||||||
|
d(">tfoot",a.footer)[0]);e=0;for(h=n.length;e<h;e++){i=0;for(k=n[e].length;i<k;i++)b[e][i].cell.className=n[e][i].cell.className}}this._fnEqualiseHeights("tfoot",this.dom.footer,a.footer)}b=l.oApi._fnGetUniqueThs(l,d(">thead",a.header)[0]);d(b).each(function(a){j=c[a];this.style.width=f.s.aiInnerWidths[j]+"px"});null!==f.s.dt.nTFoot&&(b=l.oApi._fnGetUniqueThs(l,d(">tfoot",a.footer)[0]),d(b).each(function(a){j=c[a];this.style.width=f.s.aiInnerWidths[j]+"px"}))},_fnGetTrNodes:function(a){for(var b=
|
||||||
|
[],c=0,d=a.childNodes.length;c<d;c++)"TR"==a.childNodes[c].nodeName.toUpperCase()&&b.push(a.childNodes[c]);return b},_fnEqualiseHeights:function(a,b,c){if(!("none"==this.s.sHeightMatch&&"thead"!==a&&"tfoot"!==a)){var g,f,e=b.getElementsByTagName(a)[0],c=c.getElementsByTagName(a)[0],a=d(">"+a+">tr:eq(0)",b).children(":first");a.outerHeight();a.height();for(var e=this._fnGetTrNodes(e),b=this._fnGetTrNodes(c),h=[],c=0,a=b.length;c<a;c++)g=e[c].offsetHeight,f=b[c].offsetHeight,g=f>g?f:g,"semiauto"==this.s.sHeightMatch&&
|
||||||
|
(e[c]._DTTC_iHeight=g),h.push(g);c=0;for(a=b.length;c<a;c++)b[c].style.height=h[c]+"px",e[c].style.height=h[c]+"px"}}};j.defaults={iLeftColumns:1,iRightColumns:0,fnDrawCallback:null,sHeightMatch:"semiauto"};j.version="3.0.4";d.fn.dataTable.FixedColumns=j;return d.fn.DataTable.FixedColumns=j};"function"===typeof define&&define.amd?define(["jquery","datatables"],p):"object"===typeof exports?p(require("jquery"),require("datatables")):jQuery&&!jQuery.fn.dataTable.FixedColumns&&p(jQuery,jQuery.fn.dataTable)})(window,
|
||||||
|
document);
|
||||||
@ -0,0 +1,7 @@
|
|||||||
|
|
||||||
|
|
||||||
|
div.FixedHeader_Cloned th,
|
||||||
|
div.FixedHeader_Cloned td {
|
||||||
|
background-color: white !important;
|
||||||
|
}
|
||||||
|
|
||||||
@ -0,0 +1 @@
|
|||||||
|
div.FixedHeader_Cloned th,div.FixedHeader_Cloned td{background-color:white !important}
|
||||||
@ -0,0 +1,30 @@
|
|||||||
|
/*!
|
||||||
|
FixedHeader 2.1.2
|
||||||
|
©2010-2014 SpryMedia Ltd - datatables.net/license
|
||||||
|
*/
|
||||||
|
var FixedHeader;
|
||||||
|
(function(j,k,h){var l=function(e){FixedHeader=function(a,b){if(!this instanceof FixedHeader)alert("FixedHeader warning: FixedHeader must be initialised with the 'new' keyword.");else{var c={aoCache:[],oSides:{top:!0,bottom:!1,left:0,right:0},oZIndexes:{top:104,bottom:103,left:102,right:101},oCloneOnDraw:{top:!1,bottom:!1,left:!0,right:!0},oMes:{iTableWidth:0,iTableHeight:0,iTableLeft:0,iTableRight:0,iTableTop:0,iTableBottom:0},oOffset:{top:0},nTable:null,bFooter:!1,bInitComplete:!1};this.fnGetSettings=
|
||||||
|
function(){return c};this.fnUpdate=function(){this._fnUpdateClones();this._fnUpdatePositions()};this.fnPosition=function(){this._fnUpdatePositions()};var d=e.fn.dataTable.Api?(new e.fn.dataTable.Api(a)).settings()[0]:a.fnSettings();d._oPluginFixedHeader=this;this.fnInit(d,b)}};FixedHeader.prototype={fnInit:function(a,b){var c=this.fnGetSettings(),d=this;this.fnInitSettings(c,b);""!==a.oScroll.sX||""!==a.oScroll.sY?alert("FixedHeader 2 is not supported with DataTables' scrolling mode at this time"):
|
||||||
|
(c.nTable=a.nTable,a.aoDrawCallback.unshift({fn:function(){FixedHeader.fnMeasure();d._fnUpdateClones.call(d);d._fnUpdatePositions.call(d)},sName:"FixedHeader"}),c.bFooter=0<e(">tfoot",c.nTable).length?!0:!1,c.oSides.top&&c.aoCache.push(d._fnCloneTable("fixedHeader","FixedHeader_Header",d._fnCloneThead)),c.oSides.bottom&&c.aoCache.push(d._fnCloneTable("fixedFooter","FixedHeader_Footer",d._fnCloneTfoot)),c.oSides.left&&c.aoCache.push(d._fnCloneTable("fixedLeft","FixedHeader_Left",d._fnCloneTLeft,c.oSides.left)),
|
||||||
|
c.oSides.right&&c.aoCache.push(d._fnCloneTable("fixedRight","FixedHeader_Right",d._fnCloneTRight,c.oSides.right)),FixedHeader.afnScroll.push(function(){d._fnUpdatePositions.call(d)}),e(j).resize(function(){FixedHeader.fnMeasure();d._fnUpdateClones.call(d);d._fnUpdatePositions.call(d)}),e(c.nTable).on("column-reorder.dt",function(){FixedHeader.fnMeasure();d._fnUpdateClones(!0);d._fnUpdatePositions()}).on("column-visibility.dt",function(){FixedHeader.fnMeasure();d._fnUpdateClones(!0);d._fnUpdatePositions()}),
|
||||||
|
FixedHeader.fnMeasure(),d._fnUpdateClones(),d._fnUpdatePositions(),c.bInitComplete=!0)},fnInitSettings:function(a,b){if(b!==h&&(b.top!==h&&(a.oSides.top=b.top),b.bottom!==h&&(a.oSides.bottom=b.bottom),"boolean"==typeof b.left?a.oSides.left=b.left?1:0:b.left!==h&&(a.oSides.left=b.left),"boolean"==typeof b.right?a.oSides.right=b.right?1:0:b.right!==h&&(a.oSides.right=b.right),b.zTop!==h&&(a.oZIndexes.top=b.zTop),b.zBottom!==h&&(a.oZIndexes.bottom=b.zBottom),b.zLeft!==h&&(a.oZIndexes.left=b.zLeft),b.zRight!==
|
||||||
|
h&&(a.oZIndexes.right=b.zRight),b.offsetTop!==h&&(a.oOffset.top=b.offsetTop),b.alwaysCloneTop!==h&&(a.oCloneOnDraw.top=b.alwaysCloneTop),b.alwaysCloneBottom!==h&&(a.oCloneOnDraw.bottom=b.alwaysCloneBottom),b.alwaysCloneLeft!==h&&(a.oCloneOnDraw.left=b.alwaysCloneLeft),b.alwaysCloneRight!==h))a.oCloneOnDraw.right=b.alwaysCloneRight},_fnCloneTable:function(a,b,c,d){var f=this.fnGetSettings(),g;"absolute"!=e(f.nTable.parentNode).css("position")&&(f.nTable.parentNode.style.position="relative");g=f.nTable.cloneNode(!1);
|
||||||
|
g.removeAttribute("id");var i=k.createElement("div");i.style.position="absolute";i.style.top="0px";i.style.left="0px";i.className+=" FixedHeader_Cloned "+a+" "+b;"fixedHeader"==a&&(i.style.zIndex=f.oZIndexes.top);"fixedFooter"==a&&(i.style.zIndex=f.oZIndexes.bottom);"fixedLeft"==a?i.style.zIndex=f.oZIndexes.left:"fixedRight"==a&&(i.style.zIndex=f.oZIndexes.right);g.style.margin="0";i.appendChild(g);k.body.appendChild(i);return{nNode:g,nWrapper:i,sType:a,sPosition:"",sTop:"",sLeft:"",fnClone:c,iCells:d}},
|
||||||
|
_fnMeasure:function(){var a=this.fnGetSettings(),b=a.oMes,c=e(a.nTable),d=c.offset(),f=this._fnSumScroll(a.nTable.parentNode,"scrollTop");this._fnSumScroll(a.nTable.parentNode,"scrollLeft");b.iTableWidth=c.outerWidth();b.iTableHeight=c.outerHeight();b.iTableLeft=d.left+a.nTable.parentNode.scrollLeft;b.iTableTop=d.top+f;b.iTableRight=b.iTableLeft+b.iTableWidth;b.iTableRight=FixedHeader.oDoc.iWidth-b.iTableLeft-b.iTableWidth;b.iTableBottom=FixedHeader.oDoc.iHeight-b.iTableTop-b.iTableHeight},_fnSumScroll:function(a,
|
||||||
|
b){for(var c=a[b];(a=a.parentNode)&&!("HTML"==a.nodeName||"BODY"==a.nodeName);)c=a[b];return c},_fnUpdatePositions:function(){var a=this.fnGetSettings();this._fnMeasure();for(var b=0,c=a.aoCache.length;b<c;b++)"fixedHeader"==a.aoCache[b].sType?this._fnScrollFixedHeader(a.aoCache[b]):"fixedFooter"==a.aoCache[b].sType?this._fnScrollFixedFooter(a.aoCache[b]):"fixedLeft"==a.aoCache[b].sType?this._fnScrollHorizontalLeft(a.aoCache[b]):this._fnScrollHorizontalRight(a.aoCache[b])},_fnUpdateClones:function(a){var b=
|
||||||
|
this.fnGetSettings();a&&(b.bInitComplete=!1);for(var c=0,d=b.aoCache.length;c<d;c++)b.aoCache[c].fnClone.call(this,b.aoCache[c]);a&&(b.bInitComplete=!0)},_fnScrollHorizontalRight:function(a){var b=this.fnGetSettings().oMes,c=FixedHeader.oWin,d=FixedHeader.oDoc,f=a.nWrapper,g=e(f).outerWidth();c.iScrollRight<b.iTableRight?(this._fnUpdateCache(a,"sPosition","absolute","position",f.style),this._fnUpdateCache(a,"sTop",b.iTableTop+"px","top",f.style),this._fnUpdateCache(a,"sLeft",b.iTableLeft+b.iTableWidth-
|
||||||
|
g+"px","left",f.style)):b.iTableLeft<d.iWidth-c.iScrollRight-g?(this._fnUpdateCache(a,"sPosition","fixed","position",f.style),this._fnUpdateCache(a,"sTop",b.iTableTop-c.iScrollTop+"px","top",f.style),this._fnUpdateCache(a,"sLeft",c.iWidth-g+"px","left",f.style)):(this._fnUpdateCache(a,"sPosition","absolute","position",f.style),this._fnUpdateCache(a,"sTop",b.iTableTop+"px","top",f.style),this._fnUpdateCache(a,"sLeft",b.iTableLeft+"px","left",f.style))},_fnScrollHorizontalLeft:function(a){var b=this.fnGetSettings().oMes,
|
||||||
|
c=FixedHeader.oWin,d=a.nWrapper,f=e(d).outerWidth();c.iScrollLeft<b.iTableLeft?(this._fnUpdateCache(a,"sPosition","absolute","position",d.style),this._fnUpdateCache(a,"sTop",b.iTableTop+"px","top",d.style),this._fnUpdateCache(a,"sLeft",b.iTableLeft+"px","left",d.style)):c.iScrollLeft<b.iTableLeft+b.iTableWidth-f?(this._fnUpdateCache(a,"sPosition","fixed","position",d.style),this._fnUpdateCache(a,"sTop",b.iTableTop-c.iScrollTop+"px","top",d.style),this._fnUpdateCache(a,"sLeft","0px","left",d.style)):
|
||||||
|
(this._fnUpdateCache(a,"sPosition","absolute","position",d.style),this._fnUpdateCache(a,"sTop",b.iTableTop+"px","top",d.style),this._fnUpdateCache(a,"sLeft",b.iTableLeft+b.iTableWidth-f+"px","left",d.style))},_fnScrollFixedFooter:function(a){var b=this.fnGetSettings(),c=b.oMes,d=FixedHeader.oWin,f=a.nWrapper,b=e("thead",b.nTable).outerHeight(),g=e(f).outerHeight();d.iScrollBottom<c.iTableBottom?(this._fnUpdateCache(a,"sPosition","absolute","position",f.style),this._fnUpdateCache(a,"sTop",c.iTableTop+
|
||||||
|
c.iTableHeight-g+"px","top",f.style),this._fnUpdateCache(a,"sLeft",c.iTableLeft+"px","left",f.style)):d.iScrollBottom<c.iTableBottom+c.iTableHeight-g-b?(this._fnUpdateCache(a,"sPosition","fixed","position",f.style),this._fnUpdateCache(a,"sTop",d.iHeight-g+"px","top",f.style),this._fnUpdateCache(a,"sLeft",c.iTableLeft-d.iScrollLeft+"px","left",f.style)):(this._fnUpdateCache(a,"sPosition","absolute","position",f.style),this._fnUpdateCache(a,"sTop",c.iTableTop+g+"px","top",f.style),this._fnUpdateCache(a,
|
||||||
|
"sLeft",c.iTableLeft+"px","left",f.style))},_fnScrollFixedHeader:function(a){for(var b=this.fnGetSettings(),c=b.oMes,d=FixedHeader.oWin,e=a.nWrapper,g=0,i=b.nTable.getElementsByTagName("tbody"),h=0;h<i.length;++h)g+=i[h].offsetHeight;c.iTableTop>d.iScrollTop+b.oOffset.top?(this._fnUpdateCache(a,"sPosition","absolute","position",e.style),this._fnUpdateCache(a,"sTop",c.iTableTop+"px","top",e.style),this._fnUpdateCache(a,"sLeft",c.iTableLeft+"px","left",e.style)):d.iScrollTop+b.oOffset.top>c.iTableTop+
|
||||||
|
g?(this._fnUpdateCache(a,"sPosition","absolute","position",e.style),this._fnUpdateCache(a,"sTop",c.iTableTop+g+"px","top",e.style),this._fnUpdateCache(a,"sLeft",c.iTableLeft+"px","left",e.style)):(this._fnUpdateCache(a,"sPosition","fixed","position",e.style),this._fnUpdateCache(a,"sTop",b.oOffset.top+"px","top",e.style),this._fnUpdateCache(a,"sLeft",c.iTableLeft-d.iScrollLeft+"px","left",e.style))},_fnUpdateCache:function(a,b,c,d,e){a[b]!=c&&(e[d]=c,a[b]=c)},_fnClassUpdate:function(a,b){var c=this;
|
||||||
|
if("TR"===a.nodeName.toUpperCase()||"TH"===a.nodeName.toUpperCase()||"TD"===a.nodeName.toUpperCase()||"SPAN"===a.nodeName.toUpperCase())b.className=a.className;e(a).children().each(function(d){c._fnClassUpdate(e(a).children()[d],e(b).children()[d])})},_fnCloneThead:function(a){var b=this.fnGetSettings(),c=a.nNode;if(b.bInitComplete&&!b.oCloneOnDraw.top)this._fnClassUpdate(e("thead",b.nTable)[0],e("thead",c)[0]);else{var d=e(b.nTable).outerWidth();a.nWrapper.style.width=d+"px";for(c.style.width=d+
|
||||||
|
"px";0<c.childNodes.length;)e("thead th",c).unbind("click"),c.removeChild(c.childNodes[0]);a=e("thead",b.nTable).clone(!0)[0];c.appendChild(a);var f=[],g=[];e("thead>tr th",b.nTable).each(function(){f.push(e(this).width())});e("thead>tr td",b.nTable).each(function(){g.push(e(this).width())});e("thead>tr th",b.nTable).each(function(a){e("thead>tr th:eq("+a+")",c).width(f[a]);e(this).width(f[a])});e("thead>tr td",b.nTable).each(function(a){e("thead>tr td:eq("+a+")",c).width(g[a]);e(this).width(g[a])});
|
||||||
|
e("th.sorting, th.sorting_desc, th.sorting_asc",c).bind("click",function(){this.blur()})}},_fnCloneTfoot:function(a){var b=this.fnGetSettings(),c=a.nNode;for(a.nWrapper.style.width=e(b.nTable).outerWidth()+"px";0<c.childNodes.length;)c.removeChild(c.childNodes[0]);a=e("tfoot",b.nTable).clone(!0)[0];c.appendChild(a);e("tfoot:eq(0)>tr th",b.nTable).each(function(a){e("tfoot:eq(0)>tr th:eq("+a+")",c).width(e(this).width())});e("tfoot:eq(0)>tr td",b.nTable).each(function(a){e("tfoot:eq(0)>tr td:eq("+
|
||||||
|
a+")",c).width(e(this).width())})},_fnCloneTLeft:function(a){for(var b=this.fnGetSettings(),c=a.nNode,d=e("tbody",b.nTable)[0];0<c.childNodes.length;)c.removeChild(c.childNodes[0]);c.appendChild(e("thead",b.nTable).clone(!0)[0]);c.appendChild(e("tbody",b.nTable).clone(!0)[0]);b.bFooter&&c.appendChild(e("tfoot",b.nTable).clone(!0)[0]);var f="gt("+(a.iCells-1)+")";e("thead tr",c).each(function(){e("th:"+f,this).remove()});e("tfoot tr",c).each(function(){e("th:"+f,this).remove()});e("tbody tr",c).each(function(){e("td:"+
|
||||||
|
f,this).remove()});this.fnEqualiseHeights("thead",d.parentNode,c);this.fnEqualiseHeights("tbody",d.parentNode,c);this.fnEqualiseHeights("tfoot",d.parentNode,c);for(var g=d=0;g<a.iCells;g++)d+=e("thead tr th:eq("+g+")",b.nTable).outerWidth();c.style.width=d+"px";a.nWrapper.style.width=d+"px"},_fnCloneTRight:function(a){for(var b=this.fnGetSettings(),c=e("tbody",b.nTable)[0],d=a.nNode,f=e("tbody tr:eq(0) td",b.nTable).length;0<d.childNodes.length;)d.removeChild(d.childNodes[0]);d.appendChild(e("thead",
|
||||||
|
b.nTable).clone(!0)[0]);d.appendChild(e("tbody",b.nTable).clone(!0)[0]);b.bFooter&&d.appendChild(e("tfoot",b.nTable).clone(!0)[0]);e("thead tr th:lt("+(f-a.iCells)+")",d).remove();e("tfoot tr th:lt("+(f-a.iCells)+")",d).remove();e("tbody tr",d).each(function(){e("td:lt("+(f-a.iCells)+")",this).remove()});this.fnEqualiseHeights("thead",c.parentNode,d);this.fnEqualiseHeights("tbody",c.parentNode,d);this.fnEqualiseHeights("tfoot",c.parentNode,d);for(var g=c=0;g<a.iCells;g++)c+=e("thead tr th:eq("+(f-
|
||||||
|
1-g)+")",b.nTable).outerWidth();d.style.width=c+"px";a.nWrapper.style.width=c+"px"},fnEqualiseHeights:function(a,b,c){var d=e(a+" tr",b),f;e(a+" tr",c).each(function(a){f=d.eq(a).css("height");"Microsoft Internet Explorer"==navigator.appName&&(f=parseInt(f,10)+1);e(this).css("height",f);d.eq(a).css("height",f)})}};FixedHeader.oWin={iScrollTop:0,iScrollRight:0,iScrollBottom:0,iScrollLeft:0,iHeight:0,iWidth:0};FixedHeader.oDoc={iHeight:0,iWidth:0};FixedHeader.afnScroll=[];FixedHeader.fnMeasure=function(){var a=
|
||||||
|
e(j),b=e(k),c=FixedHeader.oWin,d=FixedHeader.oDoc;d.iHeight=b.height();d.iWidth=b.width();c.iHeight=a.height();c.iWidth=a.width();c.iScrollTop=a.scrollTop();c.iScrollLeft=a.scrollLeft();c.iScrollRight=d.iWidth-c.iScrollLeft-c.iWidth;c.iScrollBottom=d.iHeight-c.iScrollTop-c.iHeight};FixedHeader.version="2.1.2";e(j).scroll(function(){FixedHeader.fnMeasure();for(var a=0,b=FixedHeader.afnScroll.length;a<b;a++)FixedHeader.afnScroll[a]()});e.fn.dataTable.FixedHeader=FixedHeader;return e.fn.DataTable.FixedHeader=
|
||||||
|
FixedHeader};"function"===typeof define&&define.amd?define(["jquery","datatables"],l):"object"===typeof exports?l(require("jquery"),require("datatables")):jQuery&&!jQuery.fn.dataTable.FixedHeader&&l(jQuery,jQuery.fn.dataTable)})(window,document);
|
||||||
@ -0,0 +1,7 @@
|
|||||||
|
|
||||||
|
|
||||||
|
table.KeyTable th.focus,
|
||||||
|
table.KeyTable td.focus {
|
||||||
|
outline: 3px solid #3366FF;
|
||||||
|
outline-offset: -3px;
|
||||||
|
}
|
||||||
@ -0,0 +1 @@
|
|||||||
|
table.KeyTable th.focus,table.KeyTable td.focus{outline:3px solid #3366FF;outline-offset:-3px}
|
||||||
@ -0,0 +1,18 @@
|
|||||||
|
/*!
|
||||||
|
KeyTable 1.2.1
|
||||||
|
©2010-2014 SpryMedia Ltd - datatables.net/license
|
||||||
|
*/
|
||||||
|
var KeyTable;
|
||||||
|
(function(F,n,K){var A=function(d){KeyTable=function(j){function A(a){return function(e,c,p){(null===e||"number"==typeof e)&&(null===c||"number"==typeof c)&&"function"==typeof p?k[a].push({x:e,y:c,fn:p}):"object"==typeof e&&"function"==typeof c?(e=E(e),k[a].push({x:e[0],y:e[1],fn:c})):alert("Unhandable event type was added: x"+e+" y:"+c+" z:"+p)}}function L(a){return function(e,c,p){(null===e||"number"==typeof e)&&(null===c||"number"==typeof c)?"function"==typeof p?B(a,e,c,p):B(a,e,c):"object"==
|
||||||
|
typeof e?(e=E(e),"function"==typeof c?B(a,e[0],e[1],c):B(a,e[0],e[1])):alert("Unhandable event type was removed: x"+e+" y:"+c+" z:"+p)}}function B(a,e,c,p){for(var h=0,b=0,d=k[a].length;b<d-h;b++)if("undefined"!=typeof p)k[a][b-h].x==e&&(k[a][b-h].y==c&&k[a][b-h].fn==p)&&(k[a].splice(b-h,1),h++);else if(k[a][b-h].x==e&&k[a][b-h].y==c)return k[a].splice(b,1),1;return h}function C(a,e,c){for(var p=0,a=k[a],b=0;b<a.length;b++)if(a[b].x==e&&a[b].y==c||null===a[b].x&&a[b].y==c||a[b].x==e&&null===a[b].y||
|
||||||
|
null===a[b].x&&null===a[b].y)a[b].fn(w(e,c),e,c),p++;return p}function q(a,e){if(t!=a){"undefined"==typeof e&&(e=!0);null!==t&&G(t);d(a).addClass(x);d(a).parent().addClass(x);var c;if(i){c=i;for(var b=H(a)[1],h=o;b>=c.fnDisplayEnd();)0<=c._iDisplayLength?c._iDisplayStart+c._iDisplayLength<c.fnRecordsDisplay()&&(c._iDisplayStart+=c._iDisplayLength):c._iDisplayStart=0,i.oApi._fnCalculateEnd(c);for(;b<c._iDisplayStart;)c._iDisplayStart=0<=c._iDisplayLength?c._iDisplayStart-c._iDisplayLength:0,0>c._iDisplayStart&&
|
||||||
|
(c._iDisplayStart=0),i.oApi._fnCalculateEnd(c);i.oApi._fnDraw(c);o=h}b=E(a);t=a;l=b[0];g=b[1];var r,j,k,m,f;if(e){r=d(F).height();b=d(F).width();j=d(n).scrollTop();h=d(n).scrollLeft();k=a.offsetHeight;m=a.offsetWidth;f=a;var q=0,s=0;if(f.offsetParent){q=f.offsetLeft;s=f.offsetTop;for(f=f.offsetParent;f;)q+=f.offsetLeft,s+=f.offsetTop,f=f.offsetParent}f=[q,s];if(i&&"undefined"!=typeof c.oScroll&&(""!==c.oScroll.sX||""!==c.oScroll.sY))f[1]-=d(c.nTable.parentNode).scrollTop(),f[0]-=d(c.nTable.parentNode).scrollLeft();
|
||||||
|
f[1]+k>j+r?(r=f[1]+k-r,n.documentElement.scrollTop=r,n.body.scrollTop=r):f[1]<j&&(r=f[1],n.documentElement.scrollTop=r,n.body.scrollTop=r);f[0]+m>h+b?(b=f[0]+m-b,n.documentElement.scrollLeft=b,n.body.scrollLeft=b):f[0]<h&&(b=f[0],n.documentElement.scrollLeft=b,n.body.scrollLeft=b)}if(i&&"undefined"!=typeof c.oScroll&&(""!==c.oScroll.sX||""!==c.oScroll.sY))(c=c.nTable.parentNode,r=c.clientHeight,b=c.clientWidth,j=c.scrollTop,h=c.scrollLeft,k=a.offsetHeight,m=a.offsetWidth,a.offsetTop+k>r+j?c.scrollTop=
|
||||||
|
a.offsetTop+k-r:a.offsetTop<j&&(c.scrollTop=a.offsetTop),a.offsetLeft+m>b+h)?c.scrollLeft=a.offsetLeft+m-b:a.offsetLeft<h&&(c.scrollLeft=a.offsetLeft);o||(o=!0);C("focus",l,g)}}function y(){G(t);t=g=l=null;o=!1}function G(a){d(a).removeClass(x);d(a).parent().removeClass(x);C("blur",l,g)}function I(){for(var a=this;"TD"!=a.nodeName;)a=a.parentNode;q(a);o||(o=!0)}function w(a,b){return i?"undefined"!=typeof i.aoData[i.aiDisplay[b]]?i.aoData[i.aiDisplay[b]].nTr.getElementsByTagName("td")[a]:null:d("tr:eq("+
|
||||||
|
b+")>td:eq("+a+")",z)[0]}function E(a){return i?[d("td",a.parentNode).index(a),d("tr",a.parentNode.parentNode).index(a.parentNode)+i._iDisplayStart]:[d("td",a.parentNode).index(a),d("tr",a.parentNode.parentNode).index(a.parentNode)]}function H(a){for(var b=0,c=i.aiDisplay.length;b<c;b++)for(var d=i.aoData[i.aiDisplay[b]].nTr.getElementsByTagName("td"),h=0,g=d.length;h<g;h++)if(d[h]==a)return[h,b];return null}this.block=!1;this.event={remove:{}};this.fnGetCurrentPosition=function(){return[l,g]};this.fnGetCurrentData=
|
||||||
|
function(){return t.innerHTML};this.fnGetCurrentTD=function(){return t};this.fnSetPosition=function(a,b){"object"==typeof a&&a.nodeName?q(a):q(w(a,b))};this.fnBlur=function(){y()};var z=null,t=null,l=null,g=null,J=null,x="focus",o=!1,k={action:[],esc:[],focus:[],blur:[]},i=null,D,s,u=!1,m;for(m in k)m&&(this.event[m]=A(m),this.event.remove[m]=L(m));var v;j===K?(m=d("table.KeyTable")[0],v=null):d.isPlainObject(j)?(m=j.table,v=j.datatable):(v=(new d.fn.dataTable.Api(j)).settings()[0],m=v.nTable);var b=
|
||||||
|
j,J=this;"undefined"==typeof b&&(b={});"undefined"==typeof b.focus&&(b.focus=[0,0]);b.table=m;d(b.table).addClass("KeyTable");"undefined"!=typeof b.focusClass&&(x=b.focusClass);"undefined"!=typeof v&&(i=v);"undefined"==typeof b.initScroll&&(b.initScroll=!0);"undefined"==typeof b.form&&(b.form=!1);D=b.form;z=b.table.getElementsByTagName("tbody")[0];D?(j=n.createElement("div"),s=n.createElement("input"),j.style.height="1px",j.style.width="0px",j.style.overflow="hidden","undefined"!=typeof b.tabIndex&&
|
||||||
|
(s.tabIndex=b.tabIndex),j.appendChild(s),b.table.parentNode.insertBefore(j,b.table.nextSibling),d(s).focus(function(){if(!u){o=true;u=false;typeof b.focus.nodeName!="undefined"?q(b.focus,b.initScroll):q(w(b.focus[0],b.focus[1]),b.initScroll);setTimeout(function(){s.blur()},0)}}),o=!1):("undefined"!=typeof b.focus.nodeName?q(b.focus,b.initScroll):q(w(b.focus[0],b.focus[1]),b.initScroll),o||(o=!0));d(n).bind("keydown",function(a){if(J.block||!o||a.metaKey||a.altKey||a.ctrlKey)return true;var b;b=z.getElementsByTagName("tr")[0].getElementsByTagName("td").length;
|
||||||
|
var c;if(i){c=i.aiDisplay.length;var d=H(t);if(d===null)return;l=d[0];g=d[1]}else c=z.getElementsByTagName("tr").length;d=a.keyCode==9&&a.shiftKey?-1:a.keyCode;switch(d){case 13:a.preventDefault();a.stopPropagation();C("action",l,g);return true;case 27:if(!C("esc",l,g)){y();return}a=l;b=g;break;case -1:case 37:if(l>0){a=l-1;b=g}else if(g>0){a=b-1;b=g-1}else{if(d==-1&&D){u=true;s.focus();setTimeout(function(){u=false},0);o=false;y();return true}return false}break;case 38:if(g>0){a=l;b=g-1}else return false;
|
||||||
|
break;case 36:a=l;b=0;break;case 33:a=l;b=g-10;b<0&&(b=0);break;case 9:case 39:if(l<b-1){a=l+1;b=g}else if(g<c-1){a=0;b=g+1}else{if(d==9&&D){u=true;s.focus();setTimeout(function(){u=false},0);o=false;y();return true}return false}break;case 40:if(g<c-1){a=l;b=g+1}else return false;break;case 35:a=l;b=c-1;break;case 34:a=l;b=g+10;b>c-1&&(b=c-1);break;default:return true}q(w(a,b));return false});if(i)d(i.nTable).on("click","td",I);else d(z).on("click","td",I);d(n).click(function(a){for(var a=a.target,
|
||||||
|
d=false;a;){if(a==b.table){d=true;break}a=a.parentNode}d||y()})};KeyTable.version="1.2.1";d.fn.dataTable.KeyTable=KeyTable;return d.fn.DataTable.KeyTable=KeyTable};"function"===typeof define&&define.amd?define(["jquery","datatables"],A):"object"===typeof exports?A(require("jquery"),require("datatables")):jQuery&&!jQuery.fn.dataTable.KeyTable&&A(jQuery,jQuery.fn.dataTable)})(window,document);
|
||||||
@ -0,0 +1,106 @@
|
|||||||
|
table.dataTable.dtr-inline.collapsed > tbody > tr > td:first-child,
|
||||||
|
table.dataTable.dtr-inline.collapsed > tbody > tr > th:first-child {
|
||||||
|
position: relative;
|
||||||
|
padding-left: 30px;
|
||||||
|
cursor: pointer;
|
||||||
|
}
|
||||||
|
table.dataTable.dtr-inline.collapsed > tbody > tr > td:first-child:before,
|
||||||
|
table.dataTable.dtr-inline.collapsed > tbody > tr > th:first-child:before {
|
||||||
|
top: 8px;
|
||||||
|
left: 4px;
|
||||||
|
height: 16px;
|
||||||
|
width: 16px;
|
||||||
|
display: block;
|
||||||
|
position: absolute;
|
||||||
|
color: white;
|
||||||
|
border: 2px solid white;
|
||||||
|
border-radius: 16px;
|
||||||
|
text-align: center;
|
||||||
|
line-height: 14px;
|
||||||
|
box-shadow: 0 0 3px #444;
|
||||||
|
box-sizing: content-box;
|
||||||
|
content: '+';
|
||||||
|
background-color: #31b131;
|
||||||
|
}
|
||||||
|
table.dataTable.dtr-inline.collapsed > tbody > tr > td:first-child.dataTables_empty:before,
|
||||||
|
table.dataTable.dtr-inline.collapsed > tbody > tr > th:first-child.dataTables_empty:before {
|
||||||
|
display: none;
|
||||||
|
}
|
||||||
|
table.dataTable.dtr-inline.collapsed > tbody > tr.parent > td:first-child:before,
|
||||||
|
table.dataTable.dtr-inline.collapsed > tbody > tr.parent > th:first-child:before {
|
||||||
|
content: '-';
|
||||||
|
background-color: #d33333;
|
||||||
|
}
|
||||||
|
table.dataTable.dtr-inline.collapsed > tbody > tr.child td:before {
|
||||||
|
display: none;
|
||||||
|
}
|
||||||
|
table.dataTable.dtr-inline.collapsed.compact > tbody > tr > td:first-child,
|
||||||
|
table.dataTable.dtr-inline.collapsed.compact > tbody > tr > th:first-child {
|
||||||
|
padding-left: 27px;
|
||||||
|
}
|
||||||
|
table.dataTable.dtr-inline.collapsed.compact > tbody > tr > td:first-child:before,
|
||||||
|
table.dataTable.dtr-inline.collapsed.compact > tbody > tr > th:first-child:before {
|
||||||
|
top: 5px;
|
||||||
|
left: 4px;
|
||||||
|
height: 14px;
|
||||||
|
width: 14px;
|
||||||
|
border-radius: 14px;
|
||||||
|
line-height: 12px;
|
||||||
|
}
|
||||||
|
table.dataTable.dtr-column > tbody > tr > td.control,
|
||||||
|
table.dataTable.dtr-column > tbody > tr > th.control {
|
||||||
|
position: relative;
|
||||||
|
cursor: pointer;
|
||||||
|
}
|
||||||
|
table.dataTable.dtr-column > tbody > tr > td.control:before,
|
||||||
|
table.dataTable.dtr-column > tbody > tr > th.control:before {
|
||||||
|
top: 50%;
|
||||||
|
left: 50%;
|
||||||
|
height: 16px;
|
||||||
|
width: 16px;
|
||||||
|
margin-top: -10px;
|
||||||
|
margin-left: -10px;
|
||||||
|
display: block;
|
||||||
|
position: absolute;
|
||||||
|
color: white;
|
||||||
|
border: 2px solid white;
|
||||||
|
border-radius: 16px;
|
||||||
|
text-align: center;
|
||||||
|
line-height: 14px;
|
||||||
|
box-shadow: 0 0 3px #444;
|
||||||
|
box-sizing: content-box;
|
||||||
|
content: '+';
|
||||||
|
background-color: #31b131;
|
||||||
|
}
|
||||||
|
table.dataTable.dtr-column > tbody > tr.parent td.control:before,
|
||||||
|
table.dataTable.dtr-column > tbody > tr.parent th.control:before {
|
||||||
|
content: '-';
|
||||||
|
background-color: #d33333;
|
||||||
|
}
|
||||||
|
table.dataTable > tbody > tr.child {
|
||||||
|
padding: 0.5em 1em;
|
||||||
|
}
|
||||||
|
table.dataTable > tbody > tr.child:hover {
|
||||||
|
background: transparent !important;
|
||||||
|
}
|
||||||
|
table.dataTable > tbody > tr.child ul {
|
||||||
|
display: inline-block;
|
||||||
|
list-style-type: none;
|
||||||
|
margin: 0;
|
||||||
|
padding: 0;
|
||||||
|
}
|
||||||
|
table.dataTable > tbody > tr.child ul li {
|
||||||
|
border-bottom: 1px solid #efefef;
|
||||||
|
padding: 0.5em 0;
|
||||||
|
}
|
||||||
|
table.dataTable > tbody > tr.child ul li:first-child {
|
||||||
|
padding-top: 0;
|
||||||
|
}
|
||||||
|
table.dataTable > tbody > tr.child ul li:last-child {
|
||||||
|
border-bottom: none;
|
||||||
|
}
|
||||||
|
table.dataTable > tbody > tr.child span.dtr-title {
|
||||||
|
display: inline-block;
|
||||||
|
min-width: 75px;
|
||||||
|
font-weight: bold;
|
||||||
|
}
|
||||||
@ -0,0 +1,149 @@
|
|||||||
|
|
||||||
|
//
|
||||||
|
// Mixins
|
||||||
|
//
|
||||||
|
@mixin control() {
|
||||||
|
display: block;
|
||||||
|
position: absolute;
|
||||||
|
color: white;
|
||||||
|
border: 2px solid white;
|
||||||
|
border-radius: 16px;
|
||||||
|
text-align: center;
|
||||||
|
line-height: 14px;
|
||||||
|
box-shadow: 0 0 3px #444;
|
||||||
|
box-sizing: content-box;
|
||||||
|
}
|
||||||
|
|
||||||
|
@mixin control-open() {
|
||||||
|
content: '+';
|
||||||
|
background-color: #31b131;
|
||||||
|
}
|
||||||
|
|
||||||
|
@mixin control-close() {
|
||||||
|
content: '-';
|
||||||
|
background-color: #d33333;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
//
|
||||||
|
// Table styles
|
||||||
|
//
|
||||||
|
table.dataTable {
|
||||||
|
// Styling for the `inline` type
|
||||||
|
&.dtr-inline.collapsed > tbody {
|
||||||
|
> tr > td:first-child,
|
||||||
|
> tr > th:first-child {
|
||||||
|
position: relative;
|
||||||
|
padding-left: 30px;
|
||||||
|
cursor: pointer;
|
||||||
|
|
||||||
|
&:before {
|
||||||
|
top: 8px;
|
||||||
|
left: 4px;
|
||||||
|
height: 16px;
|
||||||
|
width: 16px;
|
||||||
|
@include control;
|
||||||
|
@include control-open;
|
||||||
|
}
|
||||||
|
|
||||||
|
&.dataTables_empty:before {
|
||||||
|
display: none;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
> tr.parent {
|
||||||
|
> td:first-child:before,
|
||||||
|
> th:first-child:before {
|
||||||
|
@include control-close;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
> tr.child td:before {
|
||||||
|
display: none;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// DataTables' `compact` styling
|
||||||
|
&.dtr-inline.collapsed.compact > tbody {
|
||||||
|
> tr > td:first-child,
|
||||||
|
> tr > th:first-child {
|
||||||
|
padding-left: 27px;
|
||||||
|
|
||||||
|
&:before {
|
||||||
|
top: 5px;
|
||||||
|
left: 4px;
|
||||||
|
height: 14px;
|
||||||
|
width: 14px;
|
||||||
|
border-radius: 14px;
|
||||||
|
line-height: 12px;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
// Styling for the `column` type
|
||||||
|
&.dtr-column > tbody {
|
||||||
|
> tr > td.control,
|
||||||
|
> tr > th.control {
|
||||||
|
position: relative;
|
||||||
|
cursor: pointer;
|
||||||
|
|
||||||
|
&:before {
|
||||||
|
top: 50%;
|
||||||
|
left: 50%;
|
||||||
|
height: 16px;
|
||||||
|
width: 16px;
|
||||||
|
margin-top: -10px;
|
||||||
|
margin-left: -10px;
|
||||||
|
@include control;
|
||||||
|
@include control-open;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
> tr.parent {
|
||||||
|
td.control:before,
|
||||||
|
th.control:before {
|
||||||
|
@include control-close;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
// Child row styling
|
||||||
|
> tbody > tr.child {
|
||||||
|
padding: 0.5em 1em;
|
||||||
|
|
||||||
|
&:hover {
|
||||||
|
background: transparent !important;
|
||||||
|
}
|
||||||
|
|
||||||
|
ul {
|
||||||
|
display: inline-block;
|
||||||
|
list-style-type: none;
|
||||||
|
margin: 0;
|
||||||
|
padding: 0;
|
||||||
|
|
||||||
|
li {
|
||||||
|
border-bottom: 1px solid #efefef;
|
||||||
|
padding: 0.5em 0;
|
||||||
|
|
||||||
|
&:first-child {
|
||||||
|
padding-top: 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
&:last-child {
|
||||||
|
border-bottom: none;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
span.dtr-title {
|
||||||
|
display: inline-block;
|
||||||
|
min-width: 75px;
|
||||||
|
font-weight: bold;
|
||||||
|
}
|
||||||
|
|
||||||
|
span.dtr-data {}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
@ -0,0 +1,873 @@
|
|||||||
|
/*! Responsive 1.0.6
|
||||||
|
* 2014-2015 SpryMedia Ltd - datatables.net/license
|
||||||
|
*/
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @summary Responsive
|
||||||
|
* @description Responsive tables plug-in for DataTables
|
||||||
|
* @version 1.0.6
|
||||||
|
* @file dataTables.responsive.js
|
||||||
|
* @author SpryMedia Ltd (www.sprymedia.co.uk)
|
||||||
|
* @contact www.sprymedia.co.uk/contact
|
||||||
|
* @copyright Copyright 2014-2015 SpryMedia Ltd.
|
||||||
|
*
|
||||||
|
* This source file is free software, available under the following license:
|
||||||
|
* MIT license - http://datatables.net/license/mit
|
||||||
|
*
|
||||||
|
* This source file is distributed in the hope that it will be useful, but
|
||||||
|
* WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY
|
||||||
|
* or FITNESS FOR A PARTICULAR PURPOSE. See the license files for details.
|
||||||
|
*
|
||||||
|
* For details please refer to: http://www.datatables.net
|
||||||
|
*/
|
||||||
|
|
||||||
|
(function(window, document, undefined) {
|
||||||
|
|
||||||
|
|
||||||
|
var factory = function( $, DataTable ) {
|
||||||
|
"use strict";
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Responsive is a plug-in for the DataTables library that makes use of
|
||||||
|
* DataTables' ability to change the visibility of columns, changing the
|
||||||
|
* visibility of columns so the displayed columns fit into the table container.
|
||||||
|
* The end result is that complex tables will be dynamically adjusted to fit
|
||||||
|
* into the viewport, be it on a desktop, tablet or mobile browser.
|
||||||
|
*
|
||||||
|
* Responsive for DataTables has two modes of operation, which can used
|
||||||
|
* individually or combined:
|
||||||
|
*
|
||||||
|
* * Class name based control - columns assigned class names that match the
|
||||||
|
* breakpoint logic can be shown / hidden as required for each breakpoint.
|
||||||
|
* * Automatic control - columns are automatically hidden when there is no
|
||||||
|
* room left to display them. Columns removed from the right.
|
||||||
|
*
|
||||||
|
* In additional to column visibility control, Responsive also has built into
|
||||||
|
* options to use DataTables' child row display to show / hide the information
|
||||||
|
* from the table that has been hidden. There are also two modes of operation
|
||||||
|
* for this child row display:
|
||||||
|
*
|
||||||
|
* * Inline - when the control element that the user can use to show / hide
|
||||||
|
* child rows is displayed inside the first column of the table.
|
||||||
|
* * Column - where a whole column is dedicated to be the show / hide control.
|
||||||
|
*
|
||||||
|
* Initialisation of Responsive is performed by:
|
||||||
|
*
|
||||||
|
* * Adding the class `responsive` or `dt-responsive` to the table. In this case
|
||||||
|
* Responsive will automatically be initialised with the default configuration
|
||||||
|
* options when the DataTable is created.
|
||||||
|
* * Using the `responsive` option in the DataTables configuration options. This
|
||||||
|
* can also be used to specify the configuration options, or simply set to
|
||||||
|
* `true` to use the defaults.
|
||||||
|
*
|
||||||
|
* @class
|
||||||
|
* @param {object} settings DataTables settings object for the host table
|
||||||
|
* @param {object} [opts] Configuration options
|
||||||
|
* @requires jQuery 1.7+
|
||||||
|
* @requires DataTables 1.10.1+
|
||||||
|
*
|
||||||
|
* @example
|
||||||
|
* $('#example').DataTable( {
|
||||||
|
* responsive: true
|
||||||
|
* } );
|
||||||
|
* } );
|
||||||
|
*/
|
||||||
|
var Responsive = function ( settings, opts ) {
|
||||||
|
// Sanity check that we are using DataTables 1.10 or newer
|
||||||
|
if ( ! DataTable.versionCheck || ! DataTable.versionCheck( '1.10.1' ) ) {
|
||||||
|
throw 'DataTables Responsive requires DataTables 1.10.1 or newer';
|
||||||
|
}
|
||||||
|
|
||||||
|
this.s = {
|
||||||
|
dt: new DataTable.Api( settings ),
|
||||||
|
columns: []
|
||||||
|
};
|
||||||
|
|
||||||
|
// Check if responsive has already been initialised on this table
|
||||||
|
if ( this.s.dt.settings()[0].responsive ) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// details is an object, but for simplicity the user can give it as a string
|
||||||
|
if ( opts && typeof opts.details === 'string' ) {
|
||||||
|
opts.details = { type: opts.details };
|
||||||
|
}
|
||||||
|
|
||||||
|
this.c = $.extend( true, {}, Responsive.defaults, DataTable.defaults.responsive, opts );
|
||||||
|
settings.responsive = this;
|
||||||
|
this._constructor();
|
||||||
|
};
|
||||||
|
|
||||||
|
Responsive.prototype = {
|
||||||
|
/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||||
|
* Constructor
|
||||||
|
*/
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Initialise the Responsive instance
|
||||||
|
*
|
||||||
|
* @private
|
||||||
|
*/
|
||||||
|
_constructor: function ()
|
||||||
|
{
|
||||||
|
var that = this;
|
||||||
|
var dt = this.s.dt;
|
||||||
|
|
||||||
|
dt.settings()[0]._responsive = this;
|
||||||
|
|
||||||
|
// Use DataTables' private throttle function to avoid processor thrashing
|
||||||
|
$(window).on( 'resize.dtr orientationchange.dtr', dt.settings()[0].oApi._fnThrottle( function () {
|
||||||
|
that._resize();
|
||||||
|
} ) );
|
||||||
|
|
||||||
|
// Destroy event handler
|
||||||
|
dt.on( 'destroy.dtr', function () {
|
||||||
|
$(window).off( 'resize.dtr orientationchange.dtr draw.dtr' );
|
||||||
|
} );
|
||||||
|
|
||||||
|
// Reorder the breakpoints array here in case they have been added out
|
||||||
|
// of order
|
||||||
|
this.c.breakpoints.sort( function (a, b) {
|
||||||
|
return a.width < b.width ? 1 :
|
||||||
|
a.width > b.width ? -1 : 0;
|
||||||
|
} );
|
||||||
|
|
||||||
|
// Determine which columns are already hidden, and should therefore
|
||||||
|
// remain hidden. todo - should this be done? See thread 22677
|
||||||
|
//
|
||||||
|
// this.s.alwaysHidden = dt.columns(':hidden').indexes();
|
||||||
|
|
||||||
|
this._classLogic();
|
||||||
|
this._resizeAuto();
|
||||||
|
|
||||||
|
// Details handler
|
||||||
|
var details = this.c.details;
|
||||||
|
if ( details.type ) {
|
||||||
|
that._detailsInit();
|
||||||
|
this._detailsVis();
|
||||||
|
|
||||||
|
dt.on( 'column-visibility.dtr', function () {
|
||||||
|
that._detailsVis();
|
||||||
|
} );
|
||||||
|
|
||||||
|
// Redraw the details box on each draw. This is used until
|
||||||
|
// DataTables implements a native `updated` event for rows
|
||||||
|
dt.on( 'draw.dtr', function () {
|
||||||
|
dt.rows( {page: 'current'} ).iterator( 'row', function ( settings, idx ) {
|
||||||
|
var row = dt.row( idx );
|
||||||
|
|
||||||
|
if ( row.child.isShown() ) {
|
||||||
|
var info = that.c.details.renderer( dt, idx );
|
||||||
|
row.child( info, 'child' ).show();
|
||||||
|
}
|
||||||
|
} );
|
||||||
|
} );
|
||||||
|
|
||||||
|
$(dt.table().node()).addClass( 'dtr-'+details.type );
|
||||||
|
}
|
||||||
|
|
||||||
|
// First pass - draw the table for the current viewport size
|
||||||
|
this._resize();
|
||||||
|
},
|
||||||
|
|
||||||
|
|
||||||
|
/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||||
|
* Private methods
|
||||||
|
*/
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Calculate the visibility for the columns in a table for a given
|
||||||
|
* breakpoint. The result is pre-determined based on the class logic if
|
||||||
|
* class names are used to control all columns, but the width of the table
|
||||||
|
* is also used if there are columns which are to be automatically shown
|
||||||
|
* and hidden.
|
||||||
|
*
|
||||||
|
* @param {string} breakpoint Breakpoint name to use for the calculation
|
||||||
|
* @return {array} Array of boolean values initiating the visibility of each
|
||||||
|
* column.
|
||||||
|
* @private
|
||||||
|
*/
|
||||||
|
_columnsVisiblity: function ( breakpoint )
|
||||||
|
{
|
||||||
|
var dt = this.s.dt;
|
||||||
|
var columns = this.s.columns;
|
||||||
|
var i, ien;
|
||||||
|
|
||||||
|
// Class logic - determine which columns are in this breakpoint based
|
||||||
|
// on the classes. If no class control (i.e. `auto`) then `-` is used
|
||||||
|
// to indicate this to the rest of the function
|
||||||
|
var display = $.map( columns, function ( col ) {
|
||||||
|
return col.auto && col.minWidth === null ?
|
||||||
|
false :
|
||||||
|
col.auto === true ?
|
||||||
|
'-' :
|
||||||
|
$.inArray( breakpoint, col.includeIn ) !== -1;
|
||||||
|
} );
|
||||||
|
|
||||||
|
// Auto column control - first pass: how much width is taken by the
|
||||||
|
// ones that must be included from the non-auto columns
|
||||||
|
var requiredWidth = 0;
|
||||||
|
for ( i=0, ien=display.length ; i<ien ; i++ ) {
|
||||||
|
if ( display[i] === true ) {
|
||||||
|
requiredWidth += columns[i].minWidth;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Second pass, use up any remaining width for other columns. For
|
||||||
|
// scrolling tables we need to subtract the width of the scrollbar. It
|
||||||
|
// may not be requires which makes this sub-optimal, but it would
|
||||||
|
// require another full redraw to make complete use of those extra few
|
||||||
|
// pixels
|
||||||
|
var scrolling = dt.settings()[0].oScroll;
|
||||||
|
var bar = scrolling.sY || scrolling.sX ? scrolling.iBarWidth : 0;
|
||||||
|
var widthAvailable = dt.table().container().offsetWidth - bar;
|
||||||
|
var usedWidth = widthAvailable - requiredWidth;
|
||||||
|
|
||||||
|
// Control column needs to always be included. This makes it sub-
|
||||||
|
// optimal in terms of using the available with, but to stop layout
|
||||||
|
// thrashing or overflow. Also we need to account for the control column
|
||||||
|
// width first so we know how much width is available for the other
|
||||||
|
// columns, since the control column might not be the first one shown
|
||||||
|
for ( i=0, ien=display.length ; i<ien ; i++ ) {
|
||||||
|
if ( columns[i].control ) {
|
||||||
|
usedWidth -= columns[i].minWidth;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Allow columns to be shown (counting from the left) until we run out
|
||||||
|
// of room
|
||||||
|
var empty = false;
|
||||||
|
for ( i=0, ien=display.length ; i<ien ; i++ ) {
|
||||||
|
if ( display[i] === '-' && ! columns[i].control ) {
|
||||||
|
// Once we've found a column that won't fit we don't let any
|
||||||
|
// others display either, or columns might disappear in the
|
||||||
|
// middle of the table
|
||||||
|
if ( empty || usedWidth - columns[i].minWidth < 0 ) {
|
||||||
|
empty = true;
|
||||||
|
display[i] = false;
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
display[i] = true;
|
||||||
|
}
|
||||||
|
|
||||||
|
usedWidth -= columns[i].minWidth;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Determine if the 'control' column should be shown (if there is one).
|
||||||
|
// This is the case when there is a hidden column (that is not the
|
||||||
|
// control column). The two loops look inefficient here, but they are
|
||||||
|
// trivial and will fly through. We need to know the outcome from the
|
||||||
|
// first , before the action in the second can be taken
|
||||||
|
var showControl = false;
|
||||||
|
|
||||||
|
for ( i=0, ien=columns.length ; i<ien ; i++ ) {
|
||||||
|
if ( ! columns[i].control && ! columns[i].never && ! display[i] ) {
|
||||||
|
showControl = true;
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
for ( i=0, ien=columns.length ; i<ien ; i++ ) {
|
||||||
|
if ( columns[i].control ) {
|
||||||
|
display[i] = showControl;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Finally we need to make sure that there is at least one column that
|
||||||
|
// is visible
|
||||||
|
if ( $.inArray( true, display ) === -1 ) {
|
||||||
|
display[0] = true;
|
||||||
|
}
|
||||||
|
|
||||||
|
return display;
|
||||||
|
},
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Create the internal `columns` array with information about the columns
|
||||||
|
* for the table. This includes determining which breakpoints the column
|
||||||
|
* will appear in, based upon class names in the column, which makes up the
|
||||||
|
* vast majority of this method.
|
||||||
|
*
|
||||||
|
* @private
|
||||||
|
*/
|
||||||
|
_classLogic: function ()
|
||||||
|
{
|
||||||
|
var that = this;
|
||||||
|
var calc = {};
|
||||||
|
var breakpoints = this.c.breakpoints;
|
||||||
|
var columns = this.s.dt.columns().eq(0).map( function (i) {
|
||||||
|
var className = this.column(i).header().className;
|
||||||
|
|
||||||
|
return {
|
||||||
|
className: className,
|
||||||
|
includeIn: [],
|
||||||
|
auto: false,
|
||||||
|
control: false,
|
||||||
|
never: className.match(/\bnever\b/) ? true : false
|
||||||
|
};
|
||||||
|
} );
|
||||||
|
|
||||||
|
// Simply add a breakpoint to `includeIn` array, ensuring that there are
|
||||||
|
// no duplicates
|
||||||
|
var add = function ( colIdx, name ) {
|
||||||
|
var includeIn = columns[ colIdx ].includeIn;
|
||||||
|
|
||||||
|
if ( $.inArray( name, includeIn ) === -1 ) {
|
||||||
|
includeIn.push( name );
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
var column = function ( colIdx, name, operator, matched ) {
|
||||||
|
var size, i, ien;
|
||||||
|
|
||||||
|
if ( ! operator ) {
|
||||||
|
columns[ colIdx ].includeIn.push( name );
|
||||||
|
}
|
||||||
|
else if ( operator === 'max-' ) {
|
||||||
|
// Add this breakpoint and all smaller
|
||||||
|
size = that._find( name ).width;
|
||||||
|
|
||||||
|
for ( i=0, ien=breakpoints.length ; i<ien ; i++ ) {
|
||||||
|
if ( breakpoints[i].width <= size ) {
|
||||||
|
add( colIdx, breakpoints[i].name );
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
else if ( operator === 'min-' ) {
|
||||||
|
// Add this breakpoint and all larger
|
||||||
|
size = that._find( name ).width;
|
||||||
|
|
||||||
|
for ( i=0, ien=breakpoints.length ; i<ien ; i++ ) {
|
||||||
|
if ( breakpoints[i].width >= size ) {
|
||||||
|
add( colIdx, breakpoints[i].name );
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
else if ( operator === 'not-' ) {
|
||||||
|
// Add all but this breakpoint (xxx need extra information)
|
||||||
|
|
||||||
|
for ( i=0, ien=breakpoints.length ; i<ien ; i++ ) {
|
||||||
|
if ( breakpoints[i].name.indexOf( matched ) === -1 ) {
|
||||||
|
add( colIdx, breakpoints[i].name );
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
// Loop over each column and determine if it has a responsive control
|
||||||
|
// class
|
||||||
|
columns.each( function ( col, i ) {
|
||||||
|
var classNames = col.className.split(' ');
|
||||||
|
var hasClass = false;
|
||||||
|
|
||||||
|
// Split the class name up so multiple rules can be applied if needed
|
||||||
|
for ( var k=0, ken=classNames.length ; k<ken ; k++ ) {
|
||||||
|
var className = $.trim( classNames[k] );
|
||||||
|
|
||||||
|
if ( className === 'all' ) {
|
||||||
|
// Include in all
|
||||||
|
hasClass = true;
|
||||||
|
col.includeIn = $.map( breakpoints, function (a) {
|
||||||
|
return a.name;
|
||||||
|
} );
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
else if ( className === 'none' || className === 'never' ) {
|
||||||
|
// Include in none (default) and no auto
|
||||||
|
hasClass = true;
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
else if ( className === 'control' ) {
|
||||||
|
// Special column that is only visible, when one of the other
|
||||||
|
// columns is hidden. This is used for the details control
|
||||||
|
hasClass = true;
|
||||||
|
col.control = true;
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
$.each( breakpoints, function ( j, breakpoint ) {
|
||||||
|
// Does this column have a class that matches this breakpoint?
|
||||||
|
var brokenPoint = breakpoint.name.split('-');
|
||||||
|
var re = new RegExp( '(min\\-|max\\-|not\\-)?('+brokenPoint[0]+')(\\-[_a-zA-Z0-9])?' );
|
||||||
|
var match = className.match( re );
|
||||||
|
|
||||||
|
if ( match ) {
|
||||||
|
hasClass = true;
|
||||||
|
|
||||||
|
if ( match[2] === brokenPoint[0] && match[3] === '-'+brokenPoint[1] ) {
|
||||||
|
// Class name matches breakpoint name fully
|
||||||
|
column( i, breakpoint.name, match[1], match[2]+match[3] );
|
||||||
|
}
|
||||||
|
else if ( match[2] === brokenPoint[0] && ! match[3] ) {
|
||||||
|
// Class name matched primary breakpoint name with no qualifier
|
||||||
|
column( i, breakpoint.name, match[1], match[2] );
|
||||||
|
}
|
||||||
|
}
|
||||||
|
} );
|
||||||
|
}
|
||||||
|
|
||||||
|
// If there was no control class, then automatic sizing is used
|
||||||
|
if ( ! hasClass ) {
|
||||||
|
col.auto = true;
|
||||||
|
}
|
||||||
|
} );
|
||||||
|
|
||||||
|
this.s.columns = columns;
|
||||||
|
},
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Initialisation for the details handler
|
||||||
|
*
|
||||||
|
* @private
|
||||||
|
*/
|
||||||
|
_detailsInit: function ()
|
||||||
|
{
|
||||||
|
var that = this;
|
||||||
|
var dt = this.s.dt;
|
||||||
|
var details = this.c.details;
|
||||||
|
|
||||||
|
// The inline type always uses the first child as the target
|
||||||
|
if ( details.type === 'inline' ) {
|
||||||
|
details.target = 'td:first-child';
|
||||||
|
}
|
||||||
|
|
||||||
|
// type.target can be a string jQuery selector or a column index
|
||||||
|
var target = details.target;
|
||||||
|
var selector = typeof target === 'string' ? target : 'td';
|
||||||
|
|
||||||
|
// Click handler to show / hide the details rows when they are available
|
||||||
|
$( dt.table().body() ).on( 'click', selector, function (e) {
|
||||||
|
// If the table is not collapsed (i.e. there is no hidden columns)
|
||||||
|
// then take no action
|
||||||
|
if ( ! $(dt.table().node()).hasClass('collapsed' ) ) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Check that the row is actually a DataTable's controlled node
|
||||||
|
if ( ! dt.row( $(this).closest('tr') ).length ) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// For column index, we determine if we should act or not in the
|
||||||
|
// handler - otherwise it is already okay
|
||||||
|
if ( typeof target === 'number' ) {
|
||||||
|
var targetIdx = target < 0 ?
|
||||||
|
dt.columns().eq(0).length + target :
|
||||||
|
target;
|
||||||
|
|
||||||
|
if ( dt.cell( this ).index().column !== targetIdx ) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// $().closest() includes itself in its check
|
||||||
|
var row = dt.row( $(this).closest('tr') );
|
||||||
|
|
||||||
|
if ( row.child.isShown() ) {
|
||||||
|
row.child( false );
|
||||||
|
$( row.node() ).removeClass( 'parent' );
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
var info = that.c.details.renderer( dt, row[0] );
|
||||||
|
row.child( info, 'child' ).show();
|
||||||
|
$( row.node() ).addClass( 'parent' );
|
||||||
|
}
|
||||||
|
} );
|
||||||
|
},
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Update the child rows in the table whenever the column visibility changes
|
||||||
|
*
|
||||||
|
* @private
|
||||||
|
*/
|
||||||
|
_detailsVis: function ()
|
||||||
|
{
|
||||||
|
var that = this;
|
||||||
|
var dt = this.s.dt;
|
||||||
|
|
||||||
|
// Find how many columns are hidden
|
||||||
|
var hiddenColumns = dt.columns().indexes().filter( function ( idx ) {
|
||||||
|
var col = dt.column( idx );
|
||||||
|
|
||||||
|
if ( col.visible() ) {
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Only counts as hidden if it doesn't have the `never` class
|
||||||
|
return $( col.header() ).hasClass( 'never' ) ? null : idx;
|
||||||
|
} );
|
||||||
|
var haveHidden = true;
|
||||||
|
|
||||||
|
if ( hiddenColumns.length === 0 || ( hiddenColumns.length === 1 && this.s.columns[ hiddenColumns[0] ].control ) ) {
|
||||||
|
haveHidden = false;
|
||||||
|
}
|
||||||
|
|
||||||
|
if ( haveHidden ) {
|
||||||
|
// Show all existing child rows
|
||||||
|
dt.rows( { page: 'current' } ).eq(0).each( function (idx) {
|
||||||
|
var row = dt.row( idx );
|
||||||
|
|
||||||
|
if ( row.child() ) {
|
||||||
|
var info = that.c.details.renderer( dt, row[0] );
|
||||||
|
|
||||||
|
// The renderer can return false to have no child row
|
||||||
|
if ( info === false ) {
|
||||||
|
row.child.hide();
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
row.child( info, 'child' ).show();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
} );
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
// Hide all existing child rows
|
||||||
|
dt.rows( { page: 'current' } ).eq(0).each( function (idx) {
|
||||||
|
dt.row( idx ).child.hide();
|
||||||
|
} );
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Find a breakpoint object from a name
|
||||||
|
* @param {string} name Breakpoint name to find
|
||||||
|
* @return {object} Breakpoint description object
|
||||||
|
*/
|
||||||
|
_find: function ( name )
|
||||||
|
{
|
||||||
|
var breakpoints = this.c.breakpoints;
|
||||||
|
|
||||||
|
for ( var i=0, ien=breakpoints.length ; i<ien ; i++ ) {
|
||||||
|
if ( breakpoints[i].name === name ) {
|
||||||
|
return breakpoints[i];
|
||||||
|
}
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Alter the table display for a resized viewport. This involves first
|
||||||
|
* determining what breakpoint the window currently is in, getting the
|
||||||
|
* column visibilities to apply and then setting them.
|
||||||
|
*
|
||||||
|
* @private
|
||||||
|
*/
|
||||||
|
_resize: function ()
|
||||||
|
{
|
||||||
|
var dt = this.s.dt;
|
||||||
|
var width = $(window).width();
|
||||||
|
var breakpoints = this.c.breakpoints;
|
||||||
|
var breakpoint = breakpoints[0].name;
|
||||||
|
var columns = this.s.columns;
|
||||||
|
var i, ien;
|
||||||
|
|
||||||
|
// Determine what breakpoint we are currently at
|
||||||
|
for ( i=breakpoints.length-1 ; i>=0 ; i-- ) {
|
||||||
|
if ( width <= breakpoints[i].width ) {
|
||||||
|
breakpoint = breakpoints[i].name;
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Show the columns for that break point
|
||||||
|
var columnsVis = this._columnsVisiblity( breakpoint );
|
||||||
|
|
||||||
|
// Set the class before the column visibility is changed so event
|
||||||
|
// listeners know what the state is. Need to determine if there are
|
||||||
|
// any columns that are not visible but can be shown
|
||||||
|
var collapsedClass = false;
|
||||||
|
for ( i=0, ien=columns.length ; i<ien ; i++ ) {
|
||||||
|
if ( columnsVis[i] === false && ! columns[i].never ) {
|
||||||
|
collapsedClass = true;
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
$( dt.table().node() ).toggleClass('collapsed', collapsedClass );
|
||||||
|
|
||||||
|
dt.columns().eq(0).each( function ( colIdx, i ) {
|
||||||
|
dt.column( colIdx ).visible( columnsVis[i] );
|
||||||
|
} );
|
||||||
|
},
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Determine the width of each column in the table so the auto column hiding
|
||||||
|
* has that information to work with. This method is never going to be 100%
|
||||||
|
* perfect since column widths can change slightly per page, but without
|
||||||
|
* seriously compromising performance this is quite effective.
|
||||||
|
*
|
||||||
|
* @private
|
||||||
|
*/
|
||||||
|
_resizeAuto: function ()
|
||||||
|
{
|
||||||
|
var dt = this.s.dt;
|
||||||
|
var columns = this.s.columns;
|
||||||
|
|
||||||
|
// Are we allowed to do auto sizing?
|
||||||
|
if ( ! this.c.auto ) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Are there any columns that actually need auto-sizing, or do they all
|
||||||
|
// have classes defined
|
||||||
|
if ( $.inArray( true, $.map( columns, function (c) { return c.auto; } ) ) === -1 ) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Clone the table with the current data in it
|
||||||
|
var tableWidth = dt.table().node().offsetWidth;
|
||||||
|
var columnWidths = dt.columns;
|
||||||
|
var clonedTable = dt.table().node().cloneNode( false );
|
||||||
|
var clonedHeader = $( dt.table().header().cloneNode( false ) ).appendTo( clonedTable );
|
||||||
|
var clonedBody = $( dt.table().body().cloneNode( false ) ).appendTo( clonedTable );
|
||||||
|
|
||||||
|
$( dt.table().footer() ).clone( false ).appendTo( clonedTable );
|
||||||
|
|
||||||
|
// This is a bit slow, but we need to get a clone of each row that
|
||||||
|
// includes all columns. As such, try to do this as little as possible.
|
||||||
|
dt.rows( { page: 'current' } ).indexes().flatten().each( function ( idx ) {
|
||||||
|
var clone = dt.row( idx ).node().cloneNode( true );
|
||||||
|
|
||||||
|
if ( dt.columns( ':hidden' ).flatten().length ) {
|
||||||
|
$(clone).append( dt.cells( idx, ':hidden' ).nodes().to$().clone() );
|
||||||
|
}
|
||||||
|
|
||||||
|
$(clone).appendTo( clonedBody );
|
||||||
|
} );
|
||||||
|
|
||||||
|
var cells = dt.columns().header().to$().clone( false );
|
||||||
|
$('<tr/>')
|
||||||
|
.append( cells )
|
||||||
|
.appendTo( clonedHeader );
|
||||||
|
|
||||||
|
// In the inline case extra padding is applied to the first column to
|
||||||
|
// give space for the show / hide icon. We need to use this in the
|
||||||
|
// calculation
|
||||||
|
if ( this.c.details.type === 'inline' ) {
|
||||||
|
$(clonedTable).addClass( 'dtr-inline collapsed' );
|
||||||
|
}
|
||||||
|
|
||||||
|
var inserted = $('<div/>')
|
||||||
|
.css( {
|
||||||
|
width: 1,
|
||||||
|
height: 1,
|
||||||
|
overflow: 'hidden'
|
||||||
|
} )
|
||||||
|
.append( clonedTable );
|
||||||
|
|
||||||
|
// Remove columns which are not to be included
|
||||||
|
inserted.find('th.never, td.never').remove();
|
||||||
|
|
||||||
|
inserted.insertBefore( dt.table().node() );
|
||||||
|
|
||||||
|
// The cloned header now contains the smallest that each column can be
|
||||||
|
dt.columns().eq(0).each( function ( idx ) {
|
||||||
|
columns[idx].minWidth = cells[ idx ].offsetWidth || 0;
|
||||||
|
} );
|
||||||
|
|
||||||
|
inserted.remove();
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* List of default breakpoints. Each item in the array is an object with two
|
||||||
|
* properties:
|
||||||
|
*
|
||||||
|
* * `name` - the breakpoint name.
|
||||||
|
* * `width` - the breakpoint width
|
||||||
|
*
|
||||||
|
* @name Responsive.breakpoints
|
||||||
|
* @static
|
||||||
|
*/
|
||||||
|
Responsive.breakpoints = [
|
||||||
|
{ name: 'desktop', width: Infinity },
|
||||||
|
{ name: 'tablet-l', width: 1024 },
|
||||||
|
{ name: 'tablet-p', width: 768 },
|
||||||
|
{ name: 'mobile-l', width: 480 },
|
||||||
|
{ name: 'mobile-p', width: 320 }
|
||||||
|
];
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Responsive default settings for initialisation
|
||||||
|
*
|
||||||
|
* @namespace
|
||||||
|
* @name Responsive.defaults
|
||||||
|
* @static
|
||||||
|
*/
|
||||||
|
Responsive.defaults = {
|
||||||
|
/**
|
||||||
|
* List of breakpoints for the instance. Note that this means that each
|
||||||
|
* instance can have its own breakpoints. Additionally, the breakpoints
|
||||||
|
* cannot be changed once an instance has been creased.
|
||||||
|
*
|
||||||
|
* @type {Array}
|
||||||
|
* @default Takes the value of `Responsive.breakpoints`
|
||||||
|
*/
|
||||||
|
breakpoints: Responsive.breakpoints,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Enable / disable auto hiding calculations. It can help to increase
|
||||||
|
* performance slightly if you disable this option, but all columns would
|
||||||
|
* need to have breakpoint classes assigned to them
|
||||||
|
*
|
||||||
|
* @type {Boolean}
|
||||||
|
* @default `true`
|
||||||
|
*/
|
||||||
|
auto: true,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Details control. If given as a string value, the `type` property of the
|
||||||
|
* default object is set to that value, and the defaults used for the rest
|
||||||
|
* of the object - this is for ease of implementation.
|
||||||
|
*
|
||||||
|
* The object consists of the following properties:
|
||||||
|
*
|
||||||
|
* * `renderer` - function that is called for display of the child row data.
|
||||||
|
* The default function will show the data from the hidden columns
|
||||||
|
* * `target` - Used as the selector for what objects to attach the child
|
||||||
|
* open / close to
|
||||||
|
* * `type` - `false` to disable the details display, `inline` or `column`
|
||||||
|
* for the two control types
|
||||||
|
*
|
||||||
|
* @type {Object|string}
|
||||||
|
*/
|
||||||
|
details: {
|
||||||
|
renderer: function ( api, rowIdx ) {
|
||||||
|
var data = api.cells( rowIdx, ':hidden' ).eq(0).map( function ( cell ) {
|
||||||
|
var header = $( api.column( cell.column ).header() );
|
||||||
|
var idx = api.cell( cell ).index();
|
||||||
|
|
||||||
|
if ( header.hasClass( 'control' ) || header.hasClass( 'never' ) ) {
|
||||||
|
return '';
|
||||||
|
}
|
||||||
|
|
||||||
|
// Use a non-public DT API method to render the data for display
|
||||||
|
// This needs to be updated when DT adds a suitable method for
|
||||||
|
// this type of data retrieval
|
||||||
|
var dtPrivate = api.settings()[0];
|
||||||
|
var cellData = dtPrivate.oApi._fnGetCellData(
|
||||||
|
dtPrivate, idx.row, idx.column, 'display'
|
||||||
|
);
|
||||||
|
var title = header.text();
|
||||||
|
if ( title ) {
|
||||||
|
title = title + ':';
|
||||||
|
}
|
||||||
|
|
||||||
|
return '<li data-dtr-index="'+idx.column+'">'+
|
||||||
|
'<span class="dtr-title">'+
|
||||||
|
title+
|
||||||
|
'</span> '+
|
||||||
|
'<span class="dtr-data">'+
|
||||||
|
cellData+
|
||||||
|
'</span>'+
|
||||||
|
'</li>';
|
||||||
|
} ).toArray().join('');
|
||||||
|
|
||||||
|
return data ?
|
||||||
|
$('<ul data-dtr-index="'+rowIdx+'"/>').append( data ) :
|
||||||
|
false;
|
||||||
|
},
|
||||||
|
|
||||||
|
target: 0,
|
||||||
|
|
||||||
|
type: 'inline'
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
|
||||||
|
/*
|
||||||
|
* API
|
||||||
|
*/
|
||||||
|
var Api = $.fn.dataTable.Api;
|
||||||
|
|
||||||
|
// Doesn't do anything - work around for a bug in DT... Not documented
|
||||||
|
Api.register( 'responsive()', function () {
|
||||||
|
return this;
|
||||||
|
} );
|
||||||
|
|
||||||
|
Api.register( 'responsive.index()', function ( li ) {
|
||||||
|
li = $(li);
|
||||||
|
|
||||||
|
return {
|
||||||
|
column: li.data('dtr-index'),
|
||||||
|
row: li.parent().data('dtr-index')
|
||||||
|
};
|
||||||
|
} );
|
||||||
|
|
||||||
|
Api.register( 'responsive.rebuild()', function () {
|
||||||
|
return this.iterator( 'table', function ( ctx ) {
|
||||||
|
if ( ctx._responsive ) {
|
||||||
|
ctx._responsive._classLogic();
|
||||||
|
}
|
||||||
|
} );
|
||||||
|
} );
|
||||||
|
|
||||||
|
Api.register( 'responsive.recalc()', function () {
|
||||||
|
return this.iterator( 'table', function ( ctx ) {
|
||||||
|
if ( ctx._responsive ) {
|
||||||
|
ctx._responsive._resizeAuto();
|
||||||
|
ctx._responsive._resize();
|
||||||
|
}
|
||||||
|
} );
|
||||||
|
} );
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Version information
|
||||||
|
*
|
||||||
|
* @name Responsive.version
|
||||||
|
* @static
|
||||||
|
*/
|
||||||
|
Responsive.version = '1.0.6';
|
||||||
|
|
||||||
|
|
||||||
|
$.fn.dataTable.Responsive = Responsive;
|
||||||
|
$.fn.DataTable.Responsive = Responsive;
|
||||||
|
|
||||||
|
// Attach a listener to the document which listens for DataTables initialisation
|
||||||
|
// events so we can automatically initialise
|
||||||
|
$(document).on( 'init.dt.dtr', function (e, settings, json) {
|
||||||
|
if ( e.namespace !== 'dt' ) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
if ( $(settings.nTable).hasClass( 'responsive' ) ||
|
||||||
|
$(settings.nTable).hasClass( 'dt-responsive' ) ||
|
||||||
|
settings.oInit.responsive ||
|
||||||
|
DataTable.defaults.responsive
|
||||||
|
) {
|
||||||
|
var init = settings.oInit.responsive;
|
||||||
|
|
||||||
|
if ( init !== false ) {
|
||||||
|
new Responsive( settings, $.isPlainObject( init ) ? init : {} );
|
||||||
|
}
|
||||||
|
}
|
||||||
|
} );
|
||||||
|
|
||||||
|
return Responsive;
|
||||||
|
}; // /factory
|
||||||
|
|
||||||
|
|
||||||
|
// Define as an AMD module if possible
|
||||||
|
if ( typeof define === 'function' && define.amd ) {
|
||||||
|
define( ['jquery', 'datatables'], factory );
|
||||||
|
}
|
||||||
|
else if ( typeof exports === 'object' ) {
|
||||||
|
// Node/CommonJS
|
||||||
|
factory( require('jquery'), require('datatables') );
|
||||||
|
}
|
||||||
|
else if ( jQuery && !jQuery.fn.dataTable.Responsive ) {
|
||||||
|
// Otherwise simply initialise as normal, stopping multiple evaluation
|
||||||
|
factory( jQuery, jQuery.fn.dataTable );
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
})(window, document);
|
||||||
@ -0,0 +1,19 @@
|
|||||||
|
/*!
|
||||||
|
Responsive 1.0.6
|
||||||
|
2014-2015 SpryMedia Ltd - datatables.net/license
|
||||||
|
*/
|
||||||
|
(function(n,p){var o=function(e,k){var h=function(d,a){if(!k.versionCheck||!k.versionCheck("1.10.1"))throw"DataTables Responsive requires DataTables 1.10.1 or newer";this.s={dt:new k.Api(d),columns:[]};this.s.dt.settings()[0].responsive||(a&&"string"===typeof a.details&&(a.details={type:a.details}),this.c=e.extend(!0,{},h.defaults,k.defaults.responsive,a),d.responsive=this,this._constructor())};h.prototype={_constructor:function(){var d=this,a=this.s.dt;a.settings()[0]._responsive=this;e(n).on("resize.dtr orientationchange.dtr",
|
||||||
|
a.settings()[0].oApi._fnThrottle(function(){d._resize()}));a.on("destroy.dtr",function(){e(n).off("resize.dtr orientationchange.dtr draw.dtr")});this.c.breakpoints.sort(function(a,c){return a.width<c.width?1:a.width>c.width?-1:0});this._classLogic();this._resizeAuto();var c=this.c.details;c.type&&(d._detailsInit(),this._detailsVis(),a.on("column-visibility.dtr",function(){d._detailsVis()}),a.on("draw.dtr",function(){a.rows({page:"current"}).iterator("row",function(b,c){var f=a.row(c);if(f.child.isShown()){var i=
|
||||||
|
d.c.details.renderer(a,c);f.child(i,"child").show()}})}),e(a.table().node()).addClass("dtr-"+c.type));this._resize()},_columnsVisiblity:function(d){var a=this.s.dt,c=this.s.columns,b,g,f=e.map(c,function(a){return a.auto&&null===a.minWidth?!1:!0===a.auto?"-":-1!==e.inArray(d,a.includeIn)}),i=0;b=0;for(g=f.length;b<g;b++)!0===f[b]&&(i+=c[b].minWidth);b=a.settings()[0].oScroll;b=b.sY||b.sX?b.iBarWidth:0;a=a.table().container().offsetWidth-b-i;b=0;for(g=f.length;b<g;b++)c[b].control&&(a-=c[b].minWidth);
|
||||||
|
i=!1;b=0;for(g=f.length;b<g;b++)"-"===f[b]&&!c[b].control&&(i||0>a-c[b].minWidth?(i=!0,f[b]=!1):f[b]=!0,a-=c[b].minWidth);a=!1;b=0;for(g=c.length;b<g;b++)if(!c[b].control&&!c[b].never&&!f[b]){a=!0;break}b=0;for(g=c.length;b<g;b++)c[b].control&&(f[b]=a);-1===e.inArray(!0,f)&&(f[0]=!0);return f},_classLogic:function(){var d=this,a=this.c.breakpoints,c=this.s.dt.columns().eq(0).map(function(a){a=this.column(a).header().className;return{className:a,includeIn:[],auto:!1,control:!1,never:a.match(/\bnever\b/)?
|
||||||
|
!0:!1}}),b=function(a,b){var d=c[a].includeIn;-1===e.inArray(b,d)&&d.push(b)},g=function(f,g,e,j){if(e)if("max-"===e){j=d._find(g).width;g=0;for(e=a.length;g<e;g++)a[g].width<=j&&b(f,a[g].name)}else if("min-"===e){j=d._find(g).width;g=0;for(e=a.length;g<e;g++)a[g].width>=j&&b(f,a[g].name)}else{if("not-"===e){g=0;for(e=a.length;g<e;g++)-1===a[g].name.indexOf(j)&&b(f,a[g].name)}}else c[f].includeIn.push(g)};c.each(function(b,c){for(var d=b.className.split(" "),j=!1,h=0,k=d.length;h<k;h++){var l=e.trim(d[h]);
|
||||||
|
if("all"===l){j=!0;b.includeIn=e.map(a,function(a){return a.name});return}if("none"===l||"never"===l){j=!0;return}if("control"===l){j=!0;b.control=!0;return}e.each(a,function(a,b){var d=b.name.split("-"),e=l.match(RegExp("(min\\-|max\\-|not\\-)?("+d[0]+")(\\-[_a-zA-Z0-9])?"));e&&(j=!0,e[2]===d[0]&&e[3]==="-"+d[1]?g(c,b.name,e[1],e[2]+e[3]):e[2]===d[0]&&!e[3]&&g(c,b.name,e[1],e[2]))})}j||(b.auto=!0)});this.s.columns=c},_detailsInit:function(){var d=this,a=this.s.dt,c=this.c.details;"inline"===c.type&&
|
||||||
|
(c.target="td:first-child");var b=c.target;e(a.table().body()).on("click","string"===typeof b?b:"td",function(){if(e(a.table().node()).hasClass("collapsed")&&a.row(e(this).closest("tr")).length){if(typeof b==="number"){var c=b<0?a.columns().eq(0).length+b:b;if(a.cell(this).index().column!==c)return}c=a.row(e(this).closest("tr"));if(c.child.isShown()){c.child(false);e(c.node()).removeClass("parent")}else{var f=d.c.details.renderer(a,c[0]);c.child(f,"child").show();e(c.node()).addClass("parent")}}})},
|
||||||
|
_detailsVis:function(){var d=this,a=this.s.dt,c=a.columns().indexes().filter(function(b){var c=a.column(b);return c.visible()?null:e(c.header()).hasClass("never")?null:b}),b=!0;if(0===c.length||1===c.length&&this.s.columns[c[0]].control)b=!1;b?a.rows({page:"current"}).eq(0).each(function(b){b=a.row(b);if(b.child()){var c=d.c.details.renderer(a,b[0]);!1===c?b.child.hide():b.child(c,"child").show()}}):a.rows({page:"current"}).eq(0).each(function(b){a.row(b).child.hide()})},_find:function(d){for(var a=
|
||||||
|
this.c.breakpoints,c=0,b=a.length;c<b;c++)if(a[c].name===d)return a[c]},_resize:function(){var d=this.s.dt,a=e(n).width(),c=this.c.breakpoints,b=c[0].name,g=this.s.columns,f;for(f=c.length-1;0<=f;f--)if(a<=c[f].width){b=c[f].name;break}var i=this._columnsVisiblity(b),c=!1;f=0;for(a=g.length;f<a;f++)if(!1===i[f]&&!g[f].never){c=!0;break}e(d.table().node()).toggleClass("collapsed",c);d.columns().eq(0).each(function(a,b){d.column(a).visible(i[b])})},_resizeAuto:function(){var d=this.s.dt,a=this.s.columns;
|
||||||
|
if(this.c.auto&&-1!==e.inArray(!0,e.map(a,function(a){return a.auto}))){d.table().node();var c=d.table().node().cloneNode(!1),b=e(d.table().header().cloneNode(!1)).appendTo(c),g=e(d.table().body().cloneNode(!1)).appendTo(c);e(d.table().footer()).clone(!1).appendTo(c);d.rows({page:"current"}).indexes().flatten().each(function(a){var b=d.row(a).node().cloneNode(!0);d.columns(":hidden").flatten().length&&e(b).append(d.cells(a,":hidden").nodes().to$().clone());e(b).appendTo(g)});var f=d.columns().header().to$().clone(!1);
|
||||||
|
e("<tr/>").append(f).appendTo(b);"inline"===this.c.details.type&&e(c).addClass("dtr-inline collapsed");c=e("<div/>").css({width:1,height:1,overflow:"hidden"}).append(c);c.find("th.never, td.never").remove();c.insertBefore(d.table().node());d.columns().eq(0).each(function(b){a[b].minWidth=f[b].offsetWidth||0});c.remove()}}};h.breakpoints=[{name:"desktop",width:Infinity},{name:"tablet-l",width:1024},{name:"tablet-p",width:768},{name:"mobile-l",width:480},{name:"mobile-p",width:320}];h.defaults={breakpoints:h.breakpoints,
|
||||||
|
auto:!0,details:{renderer:function(d,a){var c=d.cells(a,":hidden").eq(0).map(function(a){var c=e(d.column(a.column).header()),a=d.cell(a).index();if(c.hasClass("control")||c.hasClass("never"))return"";var f=d.settings()[0],f=f.oApi._fnGetCellData(f,a.row,a.column,"display");(c=c.text())&&(c+=":");return'<li data-dtr-index="'+a.column+'"><span class="dtr-title">'+c+'</span> <span class="dtr-data">'+f+"</span></li>"}).toArray().join("");return c?e('<ul data-dtr-index="'+a+'"/>').append(c):!1},target:0,
|
||||||
|
type:"inline"}};var m=e.fn.dataTable.Api;m.register("responsive()",function(){return this});m.register("responsive.index()",function(d){d=e(d);return{column:d.data("dtr-index"),row:d.parent().data("dtr-index")}});m.register("responsive.rebuild()",function(){return this.iterator("table",function(d){d._responsive&&d._responsive._classLogic()})});m.register("responsive.recalc()",function(){return this.iterator("table",function(d){d._responsive&&(d._responsive._resizeAuto(),d._responsive._resize())})});
|
||||||
|
h.version="1.0.6";e.fn.dataTable.Responsive=h;e.fn.DataTable.Responsive=h;e(p).on("init.dt.dtr",function(d,a){if("dt"===d.namespace&&(e(a.nTable).hasClass("responsive")||e(a.nTable).hasClass("dt-responsive")||a.oInit.responsive||k.defaults.responsive)){var c=a.oInit.responsive;!1!==c&&new h(a,e.isPlainObject(c)?c:{})}});return h};"function"===typeof define&&define.amd?define(["jquery","datatables"],o):"object"===typeof exports?o(require("jquery"),require("datatables")):jQuery&&!jQuery.fn.dataTable.Responsive&&
|
||||||
|
o(jQuery,jQuery.fn.dataTable)})(window,document);
|
||||||
@ -0,0 +1,44 @@
|
|||||||
|
|
||||||
|
/*
|
||||||
|
* Namespace: DTS (DataTables Scroller)
|
||||||
|
*/
|
||||||
|
|
||||||
|
div.DTS tbody th,
|
||||||
|
div.DTS tbody td {
|
||||||
|
white-space: nowrap;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.DTS tbody tr.even {
|
||||||
|
background-color: white;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.DTS div.DTS_Loading {
|
||||||
|
position: absolute;
|
||||||
|
top: 50%;
|
||||||
|
left: 50%;
|
||||||
|
width: 200px;
|
||||||
|
height: 20px;
|
||||||
|
margin-top: -20px;
|
||||||
|
margin-left: -100px;
|
||||||
|
z-index: 1;
|
||||||
|
|
||||||
|
border: 1px solid #999;
|
||||||
|
padding: 20px 0;
|
||||||
|
text-align: center;
|
||||||
|
background-color: white;
|
||||||
|
background-color: rgba(255, 255, 255, 0.5);
|
||||||
|
}
|
||||||
|
|
||||||
|
div.DTS div.dataTables_scrollHead,
|
||||||
|
div.DTS div.dataTables_scrollFoot {
|
||||||
|
background-color: white;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.DTS div.dataTables_scrollBody {
|
||||||
|
z-index: 2;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.DTS div.dataTables_scroll {
|
||||||
|
background: url('../images/loading-background.png') repeat 0 0;
|
||||||
|
}
|
||||||
|
|
||||||
@ -0,0 +1 @@
|
|||||||
|
div.DTS tbody th,div.DTS tbody td{white-space:nowrap}div.DTS tbody tr.even{background-color:white}div.DTS div.DTS_Loading{position:absolute;top:50%;left:50%;width:200px;height:20px;margin-top:-20px;margin-left:-100px;z-index:1;border:1px solid #999;padding:20px 0;text-align:center;background-color:white;background-color:rgba(255,255,255,0.5)}div.DTS div.dataTables_scrollHead,div.DTS div.dataTables_scrollFoot{background-color:white}div.DTS div.dataTables_scrollBody{z-index:2}div.DTS div.dataTables_scroll{background:url("../images/loading-background.png") repeat 0 0}
|
||||||
|
After Width: | Height: | Size: 1013 B |
@ -0,0 +1,25 @@
|
|||||||
|
/*!
|
||||||
|
Scroller 1.2.2
|
||||||
|
©2011-2014 SpryMedia Ltd - datatables.net/license
|
||||||
|
*/
|
||||||
|
(function(m,n,k){var l=function(e){var g=function(a,b){!this instanceof g?alert("Scroller warning: Scroller must be initialised with the 'new' keyword."):("undefined"==typeof b&&(b={}),this.s={dt:a,tableTop:0,tableBottom:0,redrawTop:0,redrawBottom:0,autoHeight:!0,viewportRows:0,stateTO:null,drawTO:null,heights:{jump:null,page:null,virtual:null,scroll:null,row:null,viewport:null},topRowFloat:0,scrollDrawDiff:null,loaderVisible:!1},this.s=e.extend(this.s,g.oDefaults,b),this.s.heights.row=this.s.rowHeight,
|
||||||
|
this.dom={force:n.createElement("div"),scroller:null,table:null,loader:null},this.s.dt.oScroller=this,this._fnConstruct())};g.prototype={fnRowToPixels:function(a,b,c){a=c?this._domain("virtualToPhysical",a*this.s.heights.row):this.s.baseScrollTop+(a-this.s.baseRowTop)*this.s.heights.row;return b||b===k?parseInt(a,10):a},fnPixelsToRow:function(a,b,c){var d=a-this.s.baseScrollTop,a=c?this._domain("physicalToVirtual",a)/this.s.heights.row:d/this.s.heights.row+this.s.baseRowTop;return b||b===k?parseInt(a,
|
||||||
|
10):a},fnScrollToRow:function(a,b){var c=this,d=!1,f=this.fnRowToPixels(a),h=a-(this.s.displayBuffer-1)/2*this.s.viewportRows;0>h&&(h=0);if((f>this.s.redrawBottom||f<this.s.redrawTop)&&this.s.dt._iDisplayStart!==h)d=!0,f=this.fnRowToPixels(a,!1,!0);"undefined"==typeof b||b?(this.s.ani=d,e(this.dom.scroller).animate({scrollTop:f},function(){setTimeout(function(){c.s.ani=!1},25)})):e(this.dom.scroller).scrollTop(f)},fnMeasure:function(a){this.s.autoHeight&&this._fnCalcRowHeight();var b=this.s.heights;
|
||||||
|
b.viewport=e(this.dom.scroller).height();this.s.viewportRows=parseInt(b.viewport/b.row,10)+1;this.s.dt._iDisplayLength=this.s.viewportRows*this.s.displayBuffer;(a===k||a)&&this.s.dt.oInstance.fnDraw()},_fnConstruct:function(){var a=this;if(this.s.dt.oFeatures.bPaginate){this.dom.force.style.position="absolute";this.dom.force.style.top="0px";this.dom.force.style.left="0px";this.dom.force.style.width="1px";this.dom.scroller=e("div."+this.s.dt.oClasses.sScrollBody,this.s.dt.nTableWrapper)[0];this.dom.scroller.appendChild(this.dom.force);
|
||||||
|
this.dom.scroller.style.position="relative";this.dom.table=e(">table",this.dom.scroller)[0];this.dom.table.style.position="absolute";this.dom.table.style.top="0px";this.dom.table.style.left="0px";e(this.s.dt.nTableWrapper).addClass("DTS");this.s.loadingIndicator&&(this.dom.loader=e('<div class="DTS_Loading">'+this.s.dt.oLanguage.sLoadingRecords+"</div>").css("display","none"),e(this.dom.scroller.parentNode).css("position","relative").append(this.dom.loader));this.s.heights.row&&"auto"!=this.s.heights.row&&
|
||||||
|
(this.s.autoHeight=!1);this.fnMeasure(!1);this.s.ingnoreScroll=!0;this.s.stateSaveThrottle=this.s.dt.oApi._fnThrottle(function(){a.s.dt.oApi._fnSaveState(a.s.dt)},500);e(this.dom.scroller).on("scroll.DTS",function(){a._fnScroll.call(a)});e(this.dom.scroller).on("touchstart.DTS",function(){a._fnScroll.call(a)});this.s.dt.aoDrawCallback.push({fn:function(){a.s.dt.bInitialised&&a._fnDrawCallback.call(a)},sName:"Scroller"});e(m).on("resize.DTS",function(){a.fnMeasure(false);a._fnInfo()});var b=!0;this.s.dt.oApi._fnCallbackReg(this.s.dt,
|
||||||
|
"aoStateSaveParams",function(c,d){if(b&&a.s.dt.oLoadedState){d.iScroller=a.s.dt.oLoadedState.iScroller;d.iScrollerTopRow=a.s.dt.oLoadedState.iScrollerTopRow;b=false}else{d.iScroller=a.dom.scroller.scrollTop;d.iScrollerTopRow=a.s.topRowFloat}},"Scroller_State");this.s.dt.oLoadedState&&(this.s.topRowFloat=this.s.dt.oLoadedState.iScrollerTopRow||0);this.s.dt.aoDestroyCallback.push({sName:"Scroller",fn:function(){e(m).off("resize.DTS");e(a.dom.scroller).off("touchstart.DTS scroll.DTS");e(a.s.dt.nTableWrapper).removeClass("DTS");
|
||||||
|
e("div.DTS_Loading",a.dom.scroller.parentNode).remove();a.dom.table.style.position="";a.dom.table.style.top="";a.dom.table.style.left=""}})}else this.s.dt.oApi._fnLog(this.s.dt,0,"Pagination must be enabled for Scroller")},_fnScroll:function(){var a=this,b=this.s.heights,c=this.dom.scroller.scrollTop,d;if(!this.s.skip&&!this.s.ingnoreScroll)if(this.s.dt.bFiltered||this.s.dt.bSorted)this.s.lastScrollTop=0;else{this._fnInfo();clearTimeout(this.s.stateTO);this.s.stateTO=setTimeout(function(){a.s.dt.oApi._fnSaveState(a.s.dt)},
|
||||||
|
250);if(c<this.s.redrawTop||c>this.s.redrawBottom){var f=Math.ceil((this.s.displayBuffer-1)/2*this.s.viewportRows);Math.abs(c-this.s.lastScrollTop)>b.viewport||this.s.ani?(d=parseInt(this._domain("physicalToVirtual",c)/b.row,10)-f,this.s.topRowFloat=this._domain("physicalToVirtual",c)/b.row):(d=this.fnPixelsToRow(c)-f,this.s.topRowFloat=this.fnPixelsToRow(c,!1));0>=d?d=0:d+this.s.dt._iDisplayLength>this.s.dt.fnRecordsDisplay()?(d=this.s.dt.fnRecordsDisplay()-this.s.dt._iDisplayLength,0>d&&(d=0)):
|
||||||
|
0!==d%2&&d++;if(d!=this.s.dt._iDisplayStart&&(this.s.tableTop=e(this.s.dt.nTable).offset().top,this.s.tableBottom=e(this.s.dt.nTable).height()+this.s.tableTop,b=function(){if(a.s.scrollDrawReq===null)a.s.scrollDrawReq=c;a.s.dt._iDisplayStart=d;a.s.dt.oApi._fnCalculateEnd&&a.s.dt.oApi._fnCalculateEnd(a.s.dt);a.s.dt.oApi._fnDraw(a.s.dt)},this.s.dt.oFeatures.bServerSide?(clearTimeout(this.s.drawTO),this.s.drawTO=setTimeout(b,this.s.serverWait)):b(),this.dom.loader&&!this.s.loaderVisible))this.dom.loader.css("display",
|
||||||
|
"block"),this.s.loaderVisible=!0}this.s.lastScrollTop=c;this.s.stateSaveThrottle()}},_domain:function(a,b){var c=this.s.heights,d;if(c.virtual===c.scroll){d=(c.virtual-c.viewport)/(c.scroll-c.viewport);if("virtualToPhysical"===a)return b/d;if("physicalToVirtual"===a)return b*d}var e=(c.scroll-c.viewport)/2,h=(c.virtual-c.viewport)/2;d=h/(e*e);if("virtualToPhysical"===a){if(b<h)return Math.pow(b/d,0.5);b=2*h-b;return 0>b?c.scroll:2*e-Math.pow(b/d,0.5)}if("physicalToVirtual"===a){if(b<e)return b*b*
|
||||||
|
d;b=2*e-b;return 0>b?c.virtual:2*h-b*b*d}},_fnDrawCallback:function(){var a=this,b=this.s.heights,c=this.dom.scroller.scrollTop,d=e(this.s.dt.nTable).height(),f=this.s.dt._iDisplayStart,h=this.s.dt._iDisplayLength,g=this.s.dt.fnRecordsDisplay();this.s.skip=!0;this._fnScrollForce();c=0===f?this.s.topRowFloat*b.row:f+h>=g?b.scroll-(g-this.s.topRowFloat)*b.row:this._domain("virtualToPhysical",this.s.topRowFloat*b.row);this.dom.scroller.scrollTop=c;this.s.baseScrollTop=c;this.s.baseRowTop=this.s.topRowFloat;
|
||||||
|
var j=c-(this.s.topRowFloat-f)*b.row;0===f?j=0:f+h>=g&&(j=b.scroll-d);this.dom.table.style.top=j+"px";this.s.tableTop=j;this.s.tableBottom=d+this.s.tableTop;d=(c-this.s.tableTop)*this.s.boundaryScale;this.s.redrawTop=c-d;this.s.redrawBottom=c+d;this.s.skip=!1;this.s.dt.oFeatures.bStateSave&&null!==this.s.dt.oLoadedState&&"undefined"!=typeof this.s.dt.oLoadedState.iScroller?((c=(this.s.dt.sAjaxSource||a.s.dt.ajax)&&!this.s.dt.oFeatures.bServerSide?!0:!1)&&2==this.s.dt.iDraw||!c&&1==this.s.dt.iDraw)&&
|
||||||
|
setTimeout(function(){e(a.dom.scroller).scrollTop(a.s.dt.oLoadedState.iScroller);a.s.redrawTop=a.s.dt.oLoadedState.iScroller-b.viewport/2;setTimeout(function(){a.s.ingnoreScroll=!1},0)},0):a.s.ingnoreScroll=!1;setTimeout(function(){a._fnInfo.call(a)},0);this.dom.loader&&this.s.loaderVisible&&(this.dom.loader.css("display","none"),this.s.loaderVisible=!1)},_fnScrollForce:function(){var a=this.s.heights;a.virtual=a.row*this.s.dt.fnRecordsDisplay();a.scroll=a.virtual;1E6<a.scroll&&(a.scroll=1E6);this.dom.force.style.height=
|
||||||
|
a.scroll+"px"},_fnCalcRowHeight:function(){var a=this.s.dt,b=a.nTable,c=b.cloneNode(!1),d=e("<tbody/>").appendTo(c),f=e('<div class="'+a.oClasses.sWrapper+' DTS"><div class="'+a.oClasses.sScrollWrapper+'"><div class="'+a.oClasses.sScrollBody+'"></div></div></div>');for(e("tbody tr:lt(4)",b).clone().appendTo(d);3>e("tr",d).length;)d.append("<tr><td> </td></tr>");e("div."+a.oClasses.sScrollBody,f).append(c);a._bInitComplete?a=b.parentNode:(this.s.dt.nHolding||(this.s.dt.nHolding=e("<div></div>").insertBefore(this.s.dt.nTable)),
|
||||||
|
a=this.s.dt.nHolding);f.appendTo(a);this.s.heights.row=e("tr",d).eq(1).outerHeight();f.remove()},_fnInfo:function(){if(this.s.dt.oFeatures.bInfo){var a=this.s.dt,b=a.oLanguage,c=this.dom.scroller.scrollTop,d=Math.floor(this.fnPixelsToRow(c,!1,this.s.ani)+1),f=a.fnRecordsTotal(),h=a.fnRecordsDisplay(),c=Math.ceil(this.fnPixelsToRow(c+this.s.heights.viewport,!1,this.s.ani)),c=h<c?h:c,g=a.fnFormatNumber(d),j=a.fnFormatNumber(c),i=a.fnFormatNumber(f),k=a.fnFormatNumber(h),g=0===a.fnRecordsDisplay()&&
|
||||||
|
a.fnRecordsDisplay()==a.fnRecordsTotal()?b.sInfoEmpty+b.sInfoPostFix:0===a.fnRecordsDisplay()?b.sInfoEmpty+" "+b.sInfoFiltered.replace("_MAX_",i)+b.sInfoPostFix:a.fnRecordsDisplay()==a.fnRecordsTotal()?b.sInfo.replace("_START_",g).replace("_END_",j).replace("_MAX_",i).replace("_TOTAL_",k)+b.sInfoPostFix:b.sInfo.replace("_START_",g).replace("_END_",j).replace("_MAX_",i).replace("_TOTAL_",k)+" "+b.sInfoFiltered.replace("_MAX_",a.fnFormatNumber(a.fnRecordsTotal()))+b.sInfoPostFix;(b=b.fnInfoCallback)&&
|
||||||
|
(g=b.call(a.oInstance,a,d,c,f,h,g));a=a.aanFeatures.i;if("undefined"!=typeof a){d=0;for(f=a.length;d<f;d++)e(a[d]).html(g)}}}};g.defaults={trace:!1,rowHeight:"auto",serverWait:200,displayBuffer:9,boundaryScale:0.5,loadingIndicator:!1};g.oDefaults=g.defaults;g.version="1.2.2";"function"==typeof e.fn.dataTable&&"function"==typeof e.fn.dataTableExt.fnVersionCheck&&e.fn.dataTableExt.fnVersionCheck("1.9.0")?e.fn.dataTableExt.aoFeatures.push({fnInit:function(a){var b=a.oInit;return(new g(a,b.scroller||
|
||||||
|
b.oScroller||{})).dom.wrapper},cFeature:"S",sFeature:"Scroller"}):alert("Warning: Scroller requires DataTables 1.9.0 or greater - www.datatables.net/download");e.fn.dataTable.Scroller=g;e.fn.DataTable.Scroller=g;if(e.fn.dataTable.Api){var i=e.fn.dataTable.Api;i.register("scroller()",function(){return this});i.register("scroller().rowToPixels()",function(a,b,c){var d=this.context;if(d.length&&d[0].oScroller)return d[0].oScroller.fnRowToPixels(a,b,c)});i.register("scroller().pixelsToRow()",function(a,
|
||||||
|
b,c){var d=this.context;if(d.length&&d[0].oScroller)return d[0].oScroller.fnPixelsToRow(a,b,c)});i.register("scroller().scrollToRow()",function(a,b){this.iterator("table",function(c){c.oScroller&&c.oScroller.fnScrollToRow(a,b)});return this});i.register("scroller().measure()",function(a){this.iterator("table",function(b){b.oScroller&&b.oScroller.fnMeasure(a)});return this})}return g};"function"===typeof define&&define.amd?define(["jquery","datatables"],l):"object"===typeof exports?l(require("jquery"),
|
||||||
|
require("datatables")):jQuery&&!jQuery.fn.dataTable.Scroller&&l(jQuery,jQuery.fn.dataTable)})(window,document);
|
||||||
@ -0,0 +1,361 @@
|
|||||||
|
/*
|
||||||
|
* File: TableTools.css
|
||||||
|
* Description: Styles for TableTools 2
|
||||||
|
* Author: Allan Jardine (www.sprymedia.co.uk)
|
||||||
|
* Language: Javascript
|
||||||
|
* License: GPL v2 / 3 point BSD
|
||||||
|
* Project: DataTables
|
||||||
|
*
|
||||||
|
* Copyright 2009-2012 Allan Jardine, all rights reserved.
|
||||||
|
*
|
||||||
|
* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
|
||||||
|
*
|
||||||
|
* CSS name space:
|
||||||
|
* DTTT DataTables TableTools
|
||||||
|
*
|
||||||
|
* Style sheet provides:
|
||||||
|
* CONTAINER TableTools container element and styles applying to all components
|
||||||
|
* BUTTON_STYLES Action specific button styles
|
||||||
|
* SELECTING Row selection styles
|
||||||
|
* COLLECTIONS Drop down list (collection) styles
|
||||||
|
* PRINTING Print display styles
|
||||||
|
*/
|
||||||
|
|
||||||
|
|
||||||
|
/*
|
||||||
|
* CONTAINER
|
||||||
|
* TableTools container element and styles applying to all components
|
||||||
|
*/
|
||||||
|
div.DTTT_container {
|
||||||
|
position: relative;
|
||||||
|
float: right;
|
||||||
|
margin-bottom: 1em;
|
||||||
|
}
|
||||||
|
|
||||||
|
@media screen and (max-width: 640px) {
|
||||||
|
div.DTTT_container {
|
||||||
|
float: none !important;
|
||||||
|
text-align: center;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.DTTT_container:after {
|
||||||
|
visibility: hidden;
|
||||||
|
display: block;
|
||||||
|
content: "";
|
||||||
|
clear: both;
|
||||||
|
height: 0;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
button.DTTT_button,
|
||||||
|
div.DTTT_button,
|
||||||
|
a.DTTT_button {
|
||||||
|
position: relative;
|
||||||
|
display: inline-block;
|
||||||
|
margin-right: 3px;
|
||||||
|
padding: 5px 8px;
|
||||||
|
border: 1px solid #999;
|
||||||
|
cursor: pointer;
|
||||||
|
*cursor: hand;
|
||||||
|
font-size: 0.88em;
|
||||||
|
color: black !important;
|
||||||
|
|
||||||
|
-webkit-border-radius: 2px;
|
||||||
|
-moz-border-radius: 2px;
|
||||||
|
-ms-border-radius: 2px;
|
||||||
|
-o-border-radius: 2px;
|
||||||
|
border-radius: 2px;
|
||||||
|
|
||||||
|
-webkit-box-shadow: 1px 1px 3px #ccc;
|
||||||
|
-moz-box-shadow: 1px 1px 3px #ccc;
|
||||||
|
-ms-box-shadow: 1px 1px 3px #ccc;
|
||||||
|
-o-box-shadow: 1px 1px 3px #ccc;
|
||||||
|
box-shadow: 1px 1px 3px #ccc;
|
||||||
|
|
||||||
|
/* Generated by http://www.colorzilla.com/gradient-editor/ */
|
||||||
|
background: #ffffff; /* Old browsers */
|
||||||
|
background: -webkit-linear-gradient(top, #ffffff 0%,#f3f3f3 89%,#f9f9f9 100%); /* Chrome10+,Safari5.1+ */
|
||||||
|
background: -moz-linear-gradient(top, #ffffff 0%,#f3f3f3 89%,#f9f9f9 100%); /* FF3.6+ */
|
||||||
|
background: -ms-linear-gradient(top, #ffffff 0%,#f3f3f3 89%,#f9f9f9 100%); /* IE10+ */
|
||||||
|
background: -o-linear-gradient(top, #ffffff 0%,#f3f3f3 89%,#f9f9f9 100%); /* Opera 11.10+ */
|
||||||
|
background: linear-gradient(top, #ffffff 0%,#f3f3f3 89%,#f9f9f9 100%); /* W3C */
|
||||||
|
filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#ffffff', endColorstr='#f9f9f9',GradientType=0 ); /* IE6-9 */
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/* Buttons are cunning border-box sizing - we can't just use that for A and DIV due to IE6/7 */
|
||||||
|
button.DTTT_button {
|
||||||
|
height: 30px;
|
||||||
|
padding: 3px 8px;
|
||||||
|
}
|
||||||
|
|
||||||
|
.DTTT_button embed {
|
||||||
|
outline: none;
|
||||||
|
}
|
||||||
|
|
||||||
|
button.DTTT_button:hover:not(.DTTT_disabled),
|
||||||
|
div.DTTT_button:hover:not(.DTTT_disabled),
|
||||||
|
a.DTTT_button:hover:not(.DTTT_disabled) {
|
||||||
|
border: 1px solid #666;
|
||||||
|
text-decoration: none !important;
|
||||||
|
|
||||||
|
-webkit-box-shadow: 1px 1px 3px #999;
|
||||||
|
-moz-box-shadow: 1px 1px 3px #999;
|
||||||
|
-ms-box-shadow: 1px 1px 3px #999;
|
||||||
|
-o-box-shadow: 1px 1px 3px #999;
|
||||||
|
box-shadow: 1px 1px 3px #999;
|
||||||
|
|
||||||
|
background: #f3f3f3; /* Old browsers */
|
||||||
|
background: -webkit-linear-gradient(top, #f3f3f3 0%,#e2e2e2 89%,#f4f4f4 100%); /* Chrome10+,Safari5.1+ */
|
||||||
|
background: -moz-linear-gradient(top, #f3f3f3 0%,#e2e2e2 89%,#f4f4f4 100%); /* FF3.6+ */
|
||||||
|
background: -ms-linear-gradient(top, #f3f3f3 0%,#e2e2e2 89%,#f4f4f4 100%); /* IE10+ */
|
||||||
|
background: -o-linear-gradient(top, #f3f3f3 0%,#e2e2e2 89%,#f4f4f4 100%); /* Opera 11.10+ */
|
||||||
|
background: linear-gradient(top, #f3f3f3 0%,#e2e2e2 89%,#f4f4f4 100%); /* W3C */
|
||||||
|
filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#f3f3f3', endColorstr='#f4f4f4',GradientType=0 ); /* IE6-9 */
|
||||||
|
}
|
||||||
|
|
||||||
|
button.DTTT_button:focus,
|
||||||
|
div.DTTT_button:focus,
|
||||||
|
a.DTTT_button:focus {
|
||||||
|
border: 1px solid #426c9e;
|
||||||
|
text-shadow: 0 1px 0 #c4def1;
|
||||||
|
outline: none;
|
||||||
|
|
||||||
|
background-color: #a3d0ef 100%;
|
||||||
|
background-image: -webkit-linear-gradient(top, #a3d0ef 0%, #79ace9 65%, #a3d0ef 100%);
|
||||||
|
background-image: -moz-linear-gradient(top, #a3d0ef 0%, #79ace9 65%, #a3d0ef 100%);
|
||||||
|
background-image: -ms-linear-gradient(top, #a3d0ef 0%, #79ace9 65%, #a3d0ef 100%);
|
||||||
|
background-image: -o-linear-gradient(top, #a3d0ef 0%, #79ace9 65%, #a3d0ef 100%);
|
||||||
|
background-image: linear-gradient(top, #a3d0ef 0%, #79ace9 65%, #a3d0ef 100%);
|
||||||
|
filter: progid:DXImageTransform.Microsoft.gradient(GradientType=0,StartColorStr='#a3d0ef', EndColorStr='#a3d0ef');
|
||||||
|
}
|
||||||
|
|
||||||
|
button.DTTT_button:active:not(.DTTT_disabled),
|
||||||
|
div.DTTT_button:active:not(.DTTT_disabled),
|
||||||
|
a.DTTT_button:active:not(.DTTT_disabled) {
|
||||||
|
-webkit-box-shadow: inset 1px 1px 3px #999999;
|
||||||
|
-moz-box-shadow: inset 1px 1px 3px #999999;
|
||||||
|
box-shadow: inset 1px 1px 3px #999999;
|
||||||
|
}
|
||||||
|
|
||||||
|
button.DTTT_disabled,
|
||||||
|
div.DTTT_disabled,
|
||||||
|
a.DTTT_disabled {
|
||||||
|
color: #999 !important;
|
||||||
|
border: 1px solid #d0d0d0;
|
||||||
|
cursor: default;
|
||||||
|
background: #ffffff; /* Old browsers */
|
||||||
|
background: -webkit-linear-gradient(top, #ffffff 0%,#f9f9f9 89%,#fafafa 100%); /* Chrome10+,Safari5.1+ */
|
||||||
|
background: -moz-linear-gradient(top, #ffffff 0%,#f9f9f9 89%,#fafafa 100%); /* FF3.6+ */
|
||||||
|
background: -ms-linear-gradient(top, #ffffff 0%,#f9f9f9 89%,#fafafa 100%); /* IE10+ */
|
||||||
|
background: -o-linear-gradient(top, #ffffff 0%,#f9f9f9 89%,#fafafa 100%); /* Opera 11.10+ */
|
||||||
|
background: linear-gradient(top, #ffffff 0%,#f9f9f9 89%,#fafafa 100%); /* W3C */
|
||||||
|
filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#ffffff', endColorstr='#fafafa',GradientType=0 ); /* IE6-9 */
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
/*
|
||||||
|
* BUTTON_STYLES
|
||||||
|
* Action specific button styles
|
||||||
|
* If you want images - comment this back in
|
||||||
|
|
||||||
|
a.DTTT_button_csv,
|
||||||
|
a.DTTT_button_xls,
|
||||||
|
a.DTTT_button_copy,
|
||||||
|
a.DTTT_button_pdf,
|
||||||
|
a.DTTT_button_print {
|
||||||
|
padding-right: 0px;
|
||||||
|
}
|
||||||
|
|
||||||
|
a.DTTT_button_csv span,
|
||||||
|
a.DTTT_button_xls span,
|
||||||
|
a.DTTT_button_copy span,
|
||||||
|
a.DTTT_button_pdf span,
|
||||||
|
a.DTTT_button_print span {
|
||||||
|
display: inline-block;
|
||||||
|
height: 24px;
|
||||||
|
line-height: 24px;
|
||||||
|
padding-right: 30px;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
a.DTTT_button_csv span { background: url(../images/csv.png) no-repeat bottom right; }
|
||||||
|
a.DTTT_button_csv:hover span { background: url(../images/csv_hover.png) no-repeat center right; }
|
||||||
|
|
||||||
|
a.DTTT_button_xls span { background: url(../images/xls.png) no-repeat center right; }
|
||||||
|
a.DTTT_button_xls:hover span { background: #f0f0f0 url(../images/xls_hover.png) no-repeat center right; }
|
||||||
|
|
||||||
|
a.DTTT_button_copy span { background: url(../images/copy.png) no-repeat center right; }
|
||||||
|
a.DTTT_button_copy:hover span { background: #f0f0f0 url(../images/copy_hover.png) no-repeat center right; }
|
||||||
|
|
||||||
|
a.DTTT_button_pdf span { background: url(../images/pdf.png) no-repeat center right; }
|
||||||
|
a.DTTT_button_pdf:hover span { background: #f0f0f0 url(../images/pdf_hover.png) no-repeat center right; }
|
||||||
|
|
||||||
|
a.DTTT_button_print span { background: url(../images/print.png) no-repeat center right; }
|
||||||
|
a.DTTT_button_print:hover span { background: #f0f0f0 url(../images/print_hover.png) no-repeat center right; }
|
||||||
|
|
||||||
|
*/
|
||||||
|
|
||||||
|
button.DTTT_button_collection span {
|
||||||
|
padding-right: 17px;
|
||||||
|
background: url(../images/collection.png) no-repeat center right;
|
||||||
|
}
|
||||||
|
|
||||||
|
button.DTTT_button_collection:hover span {
|
||||||
|
padding-right: 17px;
|
||||||
|
background: #f0f0f0 url(../images/collection_hover.png) no-repeat center right;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/*
|
||||||
|
* SELECTING
|
||||||
|
* Row selection styles
|
||||||
|
*/
|
||||||
|
table.DTTT_selectable tbody tr {
|
||||||
|
cursor: pointer;
|
||||||
|
*cursor: hand;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.dataTable tr.DTTT_selected.odd {
|
||||||
|
background-color: #9FAFD1;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.dataTable tr.DTTT_selected.odd td.sorting_1 {
|
||||||
|
background-color: #9FAFD1;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.dataTable tr.DTTT_selected.odd td.sorting_2 {
|
||||||
|
background-color: #9FAFD1;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.dataTable tr.DTTT_selected.odd td.sorting_3 {
|
||||||
|
background-color: #9FAFD1;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
table.dataTable tr.DTTT_selected.even {
|
||||||
|
background-color: #B0BED9;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.dataTable tr.DTTT_selected.even td.sorting_1 {
|
||||||
|
background-color: #B0BED9;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.dataTable tr.DTTT_selected.even td.sorting_2 {
|
||||||
|
background-color: #B0BED9;
|
||||||
|
}
|
||||||
|
|
||||||
|
table.dataTable tr.DTTT_selected.even td.sorting_3 {
|
||||||
|
background-color: #B0BED9;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/*
|
||||||
|
* COLLECTIONS
|
||||||
|
* Drop down list (collection) styles
|
||||||
|
*/
|
||||||
|
|
||||||
|
div.DTTT_collection {
|
||||||
|
width: 150px;
|
||||||
|
padding: 8px 8px 4px 8px;
|
||||||
|
border: 1px solid #ccc;
|
||||||
|
border: 1px solid rgba( 0, 0, 0, 0.4 );
|
||||||
|
background-color: #f3f3f3;
|
||||||
|
background-color: rgba( 255, 255, 255, 0.3 );
|
||||||
|
overflow: hidden;
|
||||||
|
z-index: 2002;
|
||||||
|
|
||||||
|
-webkit-border-radius: 5px;
|
||||||
|
-moz-border-radius: 5px;
|
||||||
|
-ms-border-radius: 5px;
|
||||||
|
-o-border-radius: 5px;
|
||||||
|
border-radius: 5px;
|
||||||
|
|
||||||
|
-webkit-box-shadow: 3px 3px 5px rgba(0, 0, 0, 0.3);
|
||||||
|
-moz-box-shadow: 3px 3px 5px rgba(0, 0, 0, 0.3);
|
||||||
|
-ms-box-shadow: 3px 3px 5px rgba(0, 0, 0, 0.3);
|
||||||
|
-o-box-shadow: 3px 3px 5px rgba(0, 0, 0, 0.3);
|
||||||
|
box-shadow: 3px 3px 5px rgba(0, 0, 0, 0.3);
|
||||||
|
}
|
||||||
|
|
||||||
|
div.DTTT_collection_background {
|
||||||
|
background: black;
|
||||||
|
z-index: 2001;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.DTTT_collection button.DTTT_button,
|
||||||
|
div.DTTT_collection div.DTTT_button,
|
||||||
|
div.DTTT_collection a.DTTT_button {
|
||||||
|
position: relative;
|
||||||
|
left: 0;
|
||||||
|
right: 0;
|
||||||
|
|
||||||
|
display: block;
|
||||||
|
float: none;
|
||||||
|
margin-bottom: 4px;
|
||||||
|
|
||||||
|
-webkit-box-shadow: 1px 1px 3px #999;
|
||||||
|
-moz-box-shadow: 1px 1px 3px #999;
|
||||||
|
-ms-box-shadow: 1px 1px 3px #999;
|
||||||
|
-o-box-shadow: 1px 1px 3px #999;
|
||||||
|
box-shadow: 1px 1px 3px #999;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/*
|
||||||
|
* PRINTING
|
||||||
|
* Print display styles
|
||||||
|
*/
|
||||||
|
|
||||||
|
.DTTT_print_info {
|
||||||
|
position: fixed;
|
||||||
|
top: 50%;
|
||||||
|
left: 50%;
|
||||||
|
width: 400px;
|
||||||
|
height: 150px;
|
||||||
|
margin-left: -200px;
|
||||||
|
margin-top: -75px;
|
||||||
|
text-align: center;
|
||||||
|
color: #333;
|
||||||
|
padding: 10px 30px;
|
||||||
|
|
||||||
|
background: #ffffff; /* Old browsers */
|
||||||
|
background: -webkit-linear-gradient(top, #ffffff 0%,#f3f3f3 89%,#f9f9f9 100%); /* Chrome10+,Safari5.1+ */
|
||||||
|
background: -moz-linear-gradient(top, #ffffff 0%,#f3f3f3 89%,#f9f9f9 100%); /* FF3.6+ */
|
||||||
|
background: -ms-linear-gradient(top, #ffffff 0%,#f3f3f3 89%,#f9f9f9 100%); /* IE10+ */
|
||||||
|
background: -o-linear-gradient(top, #ffffff 0%,#f3f3f3 89%,#f9f9f9 100%); /* Opera 11.10+ */
|
||||||
|
background: linear-gradient(top, #ffffff 0%,#f3f3f3 89%,#f9f9f9 100%); /* W3C */
|
||||||
|
filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#ffffff', endColorstr='#f9f9f9',GradientType=0 ); /* IE6-9 */
|
||||||
|
|
||||||
|
opacity: 0.95;
|
||||||
|
|
||||||
|
border: 1px solid black;
|
||||||
|
border: 1px solid rgba(0, 0, 0, 0.5);
|
||||||
|
|
||||||
|
-webkit-border-radius: 6px;
|
||||||
|
-moz-border-radius: 6px;
|
||||||
|
-ms-border-radius: 6px;
|
||||||
|
-o-border-radius: 6px;
|
||||||
|
border-radius: 6px;
|
||||||
|
|
||||||
|
-webkit-box-shadow: 0 3px 7px rgba(0, 0, 0, 0.5);
|
||||||
|
-moz-box-shadow: 0 3px 7px rgba(0, 0, 0, 0.5);
|
||||||
|
-ms-box-shadow: 0 3px 7px rgba(0, 0, 0, 0.5);
|
||||||
|
-o-box-shadow: 0 3px 7px rgba(0, 0, 0, 0.5);
|
||||||
|
box-shadow: 0 3px 7px rgba(0, 0, 0, 0.5);
|
||||||
|
}
|
||||||
|
|
||||||
|
.DTTT_print_info h6 {
|
||||||
|
font-weight: normal;
|
||||||
|
font-size: 28px;
|
||||||
|
line-height: 28px;
|
||||||
|
margin: 1em;
|
||||||
|
}
|
||||||
|
|
||||||
|
.DTTT_print_info p {
|
||||||
|
font-size: 14px;
|
||||||
|
line-height: 20px;
|
||||||
|
}
|
||||||
|
|
||||||
|
After Width: | Height: | Size: 1.1 KiB |